(self["webpackChunklandrick_angular"] = self["webpackChunklandrick_angular"] || []).push([["vendor"],{
/***/ 17238:
/*!******************************************************************************!*\
!*** ./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js ***!
\******************************************************************************/
/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */ "AUTO_STYLE": function() { return /* binding */ AUTO_STYLE; },
/* harmony export */ "AnimationBuilder": function() { return /* binding */ AnimationBuilder; },
/* harmony export */ "AnimationFactory": function() { return /* binding */ AnimationFactory; },
/* harmony export */ "NoopAnimationPlayer": function() { return /* binding */ NoopAnimationPlayer; },
/* harmony export */ "animate": function() { return /* binding */ animate; },
/* harmony export */ "animateChild": function() { return /* binding */ animateChild; },
/* harmony export */ "animation": function() { return /* binding */ animation; },
/* harmony export */ "group": function() { return /* binding */ group; },
/* harmony export */ "keyframes": function() { return /* binding */ keyframes; },
/* harmony export */ "query": function() { return /* binding */ query; },
/* harmony export */ "sequence": function() { return /* binding */ sequence; },
/* harmony export */ "stagger": function() { return /* binding */ stagger; },
/* harmony export */ "state": function() { return /* binding */ state; },
/* harmony export */ "style": function() { return /* binding */ style; },
/* harmony export */ "transition": function() { return /* binding */ transition; },
/* harmony export */ "trigger": function() { return /* binding */ trigger; },
/* harmony export */ "useAnimation": function() { return /* binding */ useAnimation; },
/* harmony export */ "ɵAnimationGroupPlayer": function() { return /* binding */ AnimationGroupPlayer; },
/* harmony export */ "ɵPRE_STYLE": function() { return /* binding */ ɵPRE_STYLE; }
/* harmony export */ });
/**
* @license Angular v12.0.2
* (c) 2010-2021 Google LLC. https://angular.io/
* License: MIT
*/
/**
* An injectable service that produces an animation sequence programmatically within an
* Angular component or directive.
* Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.
*
* @usageNotes
*
* To use this service, add it to your component or directive as a dependency.
* The service is instantiated along with your component.
*
* Apps do not typically need to create their own animation players, but if you
* do need to, follow these steps:
*
* 1. Use the `build()` method to create a programmatic animation using the
* `animate()` function. The method returns an `AnimationFactory` instance.
*
* 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.
*
* 3. Use the player object to control the animation programmatically.
*
* For example:
*
* ```ts
* // import the service from BrowserAnimationsModule
* import {AnimationBuilder} from '@angular/animations';
* // require the service as a dependency
* class MyCmp {
* constructor(private _builder: AnimationBuilder) {}
*
* makeAnimation(element: any) {
* // first define a reusable animation
* const myAnimation = this._builder.build([
* style({ width: 0 }),
* animate(1000, style({ width: '100px' }))
* ]);
*
* // use the returned factory object to create a player
* const player = myAnimation.create(element);
*
* player.play();
* }
* }
* ```
*
* @publicApi
*/
class AnimationBuilder {
}
/**
* A factory object returned from the `AnimationBuilder`.`build()` method.
*
* @publicApi
*/
class AnimationFactory {
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Specifies automatic styling.
*
* @publicApi
*/
const AUTO_STYLE = '*';
/**
* Creates a named animation trigger, containing a list of `state()`
* and `transition()` entries to be evaluated when the expression
* bound to the trigger changes.
*
* @param name An identifying string.
* @param definitions An animation definition object, containing an array of `state()`
* and `transition()` declarations.
*
* @return An object that encapsulates the trigger data.
*
* @usageNotes
* Define an animation trigger in the `animations` section of `@Component` metadata.
* In the template, reference the trigger by name and bind it to a trigger expression that
* evaluates to a defined animation state, using the following format:
*
* `[@triggerName]="expression"`
*
* Animation trigger bindings convert all values to strings, and then match the
* previous and current values against any linked transitions.
* Booleans can be specified as `1` or `true` and `0` or `false`.
*
* ### Usage Example
*
* The following example creates an animation trigger reference based on the provided
* name value.
* The provided animation value is expected to be an array consisting of state and
* transition declarations.
*
* ```typescript
* @Component({
* selector: "my-component",
* templateUrl: "my-component-tpl.html",
* animations: [
* trigger("myAnimationTrigger", [
* state(...),
* state(...),
* transition(...),
* transition(...)
* ])
* ]
* })
* class MyComponent {
* myStatusExp = "something";
* }
* ```
*
* The template associated with this component makes use of the defined trigger
* by binding to an element within its template code.
*
* ```html
*
*
...
* ```
*
* ### Using an inline function
* The `transition` animation method also supports reading an inline function which can decide
* if its associated animation should be run.
*
* ```typescript
* // this method is run each time the `myAnimationTrigger` trigger value changes.
* function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:
string]: any}): boolean {
* // notice that `element` and `params` are also available here
* return toState == 'yes-please-animate';
* }
*
* @Component({
* selector: 'my-component',
* templateUrl: 'my-component-tpl.html',
* animations: [
* trigger('myAnimationTrigger', [
* transition(myInlineMatcherFn, [
* // the animation sequence code
* ]),
* ])
* ]
* })
* class MyComponent {
* myStatusExp = "yes-please-animate";
* }
* ```
*
* ### Disabling Animations
* When true, the special animation control binding `@.disabled` binding prevents
* all animations from rendering.
* Place the `@.disabled` binding on an element to disable
* animations on the element itself, as well as any inner animation triggers
* within the element.
*
* The following example shows how to use this feature:
*
* ```typescript
* @Component({
* selector: 'my-component',
* template: `
*
*
*
* `,
* animations: [
* trigger("childAnimation", [
* // ...
* ])
* ]
* })
* class MyComponent {
* isDisabled = true;
* exp = '...';
* }
* ```
*
* When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,
* along with any inner animations.
*
* ### Disable animations application-wide
* When an area of the template is set to have animations disabled,
* **all** inner components have their animations disabled as well.
* This means that you can disable all animations for an app
* by placing a host binding set on `@.disabled` on the topmost Angular component.
*
* ```typescript
* import {Component, HostBinding} from '@angular/core';
*
* @Component({
* selector: 'app-component',
* templateUrl: 'app.component.html',
* })
* class AppComponent {
* @HostBinding('@.disabled')
* public animationsDisabled = true;
* }
* ```
*
* ### Overriding disablement of inner animations
* Despite inner animations being disabled, a parent animation can `query()`
* for inner elements located in disabled areas of the template and still animate
* them if needed. This is also the case for when a sub animation is
* queried by a parent and then later animated using `animateChild()`.
*
* ### Detecting when an animation is disabled
* If a region of the DOM (or the entire application) has its animations disabled, the animation
* trigger callbacks still fire, but for zero seconds. When the callback fires, it provides
* an instance of an `AnimationEvent`. If animations are disabled,
* the `.disabled` flag on the event is true.
*
* @publicApi
*/
function trigger(name, definitions) {
return { type: 7 /* Trigger */, name, definitions, options: {} };
}
/**
* Defines an animation step that combines styling information with timing information.
*
* @param timings Sets `AnimateTimings` for the parent animation.
* A string in the format "duration [delay] [easing]".
* - Duration and delay are expressed as a number and optional time unit,
* such as "1s" or "10ms" for one second and 10 milliseconds, respectively.
* The default unit is milliseconds.
* - The easing value controls how the animation accelerates and decelerates
* during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,
* `ease-in-out`, or a `cubic-bezier()` function call.
* If not supplied, no easing is applied.
*
* For example, the string "1s 100ms ease-out" specifies a duration of
* 1000 milliseconds, and delay of 100 ms, and the "ease-out" easing style,
* which decelerates near the end of the duration.
* @param styles Sets AnimationStyles for the parent animation.
* A function call to either `style()` or `keyframes()`
* that returns a collection of CSS style entries to be applied to the parent animation.
* When null, uses the styles from the destination state.
* This is useful when describing an animation step that will complete an animation;
* see "Animating to the final state" in `transitions()`.
* @returns An object that encapsulates the animation step.
*
* @usageNotes
* Call within an animation `sequence()`, `{@link animations/group group()}`, or
* `transition()` call to specify an animation step
* that applies given style data to the parent animation for a given amount of time.
*
* ### Syntax Examples
* **Timing examples**
*
* The following examples show various `timings` specifications.
* - `animate(500)` : Duration is 500 milliseconds.
* - `animate("1s")` : Duration is 1000 milliseconds.
* - `animate("100ms 0.5s")` : Duration is 100 milliseconds, delay is 500 milliseconds.
* - `animate("5s ease-in")` : Duration is 5000 milliseconds, easing in.
* - `animate("5s 10ms cubic-bezier(.17,.67,.88,.1)")` : Duration is 5000 milliseconds, delay is 10
* milliseconds, easing according to a bezier curve.
*
* **Style examples**
*
* The following example calls `style()` to set a single CSS style.
* ```typescript
* animate(500, style({ background: "red" }))
* ```
* The following example calls `keyframes()` to set a CSS style
* to different values for successive keyframes.
* ```typescript
* animate(500, keyframes(
* [
* style({ background: "blue" }),
* style({ background: "red" })
* ])
* ```
*
* @publicApi
*/
function animate(timings, styles = null) {
return { type: 4 /* Animate */, styles, timings };
}
/**
* @description Defines a list of animation steps to be run in parallel.
*
* @param steps An array of animation step objects.
* - When steps are defined by `style()` or `animate()`
* function calls, each call within the group is executed instantly.
* - To specify offset styles to be applied at a later time, define steps with
* `keyframes()`, or use `animate()` calls with a delay value.
* For example:
*
* ```typescript
* group([
* animate("1s", style({ background: "black" })),
* animate("2s", style({ color: "white" }))
* ])
* ```
*
* @param options An options object containing a delay and
* developer-defined parameters that provide styling defaults and
* can be overridden on invocation.
*
* @return An object that encapsulates the group data.
*
* @usageNotes
* Grouped animations are useful when a series of styles must be
* animated at different starting times and closed off at different ending times.
*
* When called within a `sequence()` or a
* `transition()` call, does not continue to the next
* instruction until all of the inner animation steps have completed.
*
* @publicApi
*/
function group(steps, options = null) {
return { type: 3 /* Group */, steps, options };
}
/**
* Defines a list of animation steps to be run sequentially, one by one.
*
* @param steps An array of animation step objects.
* - Steps defined by `style()` calls apply the styling data immediately.
* - Steps defined by `animate()` calls apply the styling data over time
* as specified by the timing data.
*
* ```typescript
* sequence([
* style({ opacity: 0 }),
* animate("1s", style({ opacity: 1 }))
* ])
* ```
*
* @param options An options object containing a delay and
* developer-defined parameters that provide styling defaults and
* can be overridden on invocation.
*
* @return An object that encapsulates the sequence data.
*
* @usageNotes
* When you pass an array of steps to a
* `transition()` call, the steps run sequentially by default.
* Compare this to the `{@link animations/group group()}` call, which runs animation steps in
*parallel.
*
* When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,
* execution continues to the next instruction only after each of the inner animation
* steps have completed.
*
* @publicApi
**/
function sequence(steps, options = null) {
return { type: 2 /* Sequence */, steps, options };
}
/**
* Declares a key/value object containing CSS properties/styles that
* can then be used for an animation `state`, within an animation `sequence`,
* or as styling data for calls to `animate()` and `keyframes()`.
*
* @param tokens A set of CSS styles or HTML styles associated with an animation state.
* The value can be any of the following:
* - A key-value style pair associating a CSS property with a value.
* - An array of key-value style pairs.
* - An asterisk (*), to use auto-styling, where styles are derived from the element
* being animated and applied to the animation when it starts.
*
* Auto-styling can be used to define a state that depends on layout or other
* environmental factors.
*
* @return An object that encapsulates the style data.
*
* @usageNotes
* The following examples create animation styles that collect a set of
* CSS property values:
*
* ```typescript
* // string values for CSS properties
* style({ background: "red", color: "blue" })
*
* // numerical pixel values
* style({ width: 100, height: 0 })
* ```
*
* The following example uses auto-styling to allow a component to animate from
* a height of 0 up to the height of the parent element:
*
* ```
* style({ height: 0 }),
* animate("1s", style({ height: "*" }))
* ```
*
* @publicApi
**/
function style(tokens) {
return { type: 6 /* Style */, styles: tokens, offset: null };
}
/**
* Declares an animation state within a trigger attached to an element.
*
* @param name One or more names for the defined state in a comma-separated string.
* The following reserved state names can be supplied to define a style for specific use
* cases:
*
* - `void` You can associate styles with this name to be used when
* the element is detached from the application. For example, when an `ngIf` evaluates
* to false, the state of the associated element is void.
* - `*` (asterisk) Indicates the default state. You can associate styles with this name
* to be used as the fallback when the state that is being animated is not declared
* within the trigger.
*
* @param styles A set of CSS styles associated with this state, created using the
* `style()` function.
* This set of styles persists on the element once the state has been reached.
* @param options Parameters that can be passed to the state when it is invoked.
* 0 or more key-value pairs.
* @return An object that encapsulates the new state data.
*
* @usageNotes
* Use the `trigger()` function to register states to an animation trigger.
* Use the `transition()` function to animate between states.
* When a state is active within a component, its associated styles persist on the element,
* even when the animation ends.
*
* @publicApi
**/
function state(name, styles, options) {
return { type: 0 /* State */, name, styles, options };
}
/**
* Defines a set of animation styles, associating each style with an optional `offset` value.
*
* @param steps A set of animation styles with optional offset data.
* The optional `offset` value for a style specifies a percentage of the total animation
* time at which that style is applied.
* @returns An object that encapsulates the keyframes data.
*
* @usageNotes
* Use with the `animate()` call. Instead of applying animations
* from the current state
* to the destination state, keyframes describe how each style entry is applied and at what point
* within the animation arc.
* Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).
*
* ### Usage
*
* In the following example, the offset values describe
* when each `backgroundColor` value is applied. The color is red at the start, and changes to
* blue when 20% of the total time has elapsed.
*
* ```typescript
* // the provided offset values
* animate("5s", keyframes([
* style({ backgroundColor: "red", offset: 0 }),
* style({ backgroundColor: "blue", offset: 0.2 }),
* style({ backgroundColor: "orange", offset: 0.3 }),
* style({ backgroundColor: "black", offset: 1 })
* ]))
* ```
*
* If there are no `offset` values specified in the style entries, the offsets
* are calculated automatically.
*
* ```typescript
* animate("5s", keyframes([
* style({ backgroundColor: "red" }) // offset = 0
* style({ backgroundColor: "blue" }) // offset = 0.33
* style({ backgroundColor: "orange" }) // offset = 0.66
* style({ backgroundColor: "black" }) // offset = 1
* ]))
*```
* @publicApi
*/
function keyframes(steps) {
return { type: 5 /* Keyframes */, steps };
}
/**
* Declares an animation transition as a sequence of animation steps to run when a given
* condition is satisfied. The condition is a Boolean expression or function that compares
* the previous and current animation states, and returns true if this transition should occur.
* When the state criteria of a defined transition are met, the associated animation is
* triggered.
*
* @param stateChangeExpr A Boolean expression or function that compares the previous and current
* animation states, and returns true if this transition should occur. Note that "true" and "false"
* match 1 and 0, respectively. An expression is evaluated each time a state change occurs in the
* animation trigger element.
* The animation steps run when the expression evaluates to true.
*
* - A state-change string takes the form "state1 => state2", where each side is a defined animation
* state, or an asterix (*) to refer to a dynamic start or end state.
* - The expression string can contain multiple comma-separated statements;
* for example "state1 => state2, state3 => state4".
* - Special values `:enter` and `:leave` initiate a transition on the entry and exit states,
* equivalent to "void => *" and "* => void".
* - Special values `:increment` and `:decrement` initiate a transition when a numeric value has
* increased or decreased in value.
* - A function is executed each time a state change occurs in the animation trigger element.
* The animation steps run when the function returns true.
*
* @param steps One or more animation objects, as returned by the `animate()` or
* `sequence()` function, that form a transformation from one state to another.
* A sequence is used by default when you pass an array.
* @param options An options object that can contain a delay value for the start of the animation,
* and additional developer-defined parameters. Provided values for additional parameters are used
* as defaults, and override values can be passed to the caller on invocation.
* @returns An object that encapsulates the transition data.
*
* @usageNotes
* The template associated with a component binds an animation trigger to an element.
*
* ```HTML
*
*
...
* ```
*
* All transitions are defined within an animation trigger,
* along with named states that the transitions change to and from.
*
* ```typescript
* trigger("myAnimationTrigger", [
* // define states
* state("on", style({ background: "green" })),
* state("off", style({ background: "grey" })),
* ...]
* ```
*
* Note that when you call the `sequence()` function within a `{@link animations/group group()}`
* or a `transition()` call, execution does not continue to the next instruction
* until each of the inner animation steps have completed.
*
* ### Syntax examples
*
* The following examples define transitions between the two defined states (and default states),
* using various options:
*
* ```typescript
* // Transition occurs when the state value
* // bound to "myAnimationTrigger" changes from "on" to "off"
* transition("on => off", animate(500))
* // Run the same animation for both directions
* transition("on <=> off", animate(500))
* // Define multiple state-change pairs separated by commas
* transition("on => off, off => void", animate(500))
* ```
*
* ### Special values for state-change expressions
*
* - Catch-all state change for when an element is inserted into the page and the
* destination state is unknown:
*
* ```typescript
* transition("void => *", [
* style({ opacity: 0 }),
* animate(500)
* ])
* ```
*
* - Capture a state change between any states:
*
* `transition("* => *", animate("1s 0s"))`
*
* - Entry and exit transitions:
*
* ```typescript
* transition(":enter", [
* style({ opacity: 0 }),
* animate(500, style({ opacity: 1 }))
* ]),
* transition(":leave", [
* animate(500, style({ opacity: 0 }))
* ])
* ```
*
* - Use `:increment` and `:decrement` to initiate transitions:
*
* ```typescript
* transition(":increment", group([
* query(':enter', [
* style({ left: '100%' }),
* animate('0.5s ease-out', style('*'))
* ]),
* query(':leave', [
* animate('0.5s ease-out', style({ left: '-100%' }))
* ])
* ]))
*
* transition(":decrement", group([
* query(':enter', [
* style({ left: '100%' }),
* animate('0.5s ease-out', style('*'))
* ]),
* query(':leave', [
* animate('0.5s ease-out', style({ left: '-100%' }))
* ])
* ]))
* ```
*
* ### State-change functions
*
* Here is an example of a `fromState` specified as a state-change function that invokes an
* animation when true:
*
* ```typescript
* transition((fromState, toState) =>
* {
* return fromState == "off" && toState == "on";
* },
* animate("1s 0s"))
* ```
*
* ### Animating to the final state
*
* If the final step in a transition is a call to `animate()` that uses a timing value
* with no style data, that step is automatically considered the final animation arc,
* for the element to reach the final state. Angular automatically adds or removes
* CSS styles to ensure that the element is in the correct final state.
*
* The following example defines a transition that starts by hiding the element,
* then makes sure that it animates properly to whatever state is currently active for trigger:
*
* ```typescript
* transition("void => *", [
* style({ opacity: 0 }),
* animate(500)
* ])
* ```
* ### Boolean value matching
* If a trigger binding value is a Boolean, it can be matched using a transition expression
* that compares true and false or 1 and 0. For example:
*
* ```
* // in the template
*
...
* // in the component metadata
* trigger('openClose', [
* state('true', style({ height: '*' })),
* state('false', style({ height: '0px' })),
* transition('false <=> true', animate(500))
* ])
* ```
*
* @publicApi
**/
function transition(stateChangeExpr, steps, options = null) {
return { type: 1 /* Transition */, expr: stateChangeExpr, animation: steps, options };
}
/**
* Produces a reusable animation that can be invoked in another animation or sequence,
* by calling the `useAnimation()` function.
*
* @param steps One or more animation objects, as returned by the `animate()`
* or `sequence()` function, that form a transformation from one state to another.
* A sequence is used by default when you pass an array.
* @param options An options object that can contain a delay value for the start of the
* animation, and additional developer-defined parameters.
* Provided values for additional parameters are used as defaults,
* and override values can be passed to the caller on invocation.
* @returns An object that encapsulates the animation data.
*
* @usageNotes
* The following example defines a reusable animation, providing some default parameter
* values.
*
* ```typescript
* var fadeAnimation = animation([
* style({ opacity: '{{ start }}' }),
* animate('{{ time }}',
* style({ opacity: '{{ end }}'}))
* ],
* { params: { time: '1000ms', start: 0, end: 1 }});
* ```
*
* The following invokes the defined animation with a call to `useAnimation()`,
* passing in override parameter values.
*
* ```js
* useAnimation(fadeAnimation, {
* params: {
* time: '2s',
* start: 1,
* end: 0
* }
* })
* ```
*
* If any of the passed-in parameter values are missing from this call,
* the default values are used. If one or more parameter values are missing before a step is
* animated, `useAnimation()` throws an error.
*
* @publicApi
*/
function animation(steps, options = null) {
return { type: 8 /* Reference */, animation: steps, options };
}
/**
* Executes a queried inner animation element within an animation sequence.
*
* @param options An options object that can contain a delay value for the start of the
* animation, and additional override values for developer-defined parameters.
* @return An object that encapsulates the child animation data.
*
* @usageNotes
* Each time an animation is triggered in Angular, the parent animation
* has priority and any child animations are blocked. In order
* for a child animation to run, the parent animation must query each of the elements
* containing child animations, and run them using this function.
*
* Note that this feature is designed to be used with `query()` and it will only work
* with animations that are assigned using the Angular animation library. CSS keyframes
* and transitions are not handled by this API.
*
* @publicApi
*/
function animateChild(options = null) {
return { type: 9 /* AnimateChild */, options };
}
/**
* Starts a reusable animation that is created using the `animation()` function.
*
* @param animation The reusable animation to start.
* @param options An options object that can contain a delay value for the start of
* the animation, and additional override values for developer-defined parameters.
* @return An object that contains the animation parameters.
*
* @publicApi
*/
function useAnimation(animation, options = null) {
return { type: 10 /* AnimateRef */, animation, options };
}
/**
* Finds one or more inner elements within the current element that is
* being animated within a sequence. Use with `animate()`.
*
* @param selector The element to query, or a set of elements that contain Angular-specific
* characteristics, specified with one or more of the following tokens.
* - `query(":enter")` or `query(":leave")` : Query for newly inserted/removed elements.
* - `query(":animating")` : Query all currently animating elements.
* - `query("@triggerName")` : Query elements that contain an animation trigger.
* - `query("@*")` : Query all elements that contain an animation triggers.
* - `query(":self")` : Include the current element into the animation sequence.
*
* @param animation One or more animation steps to apply to the queried element or elements.
* An array is treated as an animation sequence.
* @param options An options object. Use the 'limit' field to limit the total number of
* items to collect.
* @return An object that encapsulates the query data.
*
* @usageNotes
* Tokens can be merged into a combined query selector string. For example:
*
* ```typescript
* query(':self, .record:enter, .record:leave, @subTrigger', [...])
* ```
*
* The `query()` function collects multiple elements and works internally by using
* `element.querySelectorAll`. Use the `limit` field of an options object to limit
* the total number of items to be collected. For example:
*
* ```js
* query('div', [
* animate(...),
* animate(...)
* ], { limit: 1 })
* ```
*
* By default, throws an error when zero items are found. Set the
* `optional` flag to ignore this error. For example:
*
* ```js
* query('.some-element-that-may-not-be-there', [
* animate(...),
* animate(...)
* ], { optional: true })
* ```
*
* ### Usage Example
*
* The following example queries for inner elements and animates them
* individually using `animate()`.
*
* ```typescript
* @Component({
* selector: 'inner',
* template: `
*
*
Title
*
* Blah blah blah
*
*
* `,
* animations: [
* trigger('queryAnimation', [
* transition('* => goAnimate', [
* // hide the inner elements
* query('h1', style({ opacity: 0 })),
* query('.content', style({ opacity: 0 })),
*
* // animate the inner elements in, one by one
* query('h1', animate(1000, style({ opacity: 1 }))),
* query('.content', animate(1000, style({ opacity: 1 }))),
* ])
* ])
* ]
* })
* class Cmp {
* exp = '';
*
* goAnimate() {
* this.exp = 'goAnimate';
* }
* }
* ```
*
* @publicApi
*/
function query(selector, animation, options = null) {
return { type: 11 /* Query */, selector, animation, options };
}
/**
* Use within an animation `query()` call to issue a timing gap after
* each queried item is animated.
*
* @param timings A delay value.
* @param animation One ore more animation steps.
* @returns An object that encapsulates the stagger data.
*
* @usageNotes
* In the following example, a container element wraps a list of items stamped out
* by an `ngFor`. The container element contains an animation trigger that will later be set
* to query for each of the inner items.
*
* Each time items are added, the opacity fade-in animation runs,
* and each removed item is faded out.
* When either of these animations occur, the stagger effect is
* applied after each item's animation is started.
*
* ```html
*
*
*
*
*
* {{ item }}
*
*
* ```
*
* Here is the component code:
*
* ```typescript
* import {trigger, transition, style, animate, query, stagger} from '@angular/animations';
* @Component({
* templateUrl: 'list.component.html',
* animations: [
* trigger('listAnimation', [
* ...
* ])
* ]
* })
* class ListComponent {
* items = [];
*
* showItems() {
* this.items = [0,1,2,3,4];
* }
*
* hideItems() {
* this.items = [];
* }
*
* toggle() {
* this.items.length ? this.hideItems() : this.showItems();
* }
* }
* ```
*
* Here is the animation trigger code:
*
* ```typescript
* trigger('listAnimation', [
* transition('* => *', [ // each time the binding value changes
* query(':leave', [
* stagger(100, [
* animate('0.5s', style({ opacity: 0 }))
* ])
* ]),
* query(':enter', [
* style({ opacity: 0 }),
* stagger(100, [
* animate('0.5s', style({ opacity: 1 }))
* ])
* ])
* ])
* ])
* ```
*
* @publicApi
*/
function stagger(timings, animation) {
return { type: 12 /* Stagger */, timings, animation };
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
function scheduleMicroTask(cb) {
Promise.resolve(null).then(cb);
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* An empty programmatic controller for reusable animations.
* Used internally when animations are disabled, to avoid
* checking for the null case when an animation player is expected.
*
* @see `animate()`
* @see `AnimationPlayer`
* @see `GroupPlayer`
*
* @publicApi
*/
class NoopAnimationPlayer {
constructor(duration = 0, delay = 0) {
this._onDoneFns = [];
this._onStartFns = [];
this._onDestroyFns = [];
this._started = false;
this._destroyed = false;
this._finished = false;
this._position = 0;
this.parentPlayer = null;
this.totalTime = duration + delay;
}
_onFinish() {
if (!this._finished) {
this._finished = true;
this._onDoneFns.forEach(fn => fn());
this._onDoneFns = [];
}
}
onStart(fn) {
this._onStartFns.push(fn);
}
onDone(fn) {
this._onDoneFns.push(fn);
}
onDestroy(fn) {
this._onDestroyFns.push(fn);
}
hasStarted() {
return this._started;
}
init() { }
play() {
if (!this.hasStarted()) {
this._onStart();
this.triggerMicrotask();
}
this._started = true;
}
/** @internal */
triggerMicrotask() {
scheduleMicroTask(() => this._onFinish());
}
_onStart() {
this._onStartFns.forEach(fn => fn());
this._onStartFns = [];
}
pause() { }
restart() { }
finish() {
this._onFinish();
}
destroy() {
if (!this._destroyed) {
this._destroyed = true;
if (!this.hasStarted()) {
this._onStart();
}
this.finish();
this._onDestroyFns.forEach(fn => fn());
this._onDestroyFns = [];
}
}
reset() {
this._started = false;
}
setPosition(position) {
this._position = this.totalTime ? position * this.totalTime : 1;
}
getPosition() {
return this.totalTime ? this._position / this.totalTime : 1;
}
/** @internal */
triggerCallback(phaseName) {
const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;
methods.forEach(fn => fn());
methods.length = 0;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A programmatic controller for a group of reusable animations.
* Used internally to control animations.
*
* @see `AnimationPlayer`
* @see `{@link animations/group group()}`
*
*/
class AnimationGroupPlayer {
constructor(_players) {
this._onDoneFns = [];
this._onStartFns = [];
this._finished = false;
this._started = false;
this._destroyed = false;
this._onDestroyFns = [];
this.parentPlayer = null;
this.totalTime = 0;
this.players = _players;
let doneCount = 0;
let destroyCount = 0;
let startCount = 0;
const total = this.players.length;
if (total == 0) {
scheduleMicroTask(() => this._onFinish());
}
else {
this.players.forEach(player => {
player.onDone(() => {
if (++doneCount == total) {
this._onFinish();
}
});
player.onDestroy(() => {
if (++destroyCount == total) {
this._onDestroy();
}
});
player.onStart(() => {
if (++startCount == total) {
this._onStart();
}
});
});
}
this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);
}
_onFinish() {
if (!this._finished) {
this._finished = true;
this._onDoneFns.forEach(fn => fn());
this._onDoneFns = [];
}
}
init() {
this.players.forEach(player => player.init());
}
onStart(fn) {
this._onStartFns.push(fn);
}
_onStart() {
if (!this.hasStarted()) {
this._started = true;
this._onStartFns.forEach(fn => fn());
this._onStartFns = [];
}
}
onDone(fn) {
this._onDoneFns.push(fn);
}
onDestroy(fn) {
this._onDestroyFns.push(fn);
}
hasStarted() {
return this._started;
}
play() {
if (!this.parentPlayer) {
this.init();
}
this._onStart();
this.players.forEach(player => player.play());
}
pause() {
this.players.forEach(player => player.pause());
}
restart() {
this.players.forEach(player => player.restart());
}
finish() {
this._onFinish();
this.players.forEach(player => player.finish());
}
destroy() {
this._onDestroy();
}
_onDestroy() {
if (!this._destroyed) {
this._destroyed = true;
this._onFinish();
this.players.forEach(player => player.destroy());
this._onDestroyFns.forEach(fn => fn());
this._onDestroyFns = [];
}
}
reset() {
this.players.forEach(player => player.reset());
this._destroyed = false;
this._finished = false;
this._started = false;
}
setPosition(p) {
const timeAtPosition = p * this.totalTime;
this.players.forEach(player => {
const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;
player.setPosition(position);
});
}
getPosition() {
const longestPlayer = this.players.reduce((longestSoFar, player) => {
const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;
return newPlayerIsLongest ? player : longestSoFar;
}, null);
return longestPlayer != null ? longestPlayer.getPosition() : 0;
}
beforeDestroy() {
this.players.forEach(player => {
if (player.beforeDestroy) {
player.beforeDestroy();
}
});
}
/** @internal */
triggerCallback(phaseName) {
const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;
methods.forEach(fn => fn());
methods.length = 0;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ɵPRE_STYLE = '!';
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Generated bundle index. Do not edit.
*/
//# sourceMappingURL=animations.js.map
/***/ }),
/***/ 93154:
/*!***************************************************************************!*\
!*** ./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/browser.js ***!
\***************************************************************************/
/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */ "AnimationDriver": function() { return /* binding */ AnimationDriver; },
/* harmony export */ "ɵAnimation": function() { return /* binding */ Animation; },
/* harmony export */ "ɵAnimationEngine": function() { return /* binding */ AnimationEngine; },
/* harmony export */ "ɵAnimationStyleNormalizer": function() { return /* binding */ AnimationStyleNormalizer; },
/* harmony export */ "ɵCssKeyframesDriver": function() { return /* binding */ CssKeyframesDriver; },
/* harmony export */ "ɵCssKeyframesPlayer": function() { return /* binding */ CssKeyframesPlayer; },
/* harmony export */ "ɵNoopAnimationDriver": function() { return /* binding */ NoopAnimationDriver; },
/* harmony export */ "ɵNoopAnimationStyleNormalizer": function() { return /* binding */ NoopAnimationStyleNormalizer; },
/* harmony export */ "ɵWebAnimationsDriver": function() { return /* binding */ WebAnimationsDriver; },
/* harmony export */ "ɵWebAnimationsPlayer": function() { return /* binding */ WebAnimationsPlayer; },
/* harmony export */ "ɵWebAnimationsStyleNormalizer": function() { return /* binding */ WebAnimationsStyleNormalizer; },
/* harmony export */ "ɵallowPreviousPlayerStylesMerge": function() { return /* binding */ allowPreviousPlayerStylesMerge; },
/* harmony export */ "ɵangular_packages_animations_browser_browser_a": function() { return /* binding */ SpecialCasedStyles; },
/* harmony export */ "ɵcontainsElement": function() { return /* binding */ containsElement; },
/* harmony export */ "ɵinvokeQuery": function() { return /* binding */ invokeQuery; },
/* harmony export */ "ɵmatchesElement": function() { return /* binding */ matchesElement; },
/* harmony export */ "ɵsupportsWebAnimations": function() { return /* binding */ supportsWebAnimations; },
/* harmony export */ "ɵvalidateStyleProperty": function() { return /* binding */ validateStyleProperty; }
/* harmony export */ });
/* harmony import */ var _angular_animations__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/animations */ 17238);
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ 37716);
/**
* @license Angular v12.0.2
* (c) 2010-2021 Google LLC. https://angular.io/
* License: MIT
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
function isBrowser() {
return (typeof window !== 'undefined' && typeof window.document !== 'undefined');
}
function isNode() {
// Checking only for `process` isn't enough to identify whether or not we're in a Node
// environment, because Webpack by default will polyfill the `process`. While we can discern
// that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and
// might not be future-proof. Instead we look at the stringified version of `process` which
// is `[object process]` in Node and `[object Object]` when polyfilled.
return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';
}
function optimizeGroupPlayer(players) {
switch (players.length) {
case 0:
return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer();
case 1:
return players[0];
default:
return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵAnimationGroupPlayer"](players);
}
}
function normalizeKeyframes(driver, normalizer, element, keyframes, preStyles = {}, postStyles = {}) {
const errors = [];
const normalizedKeyframes = [];
let previousOffset = -1;
let previousKeyframe = null;
keyframes.forEach(kf => {
const offset = kf['offset'];
const isSameOffset = offset == previousOffset;
const normalizedKeyframe = (isSameOffset && previousKeyframe) || {};
Object.keys(kf).forEach(prop => {
let normalizedProp = prop;
let normalizedValue = kf[prop];
if (prop !== 'offset') {
normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);
switch (normalizedValue) {
case _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]:
normalizedValue = preStyles[prop];
break;
case _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE:
normalizedValue = postStyles[prop];
break;
default:
normalizedValue =
normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);
break;
}
}
normalizedKeyframe[normalizedProp] = normalizedValue;
});
if (!isSameOffset) {
normalizedKeyframes.push(normalizedKeyframe);
}
previousKeyframe = normalizedKeyframe;
previousOffset = offset;
});
if (errors.length) {
const LINE_START = '\n - ';
throw new Error(`Unable to animate due to the following errors:${LINE_START}${errors.join(LINE_START)}`);
}
return normalizedKeyframes;
}
function listenOnPlayer(player, eventName, event, callback) {
switch (eventName) {
case 'start':
player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));
break;
case 'done':
player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));
break;
case 'destroy':
player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));
break;
}
}
function copyAnimationEvent(e, phaseName, player) {
const totalTime = player.totalTime;
const disabled = player.disabled ? true : false;
const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);
const data = e['_data'];
if (data != null) {
event['_data'] = data;
}
return event;
}
function makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {
return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };
}
function getOrSetAsInMap(map, key, defaultValue) {
let value;
if (map instanceof Map) {
value = map.get(key);
if (!value) {
map.set(key, value = defaultValue);
}
}
else {
value = map[key];
if (!value) {
value = map[key] = defaultValue;
}
}
return value;
}
function parseTimelineCommand(command) {
const separatorPos = command.indexOf(':');
const id = command.substring(1, separatorPos);
const action = command.substr(separatorPos + 1);
return [id, action];
}
let _contains = (elm1, elm2) => false;
const ɵ0 = _contains;
let _matches = (element, selector) => false;
const ɵ1 = _matches;
let _query = (element, selector, multi) => {
return [];
};
const ɵ2 = _query;
// Define utility methods for browsers and platform-server(domino) where Element
// and utility methods exist.
const _isNode = isNode();
if (_isNode || typeof Element !== 'undefined') {
if (!isBrowser()) {
_contains = (elm1, elm2) => elm1.contains(elm2);
}
else {
_contains = (elm1, elm2) => {
while (elm2 && elm2 !== document.documentElement) {
if (elm2 === elm1) {
return true;
}
elm2 = elm2.parentNode || elm2.host; // consider host to support shadow DOM
}
return false;
};
}
_matches = (() => {
if (_isNode || Element.prototype.matches) {
return (element, selector) => element.matches(selector);
}
else {
const proto = Element.prototype;
const fn = proto.matchesSelector || proto.mozMatchesSelector || proto.msMatchesSelector ||
proto.oMatchesSelector || proto.webkitMatchesSelector;
if (fn) {
return (element, selector) => fn.apply(element, [selector]);
}
else {
return _matches;
}
}
})();
_query = (element, selector, multi) => {
let results = [];
if (multi) {
// DO NOT REFACTOR TO USE SPREAD SYNTAX.
// For element queries that return sufficiently large NodeList objects,
// using spread syntax to populate the results array causes a RangeError
// due to the call stack limit being reached. `Array.from` can not be used
// as well, since NodeList is not iterable in IE 11, see
// https://developer.mozilla.org/en-US/docs/Web/API/NodeList
// More info is available in #38551.
const elems = element.querySelectorAll(selector);
for (let i = 0; i < elems.length; i++) {
results.push(elems[i]);
}
}
else {
const elm = element.querySelector(selector);
if (elm) {
results.push(elm);
}
}
return results;
};
}
function containsVendorPrefix(prop) {
// Webkit is the only real popular vendor prefix nowadays
// cc: http://shouldiprefix.com/
return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit
}
let _CACHED_BODY = null;
let _IS_WEBKIT = false;
function validateStyleProperty(prop) {
if (!_CACHED_BODY) {
_CACHED_BODY = getBodyNode() || {};
_IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;
}
let result = true;
if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {
result = prop in _CACHED_BODY.style;
if (!result && _IS_WEBKIT) {
const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.substr(1);
result = camelProp in _CACHED_BODY.style;
}
}
return result;
}
function getBodyNode() {
if (typeof document != 'undefined') {
return document.body;
}
return null;
}
const matchesElement = _matches;
const containsElement = _contains;
const invokeQuery = _query;
function hypenatePropsObject(object) {
const newObj = {};
Object.keys(object).forEach(prop => {
const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');
newObj[newProp] = object[prop];
});
return newObj;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @publicApi
*/
class NoopAnimationDriver {
validateStyleProperty(prop) {
return validateStyleProperty(prop);
}
matchesElement(element, selector) {
return matchesElement(element, selector);
}
containsElement(elm1, elm2) {
return containsElement(elm1, elm2);
}
query(element, selector, multi) {
return invokeQuery(element, selector, multi);
}
computeStyle(element, prop, defaultValue) {
return defaultValue || '';
}
animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {
return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer(duration, delay);
}
}
NoopAnimationDriver.ɵfac = function NoopAnimationDriver_Factory(t) { return new (t || NoopAnimationDriver)(); };
NoopAnimationDriver.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"]({ token: NoopAnimationDriver, factory: NoopAnimationDriver.ɵfac });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](NoopAnimationDriver, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_1__.Injectable
}], null, null); })();
/**
* @publicApi
*/
class AnimationDriver {
}
AnimationDriver.NOOP = new NoopAnimationDriver();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ONE_SECOND = 1000;
const SUBSTITUTION_EXPR_START = '{{';
const SUBSTITUTION_EXPR_END = '}}';
const ENTER_CLASSNAME = 'ng-enter';
const LEAVE_CLASSNAME = 'ng-leave';
const ENTER_SELECTOR = '.ng-enter';
const LEAVE_SELECTOR = '.ng-leave';
const NG_TRIGGER_CLASSNAME = 'ng-trigger';
const NG_TRIGGER_SELECTOR = '.ng-trigger';
const NG_ANIMATING_CLASSNAME = 'ng-animating';
const NG_ANIMATING_SELECTOR = '.ng-animating';
function resolveTimingValue(value) {
if (typeof value == 'number')
return value;
const matches = value.match(/^(-?[\.\d]+)(m?s)/);
if (!matches || matches.length < 2)
return 0;
return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);
}
function _convertTimeValueToMS(value, unit) {
switch (unit) {
case 's':
return value * ONE_SECOND;
default: // ms or something else
return value;
}
}
function resolveTiming(timings, errors, allowNegativeValues) {
return timings.hasOwnProperty('duration') ?
timings :
parseTimeExpression(timings, errors, allowNegativeValues);
}
function parseTimeExpression(exp, errors, allowNegativeValues) {
const regex = /^(-?[\.\d]+)(m?s)(?:\s+(-?[\.\d]+)(m?s))?(?:\s+([-a-z]+(?:\(.+?\))?))?$/i;
let duration;
let delay = 0;
let easing = '';
if (typeof exp === 'string') {
const matches = exp.match(regex);
if (matches === null) {
errors.push(`The provided timing value "${exp}" is invalid.`);
return { duration: 0, delay: 0, easing: '' };
}
duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);
const delayMatch = matches[3];
if (delayMatch != null) {
delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);
}
const easingVal = matches[5];
if (easingVal) {
easing = easingVal;
}
}
else {
duration = exp;
}
if (!allowNegativeValues) {
let containsErrors = false;
let startIndex = errors.length;
if (duration < 0) {
errors.push(`Duration values below 0 are not allowed for this animation step.`);
containsErrors = true;
}
if (delay < 0) {
errors.push(`Delay values below 0 are not allowed for this animation step.`);
containsErrors = true;
}
if (containsErrors) {
errors.splice(startIndex, 0, `The provided timing value "${exp}" is invalid.`);
}
}
return { duration, delay, easing };
}
function copyObj(obj, destination = {}) {
Object.keys(obj).forEach(prop => {
destination[prop] = obj[prop];
});
return destination;
}
function normalizeStyles(styles) {
const normalizedStyles = {};
if (Array.isArray(styles)) {
styles.forEach(data => copyStyles(data, false, normalizedStyles));
}
else {
copyStyles(styles, false, normalizedStyles);
}
return normalizedStyles;
}
function copyStyles(styles, readPrototype, destination = {}) {
if (readPrototype) {
// we make use of a for-in loop so that the
// prototypically inherited properties are
// revealed from the backFill map
for (let prop in styles) {
destination[prop] = styles[prop];
}
}
else {
copyObj(styles, destination);
}
return destination;
}
function getStyleAttributeString(element, key, value) {
// Return the key-value pair string to be added to the style attribute for the
// given CSS style key.
if (value) {
return key + ':' + value + ';';
}
else {
return '';
}
}
function writeStyleAttribute(element) {
// Read the style property of the element and manually reflect it to the
// style attribute. This is needed because Domino on platform-server doesn't
// understand the full set of allowed CSS properties and doesn't reflect some
// of them automatically.
let styleAttrValue = '';
for (let i = 0; i < element.style.length; i++) {
const key = element.style.item(i);
styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));
}
for (const key in element.style) {
// Skip internal Domino properties that don't need to be reflected.
if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {
continue;
}
const dashKey = camelCaseToDashCase(key);
styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);
}
element.setAttribute('style', styleAttrValue);
}
function setStyles(element, styles, formerStyles) {
if (element['style']) {
Object.keys(styles).forEach(prop => {
const camelProp = dashCaseToCamelCase(prop);
if (formerStyles && !formerStyles.hasOwnProperty(prop)) {
formerStyles[prop] = element.style[camelProp];
}
element.style[camelProp] = styles[prop];
});
// On the server set the 'style' attribute since it's not automatically reflected.
if (isNode()) {
writeStyleAttribute(element);
}
}
}
function eraseStyles(element, styles) {
if (element['style']) {
Object.keys(styles).forEach(prop => {
const camelProp = dashCaseToCamelCase(prop);
element.style[camelProp] = '';
});
// On the server set the 'style' attribute since it's not automatically reflected.
if (isNode()) {
writeStyleAttribute(element);
}
}
}
function normalizeAnimationEntry(steps) {
if (Array.isArray(steps)) {
if (steps.length == 1)
return steps[0];
return (0,_angular_animations__WEBPACK_IMPORTED_MODULE_0__.sequence)(steps);
}
return steps;
}
function validateStyleParams(value, options, errors) {
const params = options.params || {};
const matches = extractStyleParams(value);
if (matches.length) {
matches.forEach(varName => {
if (!params.hasOwnProperty(varName)) {
errors.push(`Unable to resolve the local animation param ${varName} in the given list of values`);
}
});
}
}
const PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\s*(.+?)\\s*${SUBSTITUTION_EXPR_END}`, 'g');
function extractStyleParams(value) {
let params = [];
if (typeof value === 'string') {
let match;
while (match = PARAM_REGEX.exec(value)) {
params.push(match[1]);
}
PARAM_REGEX.lastIndex = 0;
}
return params;
}
function interpolateParams(value, params, errors) {
const original = value.toString();
const str = original.replace(PARAM_REGEX, (_, varName) => {
let localVal = params[varName];
// this means that the value was never overridden by the data passed in by the user
if (!params.hasOwnProperty(varName)) {
errors.push(`Please provide a value for the animation param ${varName}`);
localVal = '';
}
return localVal.toString();
});
// we do this to assert that numeric values stay as they are
return str == original ? value : str;
}
function iteratorToArray(iterator) {
const arr = [];
let item = iterator.next();
while (!item.done) {
arr.push(item.value);
item = iterator.next();
}
return arr;
}
const DASH_CASE_REGEXP = /-+([a-z0-9])/g;
function dashCaseToCamelCase(input) {
return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());
}
function camelCaseToDashCase(input) {
return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();
}
function allowPreviousPlayerStylesMerge(duration, delay) {
return duration === 0 || delay === 0;
}
function balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {
const previousStyleProps = Object.keys(previousStyles);
if (previousStyleProps.length && keyframes.length) {
let startingKeyframe = keyframes[0];
let missingStyleProps = [];
previousStyleProps.forEach(prop => {
if (!startingKeyframe.hasOwnProperty(prop)) {
missingStyleProps.push(prop);
}
startingKeyframe[prop] = previousStyles[prop];
});
if (missingStyleProps.length) {
// tslint:disable-next-line
for (var i = 1; i < keyframes.length; i++) {
let kf = keyframes[i];
missingStyleProps.forEach(function (prop) {
kf[prop] = computeStyle(element, prop);
});
}
}
}
return keyframes;
}
function visitDslNode(visitor, node, context) {
switch (node.type) {
case 7 /* Trigger */:
return visitor.visitTrigger(node, context);
case 0 /* State */:
return visitor.visitState(node, context);
case 1 /* Transition */:
return visitor.visitTransition(node, context);
case 2 /* Sequence */:
return visitor.visitSequence(node, context);
case 3 /* Group */:
return visitor.visitGroup(node, context);
case 4 /* Animate */:
return visitor.visitAnimate(node, context);
case 5 /* Keyframes */:
return visitor.visitKeyframes(node, context);
case 6 /* Style */:
return visitor.visitStyle(node, context);
case 8 /* Reference */:
return visitor.visitReference(node, context);
case 9 /* AnimateChild */:
return visitor.visitAnimateChild(node, context);
case 10 /* AnimateRef */:
return visitor.visitAnimateRef(node, context);
case 11 /* Query */:
return visitor.visitQuery(node, context);
case 12 /* Stagger */:
return visitor.visitStagger(node, context);
default:
throw new Error(`Unable to resolve animation metadata node #${node.type}`);
}
}
function computeStyle(element, prop) {
return window.getComputedStyle(element)[prop];
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ANY_STATE = '*';
function parseTransitionExpr(transitionValue, errors) {
const expressions = [];
if (typeof transitionValue == 'string') {
transitionValue.split(/\s*,\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));
}
else {
expressions.push(transitionValue);
}
return expressions;
}
function parseInnerTransitionStr(eventStr, expressions, errors) {
if (eventStr[0] == ':') {
const result = parseAnimationAlias(eventStr, errors);
if (typeof result == 'function') {
expressions.push(result);
return;
}
eventStr = result;
}
const match = eventStr.match(/^(\*|[-\w]+)\s*([=-]>)\s*(\*|[-\w]+)$/);
if (match == null || match.length < 4) {
errors.push(`The provided transition expression "${eventStr}" is not supported`);
return expressions;
}
const fromState = match[1];
const separator = match[2];
const toState = match[3];
expressions.push(makeLambdaFromStates(fromState, toState));
const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;
if (separator[0] == '<' && !isFullAnyStateExpr) {
expressions.push(makeLambdaFromStates(toState, fromState));
}
}
function parseAnimationAlias(alias, errors) {
switch (alias) {
case ':enter':
return 'void => *';
case ':leave':
return '* => void';
case ':increment':
return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);
case ':decrement':
return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);
default:
errors.push(`The transition alias value "${alias}" is not supported`);
return '* => *';
}
}
// DO NOT REFACTOR ... keep the follow set instantiations
// with the values intact (closure compiler for some reason
// removes follow-up lines that add the values outside of
// the constructor...
const TRUE_BOOLEAN_VALUES = new Set(['true', '1']);
const FALSE_BOOLEAN_VALUES = new Set(['false', '0']);
function makeLambdaFromStates(lhs, rhs) {
const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);
const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);
return (fromState, toState) => {
let lhsMatch = lhs == ANY_STATE || lhs == fromState;
let rhsMatch = rhs == ANY_STATE || rhs == toState;
if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {
lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);
}
if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {
rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);
}
return lhsMatch && rhsMatch;
};
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const SELF_TOKEN = ':self';
const SELF_TOKEN_REGEX = new RegExp(`\s*${SELF_TOKEN}\s*,?`, 'g');
/*
* [Validation]
* The visitor code below will traverse the animation AST generated by the animation verb functions
* (the output is a tree of objects) and attempt to perform a series of validations on the data. The
* following corner-cases will be validated:
*
* 1. Overlap of animations
* Given that a CSS property cannot be animated in more than one place at the same time, it's
* important that this behavior is detected and validated. The way in which this occurs is that
* each time a style property is examined, a string-map containing the property will be updated with
* the start and end times for when the property is used within an animation step.
*
* If there are two or more parallel animations that are currently running (these are invoked by the
* group()) on the same element then the validator will throw an error. Since the start/end timing
* values are collected for each property then if the current animation step is animating the same
* property and its timing values fall anywhere into the window of time that the property is
* currently being animated within then this is what causes an error.
*
* 2. Timing values
* The validator will validate to see if a timing value of `duration delay easing` or
* `durationNumber` is valid or not.
*
* (note that upon validation the code below will replace the timing data with an object containing
* {duration,delay,easing}.
*
* 3. Offset Validation
* Each of the style() calls are allowed to have an offset value when placed inside of keyframes().
* Offsets within keyframes() are considered valid when:
*
* - No offsets are used at all
* - Each style() entry contains an offset value
* - Each offset is between 0 and 1
* - Each offset is greater to or equal than the previous one
*
* Otherwise an error will be thrown.
*/
function buildAnimationAst(driver, metadata, errors) {
return new AnimationAstBuilderVisitor(driver).build(metadata, errors);
}
const ROOT_SELECTOR = '';
class AnimationAstBuilderVisitor {
constructor(_driver) {
this._driver = _driver;
}
build(metadata, errors) {
const context = new AnimationAstBuilderContext(errors);
this._resetContextStyleTimingState(context);
return visitDslNode(this, normalizeAnimationEntry(metadata), context);
}
_resetContextStyleTimingState(context) {
context.currentQuerySelector = ROOT_SELECTOR;
context.collectedStyles = {};
context.collectedStyles[ROOT_SELECTOR] = {};
context.currentTime = 0;
}
visitTrigger(metadata, context) {
let queryCount = context.queryCount = 0;
let depCount = context.depCount = 0;
const states = [];
const transitions = [];
if (metadata.name.charAt(0) == '@') {
context.errors.push('animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\'@foo\', [...]))');
}
metadata.definitions.forEach(def => {
this._resetContextStyleTimingState(context);
if (def.type == 0 /* State */) {
const stateDef = def;
const name = stateDef.name;
name.toString().split(/\s*,\s*/).forEach(n => {
stateDef.name = n;
states.push(this.visitState(stateDef, context));
});
stateDef.name = name;
}
else if (def.type == 1 /* Transition */) {
const transition = this.visitTransition(def, context);
queryCount += transition.queryCount;
depCount += transition.depCount;
transitions.push(transition);
}
else {
context.errors.push('only state() and transition() definitions can sit inside of a trigger()');
}
});
return {
type: 7 /* Trigger */,
name: metadata.name,
states,
transitions,
queryCount,
depCount,
options: null
};
}
visitState(metadata, context) {
const styleAst = this.visitStyle(metadata.styles, context);
const astParams = (metadata.options && metadata.options.params) || null;
if (styleAst.containsDynamicStyles) {
const missingSubs = new Set();
const params = astParams || {};
styleAst.styles.forEach(value => {
if (isObject(value)) {
const stylesObj = value;
Object.keys(stylesObj).forEach(prop => {
extractStyleParams(stylesObj[prop]).forEach(sub => {
if (!params.hasOwnProperty(sub)) {
missingSubs.add(sub);
}
});
});
}
});
if (missingSubs.size) {
const missingSubsArr = iteratorToArray(missingSubs.values());
context.errors.push(`state("${metadata
.name}", ...) must define default values for all the following style substitutions: ${missingSubsArr.join(', ')}`);
}
}
return {
type: 0 /* State */,
name: metadata.name,
style: styleAst,
options: astParams ? { params: astParams } : null
};
}
visitTransition(metadata, context) {
context.queryCount = 0;
context.depCount = 0;
const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);
const matchers = parseTransitionExpr(metadata.expr, context.errors);
return {
type: 1 /* Transition */,
matchers,
animation,
queryCount: context.queryCount,
depCount: context.depCount,
options: normalizeAnimationOptions(metadata.options)
};
}
visitSequence(metadata, context) {
return {
type: 2 /* Sequence */,
steps: metadata.steps.map(s => visitDslNode(this, s, context)),
options: normalizeAnimationOptions(metadata.options)
};
}
visitGroup(metadata, context) {
const currentTime = context.currentTime;
let furthestTime = 0;
const steps = metadata.steps.map(step => {
context.currentTime = currentTime;
const innerAst = visitDslNode(this, step, context);
furthestTime = Math.max(furthestTime, context.currentTime);
return innerAst;
});
context.currentTime = furthestTime;
return {
type: 3 /* Group */,
steps,
options: normalizeAnimationOptions(metadata.options)
};
}
visitAnimate(metadata, context) {
const timingAst = constructTimingAst(metadata.timings, context.errors);
context.currentAnimateTimings = timingAst;
let styleAst;
let styleMetadata = metadata.styles ? metadata.styles : (0,_angular_animations__WEBPACK_IMPORTED_MODULE_0__.style)({});
if (styleMetadata.type == 5 /* Keyframes */) {
styleAst = this.visitKeyframes(styleMetadata, context);
}
else {
let styleMetadata = metadata.styles;
let isEmpty = false;
if (!styleMetadata) {
isEmpty = true;
const newStyleData = {};
if (timingAst.easing) {
newStyleData['easing'] = timingAst.easing;
}
styleMetadata = (0,_angular_animations__WEBPACK_IMPORTED_MODULE_0__.style)(newStyleData);
}
context.currentTime += timingAst.duration + timingAst.delay;
const _styleAst = this.visitStyle(styleMetadata, context);
_styleAst.isEmptyStep = isEmpty;
styleAst = _styleAst;
}
context.currentAnimateTimings = null;
return {
type: 4 /* Animate */,
timings: timingAst,
style: styleAst,
options: null
};
}
visitStyle(metadata, context) {
const ast = this._makeStyleAst(metadata, context);
this._validateStyleAst(ast, context);
return ast;
}
_makeStyleAst(metadata, context) {
const styles = [];
if (Array.isArray(metadata.styles)) {
metadata.styles.forEach(styleTuple => {
if (typeof styleTuple == 'string') {
if (styleTuple == _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE) {
styles.push(styleTuple);
}
else {
context.errors.push(`The provided style string value ${styleTuple} is not allowed.`);
}
}
else {
styles.push(styleTuple);
}
});
}
else {
styles.push(metadata.styles);
}
let containsDynamicStyles = false;
let collectedEasing = null;
styles.forEach(styleData => {
if (isObject(styleData)) {
const styleMap = styleData;
const easing = styleMap['easing'];
if (easing) {
collectedEasing = easing;
delete styleMap['easing'];
}
if (!containsDynamicStyles) {
for (let prop in styleMap) {
const value = styleMap[prop];
if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {
containsDynamicStyles = true;
break;
}
}
}
}
});
return {
type: 6 /* Style */,
styles,
easing: collectedEasing,
offset: metadata.offset,
containsDynamicStyles,
options: null
};
}
_validateStyleAst(ast, context) {
const timings = context.currentAnimateTimings;
let endTime = context.currentTime;
let startTime = context.currentTime;
if (timings && startTime > 0) {
startTime -= timings.duration + timings.delay;
}
ast.styles.forEach(tuple => {
if (typeof tuple == 'string')
return;
Object.keys(tuple).forEach(prop => {
if (!this._driver.validateStyleProperty(prop)) {
context.errors.push(`The provided animation property "${prop}" is not a supported CSS property for animations`);
return;
}
const collectedStyles = context.collectedStyles[context.currentQuerySelector];
const collectedEntry = collectedStyles[prop];
let updateCollectedStyle = true;
if (collectedEntry) {
if (startTime != endTime && startTime >= collectedEntry.startTime &&
endTime <= collectedEntry.endTime) {
context.errors.push(`The CSS property "${prop}" that exists between the times of "${collectedEntry.startTime}ms" and "${collectedEntry
.endTime}ms" is also being animated in a parallel animation between the times of "${startTime}ms" and "${endTime}ms"`);
updateCollectedStyle = false;
}
// we always choose the smaller start time value since we
// want to have a record of the entire animation window where
// the style property is being animated in between
startTime = collectedEntry.startTime;
}
if (updateCollectedStyle) {
collectedStyles[prop] = { startTime, endTime };
}
if (context.options) {
validateStyleParams(tuple[prop], context.options, context.errors);
}
});
});
}
visitKeyframes(metadata, context) {
const ast = { type: 5 /* Keyframes */, styles: [], options: null };
if (!context.currentAnimateTimings) {
context.errors.push(`keyframes() must be placed inside of a call to animate()`);
return ast;
}
const MAX_KEYFRAME_OFFSET = 1;
let totalKeyframesWithOffsets = 0;
const offsets = [];
let offsetsOutOfOrder = false;
let keyframesOutOfRange = false;
let previousOffset = 0;
const keyframes = metadata.steps.map(styles => {
const style = this._makeStyleAst(styles, context);
let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);
let offset = 0;
if (offsetVal != null) {
totalKeyframesWithOffsets++;
offset = style.offset = offsetVal;
}
keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;
offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;
previousOffset = offset;
offsets.push(offset);
return style;
});
if (keyframesOutOfRange) {
context.errors.push(`Please ensure that all keyframe offsets are between 0 and 1`);
}
if (offsetsOutOfOrder) {
context.errors.push(`Please ensure that all keyframe offsets are in order`);
}
const length = metadata.steps.length;
let generatedOffset = 0;
if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {
context.errors.push(`Not all style() steps within the declared keyframes() contain offsets`);
}
else if (totalKeyframesWithOffsets == 0) {
generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);
}
const limit = length - 1;
const currentTime = context.currentTime;
const currentAnimateTimings = context.currentAnimateTimings;
const animateDuration = currentAnimateTimings.duration;
keyframes.forEach((kf, i) => {
const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];
const durationUpToThisFrame = offset * animateDuration;
context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;
currentAnimateTimings.duration = durationUpToThisFrame;
this._validateStyleAst(kf, context);
kf.offset = offset;
ast.styles.push(kf);
});
return ast;
}
visitReference(metadata, context) {
return {
type: 8 /* Reference */,
animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),
options: normalizeAnimationOptions(metadata.options)
};
}
visitAnimateChild(metadata, context) {
context.depCount++;
return {
type: 9 /* AnimateChild */,
options: normalizeAnimationOptions(metadata.options)
};
}
visitAnimateRef(metadata, context) {
return {
type: 10 /* AnimateRef */,
animation: this.visitReference(metadata.animation, context),
options: normalizeAnimationOptions(metadata.options)
};
}
visitQuery(metadata, context) {
const parentSelector = context.currentQuerySelector;
const options = (metadata.options || {});
context.queryCount++;
context.currentQuery = metadata;
const [selector, includeSelf] = normalizeSelector(metadata.selector);
context.currentQuerySelector =
parentSelector.length ? (parentSelector + ' ' + selector) : selector;
getOrSetAsInMap(context.collectedStyles, context.currentQuerySelector, {});
const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);
context.currentQuery = null;
context.currentQuerySelector = parentSelector;
return {
type: 11 /* Query */,
selector,
limit: options.limit || 0,
optional: !!options.optional,
includeSelf,
animation,
originalSelector: metadata.selector,
options: normalizeAnimationOptions(metadata.options)
};
}
visitStagger(metadata, context) {
if (!context.currentQuery) {
context.errors.push(`stagger() can only be used inside of query()`);
}
const timings = metadata.timings === 'full' ?
{ duration: 0, delay: 0, easing: 'full' } :
resolveTiming(metadata.timings, context.errors, true);
return {
type: 12 /* Stagger */,
animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),
timings,
options: null
};
}
}
function normalizeSelector(selector) {
const hasAmpersand = selector.split(/\s*,\s*/).find(token => token == SELF_TOKEN) ? true : false;
if (hasAmpersand) {
selector = selector.replace(SELF_TOKEN_REGEX, '');
}
// the :enter and :leave selectors are filled in at runtime during timeline building
selector = selector.replace(/@\*/g, NG_TRIGGER_SELECTOR)
.replace(/@\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.substr(1))
.replace(/:animating/g, NG_ANIMATING_SELECTOR);
return [selector, hasAmpersand];
}
function normalizeParams(obj) {
return obj ? copyObj(obj) : null;
}
class AnimationAstBuilderContext {
constructor(errors) {
this.errors = errors;
this.queryCount = 0;
this.depCount = 0;
this.currentTransition = null;
this.currentQuery = null;
this.currentQuerySelector = null;
this.currentAnimateTimings = null;
this.currentTime = 0;
this.collectedStyles = {};
this.options = null;
}
}
function consumeOffset(styles) {
if (typeof styles == 'string')
return null;
let offset = null;
if (Array.isArray(styles)) {
styles.forEach(styleTuple => {
if (isObject(styleTuple) && styleTuple.hasOwnProperty('offset')) {
const obj = styleTuple;
offset = parseFloat(obj['offset']);
delete obj['offset'];
}
});
}
else if (isObject(styles) && styles.hasOwnProperty('offset')) {
const obj = styles;
offset = parseFloat(obj['offset']);
delete obj['offset'];
}
return offset;
}
function isObject(value) {
return !Array.isArray(value) && typeof value == 'object';
}
function constructTimingAst(value, errors) {
let timings = null;
if (value.hasOwnProperty('duration')) {
timings = value;
}
else if (typeof value == 'number') {
const duration = resolveTiming(value, errors).duration;
return makeTimingAst(duration, 0, '');
}
const strValue = value;
const isDynamic = strValue.split(/\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');
if (isDynamic) {
const ast = makeTimingAst(0, 0, '');
ast.dynamic = true;
ast.strValue = strValue;
return ast;
}
timings = timings || resolveTiming(strValue, errors);
return makeTimingAst(timings.duration, timings.delay, timings.easing);
}
function normalizeAnimationOptions(options) {
if (options) {
options = copyObj(options);
if (options['params']) {
options['params'] = normalizeParams(options['params']);
}
}
else {
options = {};
}
return options;
}
function makeTimingAst(duration, delay, easing) {
return { duration, delay, easing };
}
function createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {
return {
type: 1 /* TimelineAnimation */,
element,
keyframes,
preStyleProps,
postStyleProps,
duration,
delay,
totalTime: duration + delay,
easing,
subTimeline
};
}
class ElementInstructionMap {
constructor() {
this._map = new Map();
}
consume(element) {
let instructions = this._map.get(element);
if (instructions) {
this._map.delete(element);
}
else {
instructions = [];
}
return instructions;
}
append(element, instructions) {
let existingInstructions = this._map.get(element);
if (!existingInstructions) {
this._map.set(element, existingInstructions = []);
}
existingInstructions.push(...instructions);
}
has(element) {
return this._map.has(element);
}
clear() {
this._map.clear();
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ONE_FRAME_IN_MILLISECONDS = 1;
const ENTER_TOKEN = ':enter';
const ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');
const LEAVE_TOKEN = ':leave';
const LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');
/*
* The code within this file aims to generate web-animations-compatible keyframes from Angular's
* animation DSL code.
*
* The code below will be converted from:
*
* ```
* sequence([
* style({ opacity: 0 }),
* animate(1000, style({ opacity: 0 }))
* ])
* ```
*
* To:
* ```
* keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]
* duration = 1000
* delay = 0
* easing = ''
* ```
*
* For this operation to cover the combination of animation verbs (style, animate, group, etc...) a
* combination of prototypical inheritance, AST traversal and merge-sort-like algorithms are used.
*
* [AST Traversal]
* Each of the animation verbs, when executed, will return an string-map object representing what
* type of action it is (style, animate, group, etc...) and the data associated with it. This means
* that when functional composition mix of these functions is evaluated (like in the example above)
* then it will end up producing a tree of objects representing the animation itself.
*
* When this animation object tree is processed by the visitor code below it will visit each of the
* verb statements within the visitor. And during each visit it will build the context of the
* animation keyframes by interacting with the `TimelineBuilder`.
*
* [TimelineBuilder]
* This class is responsible for tracking the styles and building a series of keyframe objects for a
* timeline between a start and end time. The builder starts off with an initial timeline and each
* time the AST comes across a `group()`, `keyframes()` or a combination of the two wihtin a
* `sequence()` then it will generate a sub timeline for each step as well as a new one after
* they are complete.
*
* As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub
* timeline was created (based on one of the cases above) then the parent timeline will attempt to
* merge the styles used within the sub timelines into itself (only with group() this will happen).
* This happens with a merge operation (much like how the merge works in mergesort) and it will only
* copy the most recently used styles from the sub timelines into the parent timeline. This ensures
* that if the styles are used later on in another phase of the animation then they will be the most
* up-to-date values.
*
* [How Missing Styles Are Updated]
* Each timeline has a `backFill` property which is responsible for filling in new styles into
* already processed keyframes if a new style shows up later within the animation sequence.
*
* ```
* sequence([
* style({ width: 0 }),
* animate(1000, style({ width: 100 })),
* animate(1000, style({ width: 200 })),
* animate(1000, style({ width: 300 }))
* animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere
* else
* ])
* ```
*
* What is happening here is that the `height` value is added later in the sequence, but is missing
* from all previous animation steps. Therefore when a keyframe is created it would also be missing
* from all previous keyframes up until where it is first used. For the timeline keyframe generation
* to properly fill in the style it will place the previous value (the value from the parent
* timeline) or a default value of `*` into the backFill object. Given that each of the keyframe
* styles are objects that prototypically inhert from the backFill object, this means that if a
* value is added into the backFill then it will automatically propagate any missing values to all
* keyframes. Therefore the missing `height` value will be properly filled into the already
* processed keyframes.
*
* When a sub-timeline is created it will have its own backFill property. This is done so that
* styles present within the sub-timeline do not accidentally seep into the previous/future timeline
* keyframes
*
* (For prototypically-inherited contents to be detected a `for(i in obj)` loop must be used.)
*
* [Validation]
* The code in this file is not responsible for validation. That functionality happens with within
* the `AnimationValidatorVisitor` code.
*/
function buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = {}, finalStyles = {}, options, subInstructions, errors = []) {
return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);
}
class AnimationTimelineBuilderVisitor {
buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {
subInstructions = subInstructions || new ElementInstructionMap();
const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);
context.options = options;
context.currentTimeline.setStyles([startingStyles], null, context.errors, options);
visitDslNode(this, ast, context);
// this checks to see if an actual animation happened
const timelines = context.timelines.filter(timeline => timeline.containsAnimation());
if (timelines.length && Object.keys(finalStyles).length) {
const tl = timelines[timelines.length - 1];
if (!tl.allowOnlyTimelineStyles()) {
tl.setStyles([finalStyles], null, context.errors, options);
}
}
return timelines.length ? timelines.map(timeline => timeline.buildKeyframes()) :
[createTimelineInstruction(rootElement, [], [], [], 0, 0, '', false)];
}
visitTrigger(ast, context) {
// these values are not visited in this AST
}
visitState(ast, context) {
// these values are not visited in this AST
}
visitTransition(ast, context) {
// these values are not visited in this AST
}
visitAnimateChild(ast, context) {
const elementInstructions = context.subInstructions.consume(context.element);
if (elementInstructions) {
const innerContext = context.createSubContext(ast.options);
const startTime = context.currentTimeline.currentTime;
const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);
if (startTime != endTime) {
// we do this on the upper context because we created a sub context for
// the sub child animations
context.transformIntoNewTimeline(endTime);
}
}
context.previousNode = ast;
}
visitAnimateRef(ast, context) {
const innerContext = context.createSubContext(ast.options);
innerContext.transformIntoNewTimeline();
this.visitReference(ast.animation, innerContext);
context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);
context.previousNode = ast;
}
_visitSubInstructions(instructions, context, options) {
const startTime = context.currentTimeline.currentTime;
let furthestTime = startTime;
// this is a special-case for when a user wants to skip a sub
// animation from being fired entirely.
const duration = options.duration != null ? resolveTimingValue(options.duration) : null;
const delay = options.delay != null ? resolveTimingValue(options.delay) : null;
if (duration !== 0) {
instructions.forEach(instruction => {
const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);
furthestTime =
Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);
});
}
return furthestTime;
}
visitReference(ast, context) {
context.updateOptions(ast.options, true);
visitDslNode(this, ast.animation, context);
context.previousNode = ast;
}
visitSequence(ast, context) {
const subContextCount = context.subContextCount;
let ctx = context;
const options = ast.options;
if (options && (options.params || options.delay)) {
ctx = context.createSubContext(options);
ctx.transformIntoNewTimeline();
if (options.delay != null) {
if (ctx.previousNode.type == 6 /* Style */) {
ctx.currentTimeline.snapshotCurrentStyles();
ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;
}
const delay = resolveTimingValue(options.delay);
ctx.delayNextStep(delay);
}
}
if (ast.steps.length) {
ast.steps.forEach(s => visitDslNode(this, s, ctx));
// this is here just incase the inner steps only contain or end with a style() call
ctx.currentTimeline.applyStylesToKeyframe();
// this means that some animation function within the sequence
// ended up creating a sub timeline (which means the current
// timeline cannot overlap with the contents of the sequence)
if (ctx.subContextCount > subContextCount) {
ctx.transformIntoNewTimeline();
}
}
context.previousNode = ast;
}
visitGroup(ast, context) {
const innerTimelines = [];
let furthestTime = context.currentTimeline.currentTime;
const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;
ast.steps.forEach(s => {
const innerContext = context.createSubContext(ast.options);
if (delay) {
innerContext.delayNextStep(delay);
}
visitDslNode(this, s, innerContext);
furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);
innerTimelines.push(innerContext.currentTimeline);
});
// this operation is run after the AST loop because otherwise
// if the parent timeline's collected styles were updated then
// it would pass in invalid data into the new-to-be forked items
innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));
context.transformIntoNewTimeline(furthestTime);
context.previousNode = ast;
}
_visitTiming(ast, context) {
if (ast.dynamic) {
const strValue = ast.strValue;
const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;
return resolveTiming(timingValue, context.errors);
}
else {
return { duration: ast.duration, delay: ast.delay, easing: ast.easing };
}
}
visitAnimate(ast, context) {
const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);
const timeline = context.currentTimeline;
if (timings.delay) {
context.incrementTime(timings.delay);
timeline.snapshotCurrentStyles();
}
const style = ast.style;
if (style.type == 5 /* Keyframes */) {
this.visitKeyframes(style, context);
}
else {
context.incrementTime(timings.duration);
this.visitStyle(style, context);
timeline.applyStylesToKeyframe();
}
context.currentAnimateTimings = null;
context.previousNode = ast;
}
visitStyle(ast, context) {
const timeline = context.currentTimeline;
const timings = context.currentAnimateTimings;
// this is a special case for when a style() call
// directly follows an animate() call (but not inside of an animate() call)
if (!timings && timeline.getCurrentStyleProperties().length) {
timeline.forwardFrame();
}
const easing = (timings && timings.easing) || ast.easing;
if (ast.isEmptyStep) {
timeline.applyEmptyStep(easing);
}
else {
timeline.setStyles(ast.styles, easing, context.errors, context.options);
}
context.previousNode = ast;
}
visitKeyframes(ast, context) {
const currentAnimateTimings = context.currentAnimateTimings;
const startTime = (context.currentTimeline).duration;
const duration = currentAnimateTimings.duration;
const innerContext = context.createSubContext();
const innerTimeline = innerContext.currentTimeline;
innerTimeline.easing = currentAnimateTimings.easing;
ast.styles.forEach(step => {
const offset = step.offset || 0;
innerTimeline.forwardTime(offset * duration);
innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);
innerTimeline.applyStylesToKeyframe();
});
// this will ensure that the parent timeline gets all the styles from
// the child even if the new timeline below is not used
context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);
// we do this because the window between this timeline and the sub timeline
// should ensure that the styles within are exactly the same as they were before
context.transformIntoNewTimeline(startTime + duration);
context.previousNode = ast;
}
visitQuery(ast, context) {
// in the event that the first step before this is a style step we need
// to ensure the styles are applied before the children are animated
const startTime = context.currentTimeline.currentTime;
const options = (ast.options || {});
const delay = options.delay ? resolveTimingValue(options.delay) : 0;
if (delay &&
(context.previousNode.type === 6 /* Style */ ||
(startTime == 0 && context.currentTimeline.getCurrentStyleProperties().length))) {
context.currentTimeline.snapshotCurrentStyles();
context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;
}
let furthestTime = startTime;
const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);
context.currentQueryTotal = elms.length;
let sameElementTimeline = null;
elms.forEach((element, i) => {
context.currentQueryIndex = i;
const innerContext = context.createSubContext(ast.options, element);
if (delay) {
innerContext.delayNextStep(delay);
}
if (element === context.element) {
sameElementTimeline = innerContext.currentTimeline;
}
visitDslNode(this, ast.animation, innerContext);
// this is here just incase the inner steps only contain or end
// with a style() call (which is here to signal that this is a preparatory
// call to style an element before it is animated again)
innerContext.currentTimeline.applyStylesToKeyframe();
const endTime = innerContext.currentTimeline.currentTime;
furthestTime = Math.max(furthestTime, endTime);
});
context.currentQueryIndex = 0;
context.currentQueryTotal = 0;
context.transformIntoNewTimeline(furthestTime);
if (sameElementTimeline) {
context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);
context.currentTimeline.snapshotCurrentStyles();
}
context.previousNode = ast;
}
visitStagger(ast, context) {
const parentContext = context.parentContext;
const tl = context.currentTimeline;
const timings = ast.timings;
const duration = Math.abs(timings.duration);
const maxTime = duration * (context.currentQueryTotal - 1);
let delay = duration * context.currentQueryIndex;
let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;
switch (staggerTransformer) {
case 'reverse':
delay = maxTime - delay;
break;
case 'full':
delay = parentContext.currentStaggerTime;
break;
}
const timeline = context.currentTimeline;
if (delay) {
timeline.delayNextStep(delay);
}
const startingTime = timeline.currentTime;
visitDslNode(this, ast.animation, context);
context.previousNode = ast;
// time = duration + delay
// the reason why this computation is so complex is because
// the inner timeline may either have a delay value or a stretched
// keyframe depending on if a subtimeline is not used or is used.
parentContext.currentStaggerTime =
(tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);
}
}
const DEFAULT_NOOP_PREVIOUS_NODE = {};
class AnimationTimelineContext {
constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {
this._driver = _driver;
this.element = element;
this.subInstructions = subInstructions;
this._enterClassName = _enterClassName;
this._leaveClassName = _leaveClassName;
this.errors = errors;
this.timelines = timelines;
this.parentContext = null;
this.currentAnimateTimings = null;
this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;
this.subContextCount = 0;
this.options = {};
this.currentQueryIndex = 0;
this.currentQueryTotal = 0;
this.currentStaggerTime = 0;
this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);
timelines.push(this.currentTimeline);
}
get params() {
return this.options.params;
}
updateOptions(options, skipIfExists) {
if (!options)
return;
const newOptions = options;
let optionsToUpdate = this.options;
// NOTE: this will get patched up when other animation methods support duration overrides
if (newOptions.duration != null) {
optionsToUpdate.duration = resolveTimingValue(newOptions.duration);
}
if (newOptions.delay != null) {
optionsToUpdate.delay = resolveTimingValue(newOptions.delay);
}
const newParams = newOptions.params;
if (newParams) {
let paramsToUpdate = optionsToUpdate.params;
if (!paramsToUpdate) {
paramsToUpdate = this.options.params = {};
}
Object.keys(newParams).forEach(name => {
if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {
paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);
}
});
}
}
_copyOptions() {
const options = {};
if (this.options) {
const oldParams = this.options.params;
if (oldParams) {
const params = options['params'] = {};
Object.keys(oldParams).forEach(name => {
params[name] = oldParams[name];
});
}
}
return options;
}
createSubContext(options = null, element, newTime) {
const target = element || this.element;
const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));
context.previousNode = this.previousNode;
context.currentAnimateTimings = this.currentAnimateTimings;
context.options = this._copyOptions();
context.updateOptions(options);
context.currentQueryIndex = this.currentQueryIndex;
context.currentQueryTotal = this.currentQueryTotal;
context.parentContext = this;
this.subContextCount++;
return context;
}
transformIntoNewTimeline(newTime) {
this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;
this.currentTimeline = this.currentTimeline.fork(this.element, newTime);
this.timelines.push(this.currentTimeline);
return this.currentTimeline;
}
appendInstructionToTimeline(instruction, duration, delay) {
const updatedTimings = {
duration: duration != null ? duration : instruction.duration,
delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,
easing: ''
};
const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);
this.timelines.push(builder);
return updatedTimings;
}
incrementTime(time) {
this.currentTimeline.forwardTime(this.currentTimeline.duration + time);
}
delayNextStep(delay) {
// negative delays are not yet supported
if (delay > 0) {
this.currentTimeline.delayNextStep(delay);
}
}
invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {
let results = [];
if (includeSelf) {
results.push(this.element);
}
if (selector.length > 0) { // if :self is only used then the selector is empty
selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);
selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);
const multi = limit != 1;
let elements = this._driver.query(this.element, selector, multi);
if (limit !== 0) {
elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :
elements.slice(0, limit);
}
results.push(...elements);
}
if (!optional && results.length == 0) {
errors.push(`\`query("${originalSelector}")\` returned zero elements. (Use \`query("${originalSelector}", { optional: true })\` if you wish to allow this.)`);
}
return results;
}
}
class TimelineBuilder {
constructor(_driver, element, startTime, _elementTimelineStylesLookup) {
this._driver = _driver;
this.element = element;
this.startTime = startTime;
this._elementTimelineStylesLookup = _elementTimelineStylesLookup;
this.duration = 0;
this._previousKeyframe = {};
this._currentKeyframe = {};
this._keyframes = new Map();
this._styleSummary = {};
this._pendingStyles = {};
this._backFill = {};
this._currentEmptyStepKeyframe = null;
if (!this._elementTimelineStylesLookup) {
this._elementTimelineStylesLookup = new Map();
}
this._localTimelineStyles = Object.create(this._backFill, {});
this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);
if (!this._globalTimelineStyles) {
this._globalTimelineStyles = this._localTimelineStyles;
this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);
}
this._loadKeyframe();
}
containsAnimation() {
switch (this._keyframes.size) {
case 0:
return false;
case 1:
return this.getCurrentStyleProperties().length > 0;
default:
return true;
}
}
getCurrentStyleProperties() {
return Object.keys(this._currentKeyframe);
}
get currentTime() {
return this.startTime + this.duration;
}
delayNextStep(delay) {
// in the event that a style() step is placed right before a stagger()
// and that style() step is the very first style() value in the animation
// then we need to make a copy of the keyframe [0, copy, 1] so that the delay
// properly applies the style() values to work with the stagger...
const hasPreStyleStep = this._keyframes.size == 1 && Object.keys(this._pendingStyles).length;
if (this.duration || hasPreStyleStep) {
this.forwardTime(this.currentTime + delay);
if (hasPreStyleStep) {
this.snapshotCurrentStyles();
}
}
else {
this.startTime += delay;
}
}
fork(element, currentTime) {
this.applyStylesToKeyframe();
return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);
}
_loadKeyframe() {
if (this._currentKeyframe) {
this._previousKeyframe = this._currentKeyframe;
}
this._currentKeyframe = this._keyframes.get(this.duration);
if (!this._currentKeyframe) {
this._currentKeyframe = Object.create(this._backFill, {});
this._keyframes.set(this.duration, this._currentKeyframe);
}
}
forwardFrame() {
this.duration += ONE_FRAME_IN_MILLISECONDS;
this._loadKeyframe();
}
forwardTime(time) {
this.applyStylesToKeyframe();
this.duration = time;
this._loadKeyframe();
}
_updateStyle(prop, value) {
this._localTimelineStyles[prop] = value;
this._globalTimelineStyles[prop] = value;
this._styleSummary[prop] = { time: this.currentTime, value };
}
allowOnlyTimelineStyles() {
return this._currentEmptyStepKeyframe !== this._currentKeyframe;
}
applyEmptyStep(easing) {
if (easing) {
this._previousKeyframe['easing'] = easing;
}
// special case for animate(duration):
// all missing styles are filled with a `*` value then
// if any destination styles are filled in later on the same
// keyframe then they will override the overridden styles
// We use `_globalTimelineStyles` here because there may be
// styles in previous keyframes that are not present in this timeline
Object.keys(this._globalTimelineStyles).forEach(prop => {
this._backFill[prop] = this._globalTimelineStyles[prop] || _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE;
this._currentKeyframe[prop] = _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE;
});
this._currentEmptyStepKeyframe = this._currentKeyframe;
}
setStyles(input, easing, errors, options) {
if (easing) {
this._previousKeyframe['easing'] = easing;
}
const params = (options && options.params) || {};
const styles = flattenStyles(input, this._globalTimelineStyles);
Object.keys(styles).forEach(prop => {
const val = interpolateParams(styles[prop], params, errors);
this._pendingStyles[prop] = val;
if (!this._localTimelineStyles.hasOwnProperty(prop)) {
this._backFill[prop] = this._globalTimelineStyles.hasOwnProperty(prop) ?
this._globalTimelineStyles[prop] :
_angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE;
}
this._updateStyle(prop, val);
});
}
applyStylesToKeyframe() {
const styles = this._pendingStyles;
const props = Object.keys(styles);
if (props.length == 0)
return;
this._pendingStyles = {};
props.forEach(prop => {
const val = styles[prop];
this._currentKeyframe[prop] = val;
});
Object.keys(this._localTimelineStyles).forEach(prop => {
if (!this._currentKeyframe.hasOwnProperty(prop)) {
this._currentKeyframe[prop] = this._localTimelineStyles[prop];
}
});
}
snapshotCurrentStyles() {
Object.keys(this._localTimelineStyles).forEach(prop => {
const val = this._localTimelineStyles[prop];
this._pendingStyles[prop] = val;
this._updateStyle(prop, val);
});
}
getFinalKeyframe() {
return this._keyframes.get(this.duration);
}
get properties() {
const properties = [];
for (let prop in this._currentKeyframe) {
properties.push(prop);
}
return properties;
}
mergeTimelineCollectedStyles(timeline) {
Object.keys(timeline._styleSummary).forEach(prop => {
const details0 = this._styleSummary[prop];
const details1 = timeline._styleSummary[prop];
if (!details0 || details1.time > details0.time) {
this._updateStyle(prop, details1.value);
}
});
}
buildKeyframes() {
this.applyStylesToKeyframe();
const preStyleProps = new Set();
const postStyleProps = new Set();
const isEmpty = this._keyframes.size === 1 && this.duration === 0;
let finalKeyframes = [];
this._keyframes.forEach((keyframe, time) => {
const finalKeyframe = copyStyles(keyframe, true);
Object.keys(finalKeyframe).forEach(prop => {
const value = finalKeyframe[prop];
if (value == _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]) {
preStyleProps.add(prop);
}
else if (value == _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE) {
postStyleProps.add(prop);
}
});
if (!isEmpty) {
finalKeyframe['offset'] = time / this.duration;
}
finalKeyframes.push(finalKeyframe);
});
const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];
const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];
// special case for a 0-second animation (which is designed just to place styles onscreen)
if (isEmpty) {
const kf0 = finalKeyframes[0];
const kf1 = copyObj(kf0);
kf0['offset'] = 0;
kf1['offset'] = 1;
finalKeyframes = [kf0, kf1];
}
return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);
}
}
class SubTimelineBuilder extends TimelineBuilder {
constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {
super(driver, element, timings.delay);
this.element = element;
this.keyframes = keyframes;
this.preStyleProps = preStyleProps;
this.postStyleProps = postStyleProps;
this._stretchStartingKeyframe = _stretchStartingKeyframe;
this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };
}
containsAnimation() {
return this.keyframes.length > 1;
}
buildKeyframes() {
let keyframes = this.keyframes;
let { delay, duration, easing } = this.timings;
if (this._stretchStartingKeyframe && delay) {
const newKeyframes = [];
const totalTime = duration + delay;
const startingGap = delay / totalTime;
// the original starting keyframe now starts once the delay is done
const newFirstKeyframe = copyStyles(keyframes[0], false);
newFirstKeyframe['offset'] = 0;
newKeyframes.push(newFirstKeyframe);
const oldFirstKeyframe = copyStyles(keyframes[0], false);
oldFirstKeyframe['offset'] = roundOffset(startingGap);
newKeyframes.push(oldFirstKeyframe);
/*
When the keyframe is stretched then it means that the delay before the animation
starts is gone. Instead the first keyframe is placed at the start of the animation
and it is then copied to where it starts when the original delay is over. This basically
means nothing animates during that delay, but the styles are still renderered. For this
to work the original offset values that exist in the original keyframes must be "warped"
so that they can take the new keyframe + delay into account.
delay=1000, duration=1000, keyframes = 0 .5 1
turns into
delay=0, duration=2000, keyframes = 0 .33 .66 1
*/
// offsets between 1 ... n -1 are all warped by the keyframe stretch
const limit = keyframes.length - 1;
for (let i = 1; i <= limit; i++) {
let kf = copyStyles(keyframes[i], false);
const oldOffset = kf['offset'];
const timeAtKeyframe = delay + oldOffset * duration;
kf['offset'] = roundOffset(timeAtKeyframe / totalTime);
newKeyframes.push(kf);
}
// the new starting keyframe should be added at the start
duration = totalTime;
delay = 0;
easing = '';
keyframes = newKeyframes;
}
return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);
}
}
function roundOffset(offset, decimalPoints = 3) {
const mult = Math.pow(10, decimalPoints - 1);
return Math.round(offset * mult) / mult;
}
function flattenStyles(input, allStyles) {
const styles = {};
let allProperties;
input.forEach(token => {
if (token === '*') {
allProperties = allProperties || Object.keys(allStyles);
allProperties.forEach(prop => {
styles[prop] = _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE;
});
}
else {
copyStyles(token, false, styles);
}
});
return styles;
}
class Animation {
constructor(_driver, input) {
this._driver = _driver;
const errors = [];
const ast = buildAnimationAst(_driver, input, errors);
if (errors.length) {
const errorMessage = `animation validation failed:\n${errors.join('\n')}`;
throw new Error(errorMessage);
}
this._animationAst = ast;
}
buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {
const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :
startingStyles;
const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :
destinationStyles;
const errors = [];
subInstructions = subInstructions || new ElementInstructionMap();
const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);
if (errors.length) {
const errorMessage = `animation building failed:\n${errors.join('\n')}`;
throw new Error(errorMessage);
}
return result;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @publicApi
*/
class AnimationStyleNormalizer {
}
/**
* @publicApi
*/
class NoopAnimationStyleNormalizer {
normalizePropertyName(propertyName, errors) {
return propertyName;
}
normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {
return value;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
class WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {
normalizePropertyName(propertyName, errors) {
return dashCaseToCamelCase(propertyName);
}
normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {
let unit = '';
const strVal = value.toString().trim();
if (DIMENSIONAL_PROP_MAP[normalizedProperty] && value !== 0 && value !== '0') {
if (typeof value === 'number') {
unit = 'px';
}
else {
const valAndSuffixMatch = value.match(/^[+-]?[\d\.]+([a-z]*)$/);
if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {
errors.push(`Please provide a CSS unit value for ${userProvidedProperty}:${value}`);
}
}
}
return strVal + unit;
}
}
const ɵ0$1 = () => makeBooleanMap('width,height,minWidth,minHeight,maxWidth,maxHeight,left,top,bottom,right,fontSize,outlineWidth,outlineOffset,paddingTop,paddingLeft,paddingBottom,paddingRight,marginTop,marginLeft,marginBottom,marginRight,borderRadius,borderWidth,borderTopWidth,borderLeftWidth,borderRightWidth,borderBottomWidth,textIndent,perspective'
.split(','));
const DIMENSIONAL_PROP_MAP = (ɵ0$1)();
function makeBooleanMap(keys) {
const map = {};
keys.forEach(key => map[key] = true);
return map;
}
function createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {
return {
type: 0 /* TransitionAnimation */,
element,
triggerName,
isRemovalTransition,
fromState,
fromStyles,
toState,
toStyles,
timelines,
queriedElements,
preStyleProps,
postStyleProps,
totalTime,
errors
};
}
const EMPTY_OBJECT = {};
class AnimationTransitionFactory {
constructor(_triggerName, ast, _stateStyles) {
this._triggerName = _triggerName;
this.ast = ast;
this._stateStyles = _stateStyles;
}
match(currentState, nextState, element, params) {
return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);
}
buildStyles(stateName, params, errors) {
const backupStateStyler = this._stateStyles['*'];
const stateStyler = this._stateStyles[stateName];
const backupStyles = backupStateStyler ? backupStateStyler.buildStyles(params, errors) : {};
return stateStyler ? stateStyler.buildStyles(params, errors) : backupStyles;
}
build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {
const errors = [];
const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;
const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;
const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);
const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;
const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);
const queriedElements = new Set();
const preStyleMap = new Map();
const postStyleMap = new Map();
const isRemoval = nextState === 'void';
const animationOptions = { params: Object.assign(Object.assign({}, transitionAnimationParams), nextAnimationParams) };
const timelines = skipAstBuild ?
[] :
buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);
let totalTime = 0;
timelines.forEach(tl => {
totalTime = Math.max(tl.duration + tl.delay, totalTime);
});
if (errors.length) {
return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);
}
timelines.forEach(tl => {
const elm = tl.element;
const preProps = getOrSetAsInMap(preStyleMap, elm, {});
tl.preStyleProps.forEach(prop => preProps[prop] = true);
const postProps = getOrSetAsInMap(postStyleMap, elm, {});
tl.postStyleProps.forEach(prop => postProps[prop] = true);
if (elm !== element) {
queriedElements.add(elm);
}
});
const queriedElementsList = iteratorToArray(queriedElements.values());
return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);
}
}
function oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {
return matchFns.some(fn => fn(currentState, nextState, element, params));
}
class AnimationStateStyles {
constructor(styles, defaultParams) {
this.styles = styles;
this.defaultParams = defaultParams;
}
buildStyles(params, errors) {
const finalStyles = {};
const combinedParams = copyObj(this.defaultParams);
Object.keys(params).forEach(key => {
const value = params[key];
if (value != null) {
combinedParams[key] = value;
}
});
this.styles.styles.forEach(value => {
if (typeof value !== 'string') {
const styleObj = value;
Object.keys(styleObj).forEach(prop => {
let val = styleObj[prop];
if (val.length > 1) {
val = interpolateParams(val, combinedParams, errors);
}
finalStyles[prop] = val;
});
}
});
return finalStyles;
}
}
/**
* @publicApi
*/
function buildTrigger(name, ast) {
return new AnimationTrigger(name, ast);
}
/**
* @publicApi
*/
class AnimationTrigger {
constructor(name, ast) {
this.name = name;
this.ast = ast;
this.transitionFactories = [];
this.states = {};
ast.states.forEach(ast => {
const defaultParams = (ast.options && ast.options.params) || {};
this.states[ast.name] = new AnimationStateStyles(ast.style, defaultParams);
});
balanceProperties(this.states, 'true', '1');
balanceProperties(this.states, 'false', '0');
ast.transitions.forEach(ast => {
this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));
});
this.fallbackTransition = createFallbackTransition(name, this.states);
}
get containsQueries() {
return this.ast.queryCount > 0;
}
matchTransition(currentState, nextState, element, params) {
const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));
return entry || null;
}
matchStyles(currentState, params, errors) {
return this.fallbackTransition.buildStyles(currentState, params, errors);
}
}
function createFallbackTransition(triggerName, states) {
const matchers = [(fromState, toState) => true];
const animation = { type: 2 /* Sequence */, steps: [], options: null };
const transition = {
type: 1 /* Transition */,
animation,
matchers,
options: null,
queryCount: 0,
depCount: 0
};
return new AnimationTransitionFactory(triggerName, transition, states);
}
function balanceProperties(obj, key1, key2) {
if (obj.hasOwnProperty(key1)) {
if (!obj.hasOwnProperty(key2)) {
obj[key2] = obj[key1];
}
}
else if (obj.hasOwnProperty(key2)) {
obj[key1] = obj[key2];
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();
class TimelineAnimationEngine {
constructor(bodyNode, _driver, _normalizer) {
this.bodyNode = bodyNode;
this._driver = _driver;
this._normalizer = _normalizer;
this._animations = {};
this._playersById = {};
this.players = [];
}
register(id, metadata) {
const errors = [];
const ast = buildAnimationAst(this._driver, metadata, errors);
if (errors.length) {
throw new Error(`Unable to build the animation due to the following errors: ${errors.join('\n')}`);
}
else {
this._animations[id] = ast;
}
}
_buildPlayer(i, preStyles, postStyles) {
const element = i.element;
const keyframes = normalizeKeyframes(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);
return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);
}
create(id, element, options = {}) {
const errors = [];
const ast = this._animations[id];
let instructions;
const autoStylesMap = new Map();
if (ast) {
instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, {}, {}, options, EMPTY_INSTRUCTION_MAP, errors);
instructions.forEach(inst => {
const styles = getOrSetAsInMap(autoStylesMap, inst.element, {});
inst.postStyleProps.forEach(prop => styles[prop] = null);
});
}
else {
errors.push('The requested animation doesn\'t exist or has already been destroyed');
instructions = [];
}
if (errors.length) {
throw new Error(`Unable to create the animation due to the following errors: ${errors.join('\n')}`);
}
autoStylesMap.forEach((styles, element) => {
Object.keys(styles).forEach(prop => {
styles[prop] = this._driver.computeStyle(element, prop, _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE);
});
});
const players = instructions.map(i => {
const styles = autoStylesMap.get(i.element);
return this._buildPlayer(i, {}, styles);
});
const player = optimizeGroupPlayer(players);
this._playersById[id] = player;
player.onDestroy(() => this.destroy(id));
this.players.push(player);
return player;
}
destroy(id) {
const player = this._getPlayer(id);
player.destroy();
delete this._playersById[id];
const index = this.players.indexOf(player);
if (index >= 0) {
this.players.splice(index, 1);
}
}
_getPlayer(id) {
const player = this._playersById[id];
if (!player) {
throw new Error(`Unable to find the timeline player referenced by ${id}`);
}
return player;
}
listen(id, element, eventName, callback) {
// triggerName, fromState, toState are all ignored for timeline animations
const baseEvent = makeAnimationEvent(element, '', '', '');
listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);
return () => { };
}
command(id, element, command, args) {
if (command == 'register') {
this.register(id, args[0]);
return;
}
if (command == 'create') {
const options = (args[0] || {});
this.create(id, element, options);
return;
}
const player = this._getPlayer(id);
switch (command) {
case 'play':
player.play();
break;
case 'pause':
player.pause();
break;
case 'reset':
player.reset();
break;
case 'restart':
player.restart();
break;
case 'finish':
player.finish();
break;
case 'init':
player.init();
break;
case 'setPosition':
player.setPosition(parseFloat(args[0]));
break;
case 'destroy':
this.destroy(id);
break;
}
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const QUEUED_CLASSNAME = 'ng-animate-queued';
const QUEUED_SELECTOR = '.ng-animate-queued';
const DISABLED_CLASSNAME = 'ng-animate-disabled';
const DISABLED_SELECTOR = '.ng-animate-disabled';
const STAR_CLASSNAME = 'ng-star-inserted';
const STAR_SELECTOR = '.ng-star-inserted';
const EMPTY_PLAYER_ARRAY = [];
const NULL_REMOVAL_STATE = {
namespaceId: '',
setForRemoval: false,
setForMove: false,
hasAnimation: false,
removedBeforeQueried: false
};
const NULL_REMOVED_QUERIED_STATE = {
namespaceId: '',
setForMove: false,
setForRemoval: false,
hasAnimation: false,
removedBeforeQueried: true
};
const REMOVAL_FLAG = '__ng_removed';
class StateValue {
constructor(input, namespaceId = '') {
this.namespaceId = namespaceId;
const isObj = input && input.hasOwnProperty('value');
const value = isObj ? input['value'] : input;
this.value = normalizeTriggerValue(value);
if (isObj) {
const options = copyObj(input);
delete options['value'];
this.options = options;
}
else {
this.options = {};
}
if (!this.options.params) {
this.options.params = {};
}
}
get params() {
return this.options.params;
}
absorbOptions(options) {
const newParams = options.params;
if (newParams) {
const oldParams = this.options.params;
Object.keys(newParams).forEach(prop => {
if (oldParams[prop] == null) {
oldParams[prop] = newParams[prop];
}
});
}
}
}
const VOID_VALUE = 'void';
const DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);
class AnimationTransitionNamespace {
constructor(id, hostElement, _engine) {
this.id = id;
this.hostElement = hostElement;
this._engine = _engine;
this.players = [];
this._triggers = {};
this._queue = [];
this._elementListeners = new Map();
this._hostClassName = 'ng-tns-' + id;
addClass(hostElement, this._hostClassName);
}
listen(element, name, phase, callback) {
if (!this._triggers.hasOwnProperty(name)) {
throw new Error(`Unable to listen on the animation trigger event "${phase}" because the animation trigger "${name}" doesn\'t exist!`);
}
if (phase == null || phase.length == 0) {
throw new Error(`Unable to listen on the animation trigger "${name}" because the provided event is undefined!`);
}
if (!isTriggerEventValid(phase)) {
throw new Error(`The provided animation trigger event "${phase}" for the animation trigger "${name}" is not supported!`);
}
const listeners = getOrSetAsInMap(this._elementListeners, element, []);
const data = { name, phase, callback };
listeners.push(data);
const triggersWithStates = getOrSetAsInMap(this._engine.statesByElement, element, {});
if (!triggersWithStates.hasOwnProperty(name)) {
addClass(element, NG_TRIGGER_CLASSNAME);
addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);
triggersWithStates[name] = DEFAULT_STATE_VALUE;
}
return () => {
// the event listener is removed AFTER the flush has occurred such
// that leave animations callbacks can fire (otherwise if the node
// is removed in between then the listeners would be deregistered)
this._engine.afterFlush(() => {
const index = listeners.indexOf(data);
if (index >= 0) {
listeners.splice(index, 1);
}
if (!this._triggers[name]) {
delete triggersWithStates[name];
}
});
};
}
register(name, ast) {
if (this._triggers[name]) {
// throw
return false;
}
else {
this._triggers[name] = ast;
return true;
}
}
_getTrigger(name) {
const trigger = this._triggers[name];
if (!trigger) {
throw new Error(`The provided animation trigger "${name}" has not been registered!`);
}
return trigger;
}
trigger(element, triggerName, value, defaultToFallback = true) {
const trigger = this._getTrigger(triggerName);
const player = new TransitionAnimationPlayer(this.id, triggerName, element);
let triggersWithStates = this._engine.statesByElement.get(element);
if (!triggersWithStates) {
addClass(element, NG_TRIGGER_CLASSNAME);
addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);
this._engine.statesByElement.set(element, triggersWithStates = {});
}
let fromState = triggersWithStates[triggerName];
const toState = new StateValue(value, this.id);
const isObj = value && value.hasOwnProperty('value');
if (!isObj && fromState) {
toState.absorbOptions(fromState.options);
}
triggersWithStates[triggerName] = toState;
if (!fromState) {
fromState = DEFAULT_STATE_VALUE;
}
const isRemoval = toState.value === VOID_VALUE;
// normally this isn't reached by here, however, if an object expression
// is passed in then it may be a new object each time. Comparing the value
// is important since that will stay the same despite there being a new object.
// The removal arc here is special cased because the same element is triggered
// twice in the event that it contains animations on the outer/inner portions
// of the host container
if (!isRemoval && fromState.value === toState.value) {
// this means that despite the value not changing, some inner params
// have changed which means that the animation final styles need to be applied
if (!objEquals(fromState.params, toState.params)) {
const errors = [];
const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);
const toStyles = trigger.matchStyles(toState.value, toState.params, errors);
if (errors.length) {
this._engine.reportError(errors);
}
else {
this._engine.afterFlush(() => {
eraseStyles(element, fromStyles);
setStyles(element, toStyles);
});
}
}
return;
}
const playersOnElement = getOrSetAsInMap(this._engine.playersByElement, element, []);
playersOnElement.forEach(player => {
// only remove the player if it is queued on the EXACT same trigger/namespace
// we only also deal with queued players here because if the animation has
// started then we want to keep the player alive until the flush happens
// (which is where the previousPlayers are passed into the new palyer)
if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {
player.destroy();
}
});
let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);
let isFallbackTransition = false;
if (!transition) {
if (!defaultToFallback)
return;
transition = trigger.fallbackTransition;
isFallbackTransition = true;
}
this._engine.totalQueuedPlayers++;
this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });
if (!isFallbackTransition) {
addClass(element, QUEUED_CLASSNAME);
player.onStart(() => {
removeClass(element, QUEUED_CLASSNAME);
});
}
player.onDone(() => {
let index = this.players.indexOf(player);
if (index >= 0) {
this.players.splice(index, 1);
}
const players = this._engine.playersByElement.get(element);
if (players) {
let index = players.indexOf(player);
if (index >= 0) {
players.splice(index, 1);
}
}
});
this.players.push(player);
playersOnElement.push(player);
return player;
}
deregister(name) {
delete this._triggers[name];
this._engine.statesByElement.forEach((stateMap, element) => {
delete stateMap[name];
});
this._elementListeners.forEach((listeners, element) => {
this._elementListeners.set(element, listeners.filter(entry => {
return entry.name != name;
}));
});
}
clearElementCache(element) {
this._engine.statesByElement.delete(element);
this._elementListeners.delete(element);
const elementPlayers = this._engine.playersByElement.get(element);
if (elementPlayers) {
elementPlayers.forEach(player => player.destroy());
this._engine.playersByElement.delete(element);
}
}
_signalRemovalForInnerTriggers(rootElement, context) {
const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);
// emulate a leave animation for all inner nodes within this node.
// If there are no animations found for any of the nodes then clear the cache
// for the element.
elements.forEach(elm => {
// this means that an inner remove() operation has already kicked off
// the animation on this element...
if (elm[REMOVAL_FLAG])
return;
const namespaces = this._engine.fetchNamespacesByElement(elm);
if (namespaces.size) {
namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));
}
else {
this.clearElementCache(elm);
}
});
// If the child elements were removed along with the parent, their animations might not
// have completed. Clear all the elements from the cache so we don't end up with a memory leak.
this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));
}
triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {
const triggerStates = this._engine.statesByElement.get(element);
if (triggerStates) {
const players = [];
Object.keys(triggerStates).forEach(triggerName => {
// this check is here in the event that an element is removed
// twice (both on the host level and the component level)
if (this._triggers[triggerName]) {
const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);
if (player) {
players.push(player);
}
}
});
if (players.length) {
this._engine.markElementAsRemoved(this.id, element, true, context);
if (destroyAfterComplete) {
optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));
}
return true;
}
}
return false;
}
prepareLeaveAnimationListeners(element) {
const listeners = this._elementListeners.get(element);
const elementStates = this._engine.statesByElement.get(element);
// if this statement fails then it means that the element was picked up
// by an earlier flush (or there are no listeners at all to track the leave).
if (listeners && elementStates) {
const visitedTriggers = new Set();
listeners.forEach(listener => {
const triggerName = listener.name;
if (visitedTriggers.has(triggerName))
return;
visitedTriggers.add(triggerName);
const trigger = this._triggers[triggerName];
const transition = trigger.fallbackTransition;
const fromState = elementStates[triggerName] || DEFAULT_STATE_VALUE;
const toState = new StateValue(VOID_VALUE);
const player = new TransitionAnimationPlayer(this.id, triggerName, element);
this._engine.totalQueuedPlayers++;
this._queue.push({
element,
triggerName,
transition,
fromState,
toState,
player,
isFallbackTransition: true
});
});
}
}
removeNode(element, context) {
const engine = this._engine;
if (element.childElementCount) {
this._signalRemovalForInnerTriggers(element, context);
}
// this means that a * => VOID animation was detected and kicked off
if (this.triggerLeaveAnimation(element, context, true))
return;
// find the player that is animating and make sure that the
// removal is delayed until that player has completed
let containsPotentialParentTransition = false;
if (engine.totalAnimations) {
const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];
// when this `if statement` does not continue forward it means that
// a previous animation query has selected the current element and
// is animating it. In this situation want to continue forwards and
// allow the element to be queued up for animation later.
if (currentPlayers && currentPlayers.length) {
containsPotentialParentTransition = true;
}
else {
let parent = element;
while (parent = parent.parentNode) {
const triggers = engine.statesByElement.get(parent);
if (triggers) {
containsPotentialParentTransition = true;
break;
}
}
}
}
// at this stage we know that the element will either get removed
// during flush or will be picked up by a parent query. Either way
// we need to fire the listeners for this element when it DOES get
// removed (once the query parent animation is done or after flush)
this.prepareLeaveAnimationListeners(element);
// whether or not a parent has an animation we need to delay the deferral of the leave
// operation until we have more information (which we do after flush() has been called)
if (containsPotentialParentTransition) {
engine.markElementAsRemoved(this.id, element, false, context);
}
else {
const removalFlag = element[REMOVAL_FLAG];
if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {
// we do this after the flush has occurred such
// that the callbacks can be fired
engine.afterFlush(() => this.clearElementCache(element));
engine.destroyInnerAnimations(element);
engine._onRemovalComplete(element, context);
}
}
}
insertNode(element, parent) {
addClass(element, this._hostClassName);
}
drainQueuedTransitions(microtaskId) {
const instructions = [];
this._queue.forEach(entry => {
const player = entry.player;
if (player.destroyed)
return;
const element = entry.element;
const listeners = this._elementListeners.get(element);
if (listeners) {
listeners.forEach((listener) => {
if (listener.name == entry.triggerName) {
const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);
baseEvent['_data'] = microtaskId;
listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);
}
});
}
if (player.markedForDestroy) {
this._engine.afterFlush(() => {
// now we can destroy the element properly since the event listeners have
// been bound to the player
player.destroy();
});
}
else {
instructions.push(entry);
}
});
this._queue = [];
return instructions.sort((a, b) => {
// if depCount == 0 them move to front
// otherwise if a contains b then move back
const d0 = a.transition.ast.depCount;
const d1 = b.transition.ast.depCount;
if (d0 == 0 || d1 == 0) {
return d0 - d1;
}
return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;
});
}
destroy(context) {
this.players.forEach(p => p.destroy());
this._signalRemovalForInnerTriggers(this.hostElement, context);
}
elementContainsData(element) {
let containsData = false;
if (this._elementListeners.has(element))
containsData = true;
containsData =
(this._queue.find(entry => entry.element === element) ? true : false) || containsData;
return containsData;
}
}
class TransitionAnimationEngine {
constructor(bodyNode, driver, _normalizer) {
this.bodyNode = bodyNode;
this.driver = driver;
this._normalizer = _normalizer;
this.players = [];
this.newHostElements = new Map();
this.playersByElement = new Map();
this.playersByQueriedElement = new Map();
this.statesByElement = new Map();
this.disabledNodes = new Set();
this.totalAnimations = 0;
this.totalQueuedPlayers = 0;
this._namespaceLookup = {};
this._namespaceList = [];
this._flushFns = [];
this._whenQuietFns = [];
this.namespacesByHostElement = new Map();
this.collectedEnterElements = [];
this.collectedLeaveElements = [];
// this method is designed to be overridden by the code that uses this engine
this.onRemovalComplete = (element, context) => { };
}
/** @internal */
_onRemovalComplete(element, context) {
this.onRemovalComplete(element, context);
}
get queuedPlayers() {
const players = [];
this._namespaceList.forEach(ns => {
ns.players.forEach(player => {
if (player.queued) {
players.push(player);
}
});
});
return players;
}
createNamespace(namespaceId, hostElement) {
const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);
if (this.bodyNode && this.driver.containsElement(this.bodyNode, hostElement)) {
this._balanceNamespaceList(ns, hostElement);
}
else {
// defer this later until flush during when the host element has
// been inserted so that we know exactly where to place it in
// the namespace list
this.newHostElements.set(hostElement, ns);
// given that this host element is apart of the animation code, it
// may or may not be inserted by a parent node that is of an
// animation renderer type. If this happens then we can still have
// access to this item when we query for :enter nodes. If the parent
// is a renderer then the set data-structure will normalize the entry
this.collectEnterElement(hostElement);
}
return this._namespaceLookup[namespaceId] = ns;
}
_balanceNamespaceList(ns, hostElement) {
const limit = this._namespaceList.length - 1;
if (limit >= 0) {
let found = false;
for (let i = limit; i >= 0; i--) {
const nextNamespace = this._namespaceList[i];
if (this.driver.containsElement(nextNamespace.hostElement, hostElement)) {
this._namespaceList.splice(i + 1, 0, ns);
found = true;
break;
}
}
if (!found) {
this._namespaceList.splice(0, 0, ns);
}
}
else {
this._namespaceList.push(ns);
}
this.namespacesByHostElement.set(hostElement, ns);
return ns;
}
register(namespaceId, hostElement) {
let ns = this._namespaceLookup[namespaceId];
if (!ns) {
ns = this.createNamespace(namespaceId, hostElement);
}
return ns;
}
registerTrigger(namespaceId, name, trigger) {
let ns = this._namespaceLookup[namespaceId];
if (ns && ns.register(name, trigger)) {
this.totalAnimations++;
}
}
destroy(namespaceId, context) {
if (!namespaceId)
return;
const ns = this._fetchNamespace(namespaceId);
this.afterFlush(() => {
this.namespacesByHostElement.delete(ns.hostElement);
delete this._namespaceLookup[namespaceId];
const index = this._namespaceList.indexOf(ns);
if (index >= 0) {
this._namespaceList.splice(index, 1);
}
});
this.afterFlushAnimationsDone(() => ns.destroy(context));
}
_fetchNamespace(id) {
return this._namespaceLookup[id];
}
fetchNamespacesByElement(element) {
// normally there should only be one namespace per element, however
// if @triggers are placed on both the component element and then
// its host element (within the component code) then there will be
// two namespaces returned. We use a set here to simply the dedupe
// of namespaces incase there are multiple triggers both the elm and host
const namespaces = new Set();
const elementStates = this.statesByElement.get(element);
if (elementStates) {
const keys = Object.keys(elementStates);
for (let i = 0; i < keys.length; i++) {
const nsId = elementStates[keys[i]].namespaceId;
if (nsId) {
const ns = this._fetchNamespace(nsId);
if (ns) {
namespaces.add(ns);
}
}
}
}
return namespaces;
}
trigger(namespaceId, element, name, value) {
if (isElementNode(element)) {
const ns = this._fetchNamespace(namespaceId);
if (ns) {
ns.trigger(element, name, value);
return true;
}
}
return false;
}
insertNode(namespaceId, element, parent, insertBefore) {
if (!isElementNode(element))
return;
// special case for when an element is removed and reinserted (move operation)
// when this occurs we do not want to use the element for deletion later
const details = element[REMOVAL_FLAG];
if (details && details.setForRemoval) {
details.setForRemoval = false;
details.setForMove = true;
const index = this.collectedLeaveElements.indexOf(element);
if (index >= 0) {
this.collectedLeaveElements.splice(index, 1);
}
}
// in the event that the namespaceId is blank then the caller
// code does not contain any animation code in it, but it is
// just being called so that the node is marked as being inserted
if (namespaceId) {
const ns = this._fetchNamespace(namespaceId);
// This if-statement is a workaround for router issue #21947.
// The router sometimes hits a race condition where while a route
// is being instantiated a new navigation arrives, triggering leave
// animation of DOM that has not been fully initialized, until this
// is resolved, we need to handle the scenario when DOM is not in a
// consistent state during the animation.
if (ns) {
ns.insertNode(element, parent);
}
}
// only *directives and host elements are inserted before
if (insertBefore) {
this.collectEnterElement(element);
}
}
collectEnterElement(element) {
this.collectedEnterElements.push(element);
}
markElementAsDisabled(element, value) {
if (value) {
if (!this.disabledNodes.has(element)) {
this.disabledNodes.add(element);
addClass(element, DISABLED_CLASSNAME);
}
}
else if (this.disabledNodes.has(element)) {
this.disabledNodes.delete(element);
removeClass(element, DISABLED_CLASSNAME);
}
}
removeNode(namespaceId, element, isHostElement, context) {
if (isElementNode(element)) {
const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;
if (ns) {
ns.removeNode(element, context);
}
else {
this.markElementAsRemoved(namespaceId, element, false, context);
}
if (isHostElement) {
const hostNS = this.namespacesByHostElement.get(element);
if (hostNS && hostNS.id !== namespaceId) {
hostNS.removeNode(element, context);
}
}
}
else {
this._onRemovalComplete(element, context);
}
}
markElementAsRemoved(namespaceId, element, hasAnimation, context) {
this.collectedLeaveElements.push(element);
element[REMOVAL_FLAG] =
{ namespaceId, setForRemoval: context, hasAnimation, removedBeforeQueried: false };
}
listen(namespaceId, element, name, phase, callback) {
if (isElementNode(element)) {
return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);
}
return () => { };
}
_buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {
return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);
}
destroyInnerAnimations(containerElement) {
let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);
elements.forEach(element => this.destroyActiveAnimationsForElement(element));
if (this.playersByQueriedElement.size == 0)
return;
elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);
elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));
}
destroyActiveAnimationsForElement(element) {
const players = this.playersByElement.get(element);
if (players) {
players.forEach(player => {
// special case for when an element is set for destruction, but hasn't started.
// in this situation we want to delay the destruction until the flush occurs
// so that any event listeners attached to the player are triggered.
if (player.queued) {
player.markedForDestroy = true;
}
else {
player.destroy();
}
});
}
}
finishActiveQueriedAnimationOnElement(element) {
const players = this.playersByQueriedElement.get(element);
if (players) {
players.forEach(player => player.finish());
}
}
whenRenderingDone() {
return new Promise(resolve => {
if (this.players.length) {
return optimizeGroupPlayer(this.players).onDone(() => resolve());
}
else {
resolve();
}
});
}
processLeaveNode(element) {
const details = element[REMOVAL_FLAG];
if (details && details.setForRemoval) {
// this will prevent it from removing it twice
element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;
if (details.namespaceId) {
this.destroyInnerAnimations(element);
const ns = this._fetchNamespace(details.namespaceId);
if (ns) {
ns.clearElementCache(element);
}
}
this._onRemovalComplete(element, details.setForRemoval);
}
if (this.driver.matchesElement(element, DISABLED_SELECTOR)) {
this.markElementAsDisabled(element, false);
}
this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {
this.markElementAsDisabled(node, false);
});
}
flush(microtaskId = -1) {
let players = [];
if (this.newHostElements.size) {
this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));
this.newHostElements.clear();
}
if (this.totalAnimations && this.collectedEnterElements.length) {
for (let i = 0; i < this.collectedEnterElements.length; i++) {
const elm = this.collectedEnterElements[i];
addClass(elm, STAR_CLASSNAME);
}
}
if (this._namespaceList.length &&
(this.totalQueuedPlayers || this.collectedLeaveElements.length)) {
const cleanupFns = [];
try {
players = this._flushAnimations(cleanupFns, microtaskId);
}
finally {
for (let i = 0; i < cleanupFns.length; i++) {
cleanupFns[i]();
}
}
}
else {
for (let i = 0; i < this.collectedLeaveElements.length; i++) {
const element = this.collectedLeaveElements[i];
this.processLeaveNode(element);
}
}
this.totalQueuedPlayers = 0;
this.collectedEnterElements.length = 0;
this.collectedLeaveElements.length = 0;
this._flushFns.forEach(fn => fn());
this._flushFns = [];
if (this._whenQuietFns.length) {
// we move these over to a variable so that
// if any new callbacks are registered in another
// flush they do not populate the existing set
const quietFns = this._whenQuietFns;
this._whenQuietFns = [];
if (players.length) {
optimizeGroupPlayer(players).onDone(() => {
quietFns.forEach(fn => fn());
});
}
else {
quietFns.forEach(fn => fn());
}
}
}
reportError(errors) {
throw new Error(`Unable to process animations due to the following failed trigger transitions\n ${errors.join('\n')}`);
}
_flushAnimations(cleanupFns, microtaskId) {
const subTimelines = new ElementInstructionMap();
const skippedPlayers = [];
const skippedPlayersMap = new Map();
const queuedInstructions = [];
const queriedElements = new Map();
const allPreStyleElements = new Map();
const allPostStyleElements = new Map();
const disabledElementsSet = new Set();
this.disabledNodes.forEach(node => {
disabledElementsSet.add(node);
const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);
for (let i = 0; i < nodesThatAreDisabled.length; i++) {
disabledElementsSet.add(nodesThatAreDisabled[i]);
}
});
const bodyNode = this.bodyNode;
const allTriggerElements = Array.from(this.statesByElement.keys());
const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);
// this must occur before the instructions are built below such that
// the :enter queries match the elements (since the timeline queries
// are fired during instruction building).
const enterNodeMapIds = new Map();
let i = 0;
enterNodeMap.forEach((nodes, root) => {
const className = ENTER_CLASSNAME + i++;
enterNodeMapIds.set(root, className);
nodes.forEach(node => addClass(node, className));
});
const allLeaveNodes = [];
const mergedLeaveNodes = new Set();
const leaveNodesWithoutAnimations = new Set();
for (let i = 0; i < this.collectedLeaveElements.length; i++) {
const element = this.collectedLeaveElements[i];
const details = element[REMOVAL_FLAG];
if (details && details.setForRemoval) {
allLeaveNodes.push(element);
mergedLeaveNodes.add(element);
if (details.hasAnimation) {
this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));
}
else {
leaveNodesWithoutAnimations.add(element);
}
}
}
const leaveNodeMapIds = new Map();
const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));
leaveNodeMap.forEach((nodes, root) => {
const className = LEAVE_CLASSNAME + i++;
leaveNodeMapIds.set(root, className);
nodes.forEach(node => addClass(node, className));
});
cleanupFns.push(() => {
enterNodeMap.forEach((nodes, root) => {
const className = enterNodeMapIds.get(root);
nodes.forEach(node => removeClass(node, className));
});
leaveNodeMap.forEach((nodes, root) => {
const className = leaveNodeMapIds.get(root);
nodes.forEach(node => removeClass(node, className));
});
allLeaveNodes.forEach(element => {
this.processLeaveNode(element);
});
});
const allPlayers = [];
const erroneousTransitions = [];
for (let i = this._namespaceList.length - 1; i >= 0; i--) {
const ns = this._namespaceList[i];
ns.drainQueuedTransitions(microtaskId).forEach(entry => {
const player = entry.player;
const element = entry.element;
allPlayers.push(player);
if (this.collectedEnterElements.length) {
const details = element[REMOVAL_FLAG];
// move animations are currently not supported...
if (details && details.setForMove) {
player.destroy();
return;
}
}
const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);
const leaveClassName = leaveNodeMapIds.get(element);
const enterClassName = enterNodeMapIds.get(element);
const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);
if (instruction.errors && instruction.errors.length) {
erroneousTransitions.push(instruction);
return;
}
// even though the element may not be apart of the DOM, it may
// still be added at a later point (due to the mechanics of content
// projection and/or dynamic component insertion) therefore it's
// important we still style the element.
if (nodeIsOrphaned) {
player.onStart(() => eraseStyles(element, instruction.fromStyles));
player.onDestroy(() => setStyles(element, instruction.toStyles));
skippedPlayers.push(player);
return;
}
// if a unmatched transition is queued to go then it SHOULD NOT render
// an animation and cancel the previously running animations.
if (entry.isFallbackTransition) {
player.onStart(() => eraseStyles(element, instruction.fromStyles));
player.onDestroy(() => setStyles(element, instruction.toStyles));
skippedPlayers.push(player);
return;
}
// this means that if a parent animation uses this animation as a sub trigger
// then it will instruct the timeline builder to not add a player delay, but
// instead stretch the first keyframe gap up until the animation starts. The
// reason this is important is to prevent extra initialization styles from being
// required by the user in the animation.
instruction.timelines.forEach(tl => tl.stretchStartingKeyframe = true);
subTimelines.append(element, instruction.timelines);
const tuple = { instruction, player, element };
queuedInstructions.push(tuple);
instruction.queriedElements.forEach(element => getOrSetAsInMap(queriedElements, element, []).push(player));
instruction.preStyleProps.forEach((stringMap, element) => {
const props = Object.keys(stringMap);
if (props.length) {
let setVal = allPreStyleElements.get(element);
if (!setVal) {
allPreStyleElements.set(element, setVal = new Set());
}
props.forEach(prop => setVal.add(prop));
}
});
instruction.postStyleProps.forEach((stringMap, element) => {
const props = Object.keys(stringMap);
let setVal = allPostStyleElements.get(element);
if (!setVal) {
allPostStyleElements.set(element, setVal = new Set());
}
props.forEach(prop => setVal.add(prop));
});
});
}
if (erroneousTransitions.length) {
const errors = [];
erroneousTransitions.forEach(instruction => {
errors.push(`@${instruction.triggerName} has failed due to:\n`);
instruction.errors.forEach(error => errors.push(`- ${error}\n`));
});
allPlayers.forEach(player => player.destroy());
this.reportError(errors);
}
const allPreviousPlayersMap = new Map();
// this map works to tell which element in the DOM tree is contained by
// which animation. Further down below this map will get populated once
// the players are built and in doing so it can efficiently figure out
// if a sub player is skipped due to a parent player having priority.
const animationElementMap = new Map();
queuedInstructions.forEach(entry => {
const element = entry.element;
if (subTimelines.has(element)) {
animationElementMap.set(element, element);
this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);
}
});
skippedPlayers.forEach(player => {
const element = player.element;
const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);
previousPlayers.forEach(prevPlayer => {
getOrSetAsInMap(allPreviousPlayersMap, element, []).push(prevPlayer);
prevPlayer.destroy();
});
});
// this is a special case for nodes that will be removed (either by)
// having their own leave animations or by being queried in a container
// that will be removed once a parent animation is complete. The idea
// here is that * styles must be identical to ! styles because of
// backwards compatibility (* is also filled in by default in many places).
// Otherwise * styles will return an empty value or auto since the element
// that is being getComputedStyle'd will not be visible (since * = destination)
const replaceNodes = allLeaveNodes.filter(node => {
return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);
});
// POST STAGE: fill the * styles
const postStylesMap = new Map();
const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, _angular_animations__WEBPACK_IMPORTED_MODULE_0__.AUTO_STYLE);
allLeaveQueriedNodes.forEach(node => {
if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {
replaceNodes.push(node);
}
});
// PRE STAGE: fill the ! styles
const preStylesMap = new Map();
enterNodeMap.forEach((nodes, root) => {
cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]);
});
replaceNodes.forEach(node => {
const post = postStylesMap.get(node);
const pre = preStylesMap.get(node);
postStylesMap.set(node, Object.assign(Object.assign({}, post), pre));
});
const rootPlayers = [];
const subPlayers = [];
const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};
queuedInstructions.forEach(entry => {
const { element, player, instruction } = entry;
// this means that it was never consumed by a parent animation which
// means that it is independent and therefore should be set for animation
if (subTimelines.has(element)) {
if (disabledElementsSet.has(element)) {
player.onDestroy(() => setStyles(element, instruction.toStyles));
player.disabled = true;
player.overrideTotalTime(instruction.totalTime);
skippedPlayers.push(player);
return;
}
// this will flow up the DOM and query the map to figure out
// if a parent animation has priority over it. In the situation
// that a parent is detected then it will cancel the loop. If
// nothing is detected, or it takes a few hops to find a parent,
// then it will fill in the missing nodes and signal them as having
// a detected parent (or a NO_PARENT value via a special constant).
let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;
if (animationElementMap.size > 1) {
let elm = element;
const parentsToAdd = [];
while (elm = elm.parentNode) {
const detectedParent = animationElementMap.get(elm);
if (detectedParent) {
parentWithAnimation = detectedParent;
break;
}
parentsToAdd.push(elm);
}
parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));
}
const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);
player.setRealPlayer(innerPlayer);
if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {
rootPlayers.push(player);
}
else {
const parentPlayers = this.playersByElement.get(parentWithAnimation);
if (parentPlayers && parentPlayers.length) {
player.parentPlayer = optimizeGroupPlayer(parentPlayers);
}
skippedPlayers.push(player);
}
}
else {
eraseStyles(element, instruction.fromStyles);
player.onDestroy(() => setStyles(element, instruction.toStyles));
// there still might be a ancestor player animating this
// element therefore we will still add it as a sub player
// even if its animation may be disabled
subPlayers.push(player);
if (disabledElementsSet.has(element)) {
skippedPlayers.push(player);
}
}
});
// find all of the sub players' corresponding inner animation player
subPlayers.forEach(player => {
// even if any players are not found for a sub animation then it
// will still complete itself after the next tick since it's Noop
const playersForElement = skippedPlayersMap.get(player.element);
if (playersForElement && playersForElement.length) {
const innerPlayer = optimizeGroupPlayer(playersForElement);
player.setRealPlayer(innerPlayer);
}
});
// the reason why we don't actually play the animation is
// because all that a skipped player is designed to do is to
// fire the start/done transition callback events
skippedPlayers.forEach(player => {
if (player.parentPlayer) {
player.syncPlayerEvents(player.parentPlayer);
}
else {
player.destroy();
}
});
// run through all of the queued removals and see if they
// were picked up by a query. If not then perform the removal
// operation right away unless a parent animation is ongoing.
for (let i = 0; i < allLeaveNodes.length; i++) {
const element = allLeaveNodes[i];
const details = element[REMOVAL_FLAG];
removeClass(element, LEAVE_CLASSNAME);
// this means the element has a removal animation that is being
// taken care of and therefore the inner elements will hang around
// until that animation is over (or the parent queried animation)
if (details && details.hasAnimation)
continue;
let players = [];
// if this element is queried or if it contains queried children
// then we want for the element not to be removed from the page
// until the queried animations have finished
if (queriedElements.size) {
let queriedPlayerResults = queriedElements.get(element);
if (queriedPlayerResults && queriedPlayerResults.length) {
players.push(...queriedPlayerResults);
}
let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);
for (let j = 0; j < queriedInnerElements.length; j++) {
let queriedPlayers = queriedElements.get(queriedInnerElements[j]);
if (queriedPlayers && queriedPlayers.length) {
players.push(...queriedPlayers);
}
}
}
const activePlayers = players.filter(p => !p.destroyed);
if (activePlayers.length) {
removeNodesAfterAnimationDone(this, element, activePlayers);
}
else {
this.processLeaveNode(element);
}
}
// this is required so the cleanup method doesn't remove them
allLeaveNodes.length = 0;
rootPlayers.forEach(player => {
this.players.push(player);
player.onDone(() => {
player.destroy();
const index = this.players.indexOf(player);
this.players.splice(index, 1);
});
player.play();
});
return rootPlayers;
}
elementContainsData(namespaceId, element) {
let containsData = false;
const details = element[REMOVAL_FLAG];
if (details && details.setForRemoval)
containsData = true;
if (this.playersByElement.has(element))
containsData = true;
if (this.playersByQueriedElement.has(element))
containsData = true;
if (this.statesByElement.has(element))
containsData = true;
return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;
}
afterFlush(callback) {
this._flushFns.push(callback);
}
afterFlushAnimationsDone(callback) {
this._whenQuietFns.push(callback);
}
_getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {
let players = [];
if (isQueriedElement) {
const queriedElementPlayers = this.playersByQueriedElement.get(element);
if (queriedElementPlayers) {
players = queriedElementPlayers;
}
}
else {
const elementPlayers = this.playersByElement.get(element);
if (elementPlayers) {
const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;
elementPlayers.forEach(player => {
if (player.queued)
return;
if (!isRemovalAnimation && player.triggerName != triggerName)
return;
players.push(player);
});
}
}
if (namespaceId || triggerName) {
players = players.filter(player => {
if (namespaceId && namespaceId != player.namespaceId)
return false;
if (triggerName && triggerName != player.triggerName)
return false;
return true;
});
}
return players;
}
_beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {
const triggerName = instruction.triggerName;
const rootElement = instruction.element;
// when a removal animation occurs, ALL previous players are collected
// and destroyed (even if they are outside of the current namespace)
const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;
const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;
for (const timelineInstruction of instruction.timelines) {
const element = timelineInstruction.element;
const isQueriedElement = element !== rootElement;
const players = getOrSetAsInMap(allPreviousPlayersMap, element, []);
const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);
previousPlayers.forEach(player => {
const realPlayer = player.getRealPlayer();
if (realPlayer.beforeDestroy) {
realPlayer.beforeDestroy();
}
player.destroy();
players.push(player);
});
}
// this needs to be done so that the PRE/POST styles can be
// computed properly without interfering with the previous animation
eraseStyles(rootElement, instruction.fromStyles);
}
_buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {
const triggerName = instruction.triggerName;
const rootElement = instruction.element;
// we first run this so that the previous animation player
// data can be passed into the successive animation players
const allQueriedPlayers = [];
const allConsumedElements = new Set();
const allSubElements = new Set();
const allNewPlayers = instruction.timelines.map(timelineInstruction => {
const element = timelineInstruction.element;
allConsumedElements.add(element);
// FIXME (matsko): make sure to-be-removed animations are removed properly
const details = element[REMOVAL_FLAG];
if (details && details.removedBeforeQueried)
return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);
const isQueriedElement = element !== rootElement;
const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)
.map(p => p.getRealPlayer()))
.filter(p => {
// the `element` is not apart of the AnimationPlayer definition, but
// Mock/WebAnimations
// use the element within their implementation. This will be added in Angular5 to
// AnimationPlayer
const pp = p;
return pp.element ? pp.element === element : false;
});
const preStyles = preStylesMap.get(element);
const postStyles = postStylesMap.get(element);
const keyframes = normalizeKeyframes(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);
const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);
// this means that this particular player belongs to a sub trigger. It is
// important that we match this player up with the corresponding (@trigger.listener)
if (timelineInstruction.subTimeline && skippedPlayersMap) {
allSubElements.add(element);
}
if (isQueriedElement) {
const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);
wrappedPlayer.setRealPlayer(player);
allQueriedPlayers.push(wrappedPlayer);
}
return player;
});
allQueriedPlayers.forEach(player => {
getOrSetAsInMap(this.playersByQueriedElement, player.element, []).push(player);
player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));
});
allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));
const player = optimizeGroupPlayer(allNewPlayers);
player.onDestroy(() => {
allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));
setStyles(rootElement, instruction.toStyles);
});
// this basically makes all of the callbacks for sub element animations
// be dependent on the upper players for when they finish
allSubElements.forEach(element => {
getOrSetAsInMap(skippedPlayersMap, element, []).push(player);
});
return player;
}
_buildPlayer(instruction, keyframes, previousPlayers) {
if (keyframes.length > 0) {
return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);
}
// special case for when an empty transition|definition is provided
// ... there is no point in rendering an empty animation
return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer(instruction.duration, instruction.delay);
}
}
class TransitionAnimationPlayer {
constructor(namespaceId, triggerName, element) {
this.namespaceId = namespaceId;
this.triggerName = triggerName;
this.element = element;
this._player = new _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer();
this._containsRealPlayer = false;
this._queuedCallbacks = {};
this.destroyed = false;
this.markedForDestroy = false;
this.disabled = false;
this.queued = true;
this.totalTime = 0;
}
setRealPlayer(player) {
if (this._containsRealPlayer)
return;
this._player = player;
Object.keys(this._queuedCallbacks).forEach(phase => {
this._queuedCallbacks[phase].forEach(callback => listenOnPlayer(player, phase, undefined, callback));
});
this._queuedCallbacks = {};
this._containsRealPlayer = true;
this.overrideTotalTime(player.totalTime);
this.queued = false;
}
getRealPlayer() {
return this._player;
}
overrideTotalTime(totalTime) {
this.totalTime = totalTime;
}
syncPlayerEvents(player) {
const p = this._player;
if (p.triggerCallback) {
player.onStart(() => p.triggerCallback('start'));
}
player.onDone(() => this.finish());
player.onDestroy(() => this.destroy());
}
_queueEvent(name, callback) {
getOrSetAsInMap(this._queuedCallbacks, name, []).push(callback);
}
onDone(fn) {
if (this.queued) {
this._queueEvent('done', fn);
}
this._player.onDone(fn);
}
onStart(fn) {
if (this.queued) {
this._queueEvent('start', fn);
}
this._player.onStart(fn);
}
onDestroy(fn) {
if (this.queued) {
this._queueEvent('destroy', fn);
}
this._player.onDestroy(fn);
}
init() {
this._player.init();
}
hasStarted() {
return this.queued ? false : this._player.hasStarted();
}
play() {
!this.queued && this._player.play();
}
pause() {
!this.queued && this._player.pause();
}
restart() {
!this.queued && this._player.restart();
}
finish() {
this._player.finish();
}
destroy() {
this.destroyed = true;
this._player.destroy();
}
reset() {
!this.queued && this._player.reset();
}
setPosition(p) {
if (!this.queued) {
this._player.setPosition(p);
}
}
getPosition() {
return this.queued ? 0 : this._player.getPosition();
}
/** @internal */
triggerCallback(phaseName) {
const p = this._player;
if (p.triggerCallback) {
p.triggerCallback(phaseName);
}
}
}
function deleteOrUnsetInMap(map, key, value) {
let currentValues;
if (map instanceof Map) {
currentValues = map.get(key);
if (currentValues) {
if (currentValues.length) {
const index = currentValues.indexOf(value);
currentValues.splice(index, 1);
}
if (currentValues.length == 0) {
map.delete(key);
}
}
}
else {
currentValues = map[key];
if (currentValues) {
if (currentValues.length) {
const index = currentValues.indexOf(value);
currentValues.splice(index, 1);
}
if (currentValues.length == 0) {
delete map[key];
}
}
}
return currentValues;
}
function normalizeTriggerValue(value) {
// we use `!= null` here because it's the most simple
// way to test against a "falsy" value without mixing
// in empty strings or a zero value. DO NOT OPTIMIZE.
return value != null ? value : null;
}
function isElementNode(node) {
return node && node['nodeType'] === 1;
}
function isTriggerEventValid(eventName) {
return eventName == 'start' || eventName == 'done';
}
function cloakElement(element, value) {
const oldValue = element.style.display;
element.style.display = value != null ? value : 'none';
return oldValue;
}
function cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {
const cloakVals = [];
elements.forEach(element => cloakVals.push(cloakElement(element)));
const failedElements = [];
elementPropsMap.forEach((props, element) => {
const styles = {};
props.forEach(prop => {
const value = styles[prop] = driver.computeStyle(element, prop, defaultStyle);
// there is no easy way to detect this because a sub element could be removed
// by a parent animation element being detached.
if (!value || value.length == 0) {
element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;
failedElements.push(element);
}
});
valuesMap.set(element, styles);
});
// we use a index variable here since Set.forEach(a, i) does not return
// an index value for the closure (but instead just the value)
let i = 0;
elements.forEach(element => cloakElement(element, cloakVals[i++]));
return failedElements;
}
/*
Since the Angular renderer code will return a collection of inserted
nodes in all areas of a DOM tree, it's up to this algorithm to figure
out which nodes are roots for each animation @trigger.
By placing each inserted node into a Set and traversing upwards, it
is possible to find the @trigger elements and well any direct *star
insertion nodes, if a @trigger root is found then the enter element
is placed into the Map[@trigger] spot.
*/
function buildRootMap(roots, nodes) {
const rootMap = new Map();
roots.forEach(root => rootMap.set(root, []));
if (nodes.length == 0)
return rootMap;
const NULL_NODE = 1;
const nodeSet = new Set(nodes);
const localRootMap = new Map();
function getRoot(node) {
if (!node)
return NULL_NODE;
let root = localRootMap.get(node);
if (root)
return root;
const parent = node.parentNode;
if (rootMap.has(parent)) { // ngIf inside @trigger
root = parent;
}
else if (nodeSet.has(parent)) { // ngIf inside ngIf
root = NULL_NODE;
}
else { // recurse upwards
root = getRoot(parent);
}
localRootMap.set(node, root);
return root;
}
nodes.forEach(node => {
const root = getRoot(node);
if (root !== NULL_NODE) {
rootMap.get(root).push(node);
}
});
return rootMap;
}
const CLASSES_CACHE_KEY = '$$classes';
function containsClass(element, className) {
if (element.classList) {
return element.classList.contains(className);
}
else {
const classes = element[CLASSES_CACHE_KEY];
return classes && classes[className];
}
}
function addClass(element, className) {
if (element.classList) {
element.classList.add(className);
}
else {
let classes = element[CLASSES_CACHE_KEY];
if (!classes) {
classes = element[CLASSES_CACHE_KEY] = {};
}
classes[className] = true;
}
}
function removeClass(element, className) {
if (element.classList) {
element.classList.remove(className);
}
else {
let classes = element[CLASSES_CACHE_KEY];
if (classes) {
delete classes[className];
}
}
}
function removeNodesAfterAnimationDone(engine, element, players) {
optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));
}
function flattenGroupPlayers(players) {
const finalPlayers = [];
_flattenGroupPlayersRecur(players, finalPlayers);
return finalPlayers;
}
function _flattenGroupPlayersRecur(players, finalPlayers) {
for (let i = 0; i < players.length; i++) {
const player = players[i];
if (player instanceof _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵAnimationGroupPlayer"]) {
_flattenGroupPlayersRecur(player.players, finalPlayers);
}
else {
finalPlayers.push(player);
}
}
}
function objEquals(a, b) {
const k1 = Object.keys(a);
const k2 = Object.keys(b);
if (k1.length != k2.length)
return false;
for (let i = 0; i < k1.length; i++) {
const prop = k1[i];
if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])
return false;
}
return true;
}
function replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {
const postEntry = allPostStyleElements.get(element);
if (!postEntry)
return false;
let preEntry = allPreStyleElements.get(element);
if (preEntry) {
postEntry.forEach(data => preEntry.add(data));
}
else {
allPreStyleElements.set(element, postEntry);
}
allPostStyleElements.delete(element);
return true;
}
class AnimationEngine {
constructor(bodyNode, _driver, normalizer) {
this.bodyNode = bodyNode;
this._driver = _driver;
this._triggerCache = {};
// this method is designed to be overridden by the code that uses this engine
this.onRemovalComplete = (element, context) => { };
this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, normalizer);
this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, normalizer);
this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);
}
registerTrigger(componentId, namespaceId, hostElement, name, metadata) {
const cacheKey = componentId + '-' + name;
let trigger = this._triggerCache[cacheKey];
if (!trigger) {
const errors = [];
const ast = buildAnimationAst(this._driver, metadata, errors);
if (errors.length) {
throw new Error(`The animation trigger "${name}" has failed to build due to the following errors:\n - ${errors.join('\n - ')}`);
}
trigger = buildTrigger(name, ast);
this._triggerCache[cacheKey] = trigger;
}
this._transitionEngine.registerTrigger(namespaceId, name, trigger);
}
register(namespaceId, hostElement) {
this._transitionEngine.register(namespaceId, hostElement);
}
destroy(namespaceId, context) {
this._transitionEngine.destroy(namespaceId, context);
}
onInsert(namespaceId, element, parent, insertBefore) {
this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);
}
onRemove(namespaceId, element, context, isHostElement) {
this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);
}
disableAnimations(element, disable) {
this._transitionEngine.markElementAsDisabled(element, disable);
}
process(namespaceId, element, property, value) {
if (property.charAt(0) == '@') {
const [id, action] = parseTimelineCommand(property);
const args = value;
this._timelineEngine.command(id, element, action, args);
}
else {
this._transitionEngine.trigger(namespaceId, element, property, value);
}
}
listen(namespaceId, element, eventName, eventPhase, callback) {
// @@listen
if (eventName.charAt(0) == '@') {
const [id, action] = parseTimelineCommand(eventName);
return this._timelineEngine.listen(id, element, action, callback);
}
return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);
}
flush(microtaskId = -1) {
this._transitionEngine.flush(microtaskId);
}
get players() {
return this._transitionEngine.players
.concat(this._timelineEngine.players);
}
whenRenderingDone() {
return this._transitionEngine.whenRenderingDone();
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are
* detected.
*
* In CSS there exist properties that cannot be animated within a keyframe animation
* (whether it be via CSS keyframes or web-animations) and the animation implementation
* will ignore them. This function is designed to detect those special cased styles and
* return a container that will be executed at the start and end of the animation.
*
* @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`
*/
function packageNonAnimatableStyles(element, styles) {
let startStyles = null;
let endStyles = null;
if (Array.isArray(styles) && styles.length) {
startStyles = filterNonAnimatableStyles(styles[0]);
if (styles.length > 1) {
endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);
}
}
else if (styles) {
startStyles = filterNonAnimatableStyles(styles);
}
return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :
null;
}
/**
* Designed to be executed during a keyframe-based animation to apply any special-cased styles.
*
* When started (when the `start()` method is run) then the provided `startStyles`
* will be applied. When finished (when the `finish()` method is called) the
* `endStyles` will be applied as well any any starting styles. Finally when
* `destroy()` is called then all styles will be removed.
*/
class SpecialCasedStyles {
constructor(_element, _startStyles, _endStyles) {
this._element = _element;
this._startStyles = _startStyles;
this._endStyles = _endStyles;
this._state = 0 /* Pending */;
let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);
if (!initialStyles) {
SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = {});
}
this._initialStyles = initialStyles;
}
start() {
if (this._state < 1 /* Started */) {
if (this._startStyles) {
setStyles(this._element, this._startStyles, this._initialStyles);
}
this._state = 1 /* Started */;
}
}
finish() {
this.start();
if (this._state < 2 /* Finished */) {
setStyles(this._element, this._initialStyles);
if (this._endStyles) {
setStyles(this._element, this._endStyles);
this._endStyles = null;
}
this._state = 1 /* Started */;
}
}
destroy() {
this.finish();
if (this._state < 3 /* Destroyed */) {
SpecialCasedStyles.initialStylesByElement.delete(this._element);
if (this._startStyles) {
eraseStyles(this._element, this._startStyles);
this._endStyles = null;
}
if (this._endStyles) {
eraseStyles(this._element, this._endStyles);
this._endStyles = null;
}
setStyles(this._element, this._initialStyles);
this._state = 3 /* Destroyed */;
}
}
}
SpecialCasedStyles.initialStylesByElement = new WeakMap();
function filterNonAnimatableStyles(styles) {
let result = null;
const props = Object.keys(styles);
for (let i = 0; i < props.length; i++) {
const prop = props[i];
if (isNonAnimatableStyle(prop)) {
result = result || {};
result[prop] = styles[prop];
}
}
return result;
}
function isNonAnimatableStyle(prop) {
return prop === 'display' || prop === 'position';
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ELAPSED_TIME_MAX_DECIMAL_PLACES = 3;
const ANIMATION_PROP = 'animation';
const ANIMATIONEND_EVENT = 'animationend';
const ONE_SECOND$1 = 1000;
class ElementAnimationStyleHandler {
constructor(_element, _name, _duration, _delay, _easing, _fillMode, _onDoneFn) {
this._element = _element;
this._name = _name;
this._duration = _duration;
this._delay = _delay;
this._easing = _easing;
this._fillMode = _fillMode;
this._onDoneFn = _onDoneFn;
this._finished = false;
this._destroyed = false;
this._startTime = 0;
this._position = 0;
this._eventFn = (e) => this._handleCallback(e);
}
apply() {
applyKeyframeAnimation(this._element, `${this._duration}ms ${this._easing} ${this._delay}ms 1 normal ${this._fillMode} ${this._name}`);
addRemoveAnimationEvent(this._element, this._eventFn, false);
this._startTime = Date.now();
}
pause() {
playPauseAnimation(this._element, this._name, 'paused');
}
resume() {
playPauseAnimation(this._element, this._name, 'running');
}
setPosition(position) {
const index = findIndexForAnimation(this._element, this._name);
this._position = position * this._duration;
setAnimationStyle(this._element, 'Delay', `-${this._position}ms`, index);
}
getPosition() {
return this._position;
}
_handleCallback(event) {
const timestamp = event._ngTestManualTimestamp || Date.now();
const elapsedTime = parseFloat(event.elapsedTime.toFixed(ELAPSED_TIME_MAX_DECIMAL_PLACES)) * ONE_SECOND$1;
if (event.animationName == this._name &&
Math.max(timestamp - this._startTime, 0) >= this._delay && elapsedTime >= this._duration) {
this.finish();
}
}
finish() {
if (this._finished)
return;
this._finished = true;
this._onDoneFn();
addRemoveAnimationEvent(this._element, this._eventFn, true);
}
destroy() {
if (this._destroyed)
return;
this._destroyed = true;
this.finish();
removeKeyframeAnimation(this._element, this._name);
}
}
function playPauseAnimation(element, name, status) {
const index = findIndexForAnimation(element, name);
setAnimationStyle(element, 'PlayState', status, index);
}
function applyKeyframeAnimation(element, value) {
const anim = getAnimationStyle(element, '').trim();
let index = 0;
if (anim.length) {
index = countChars(anim, ',') + 1;
value = `${anim}, ${value}`;
}
setAnimationStyle(element, '', value);
return index;
}
function removeKeyframeAnimation(element, name) {
const anim = getAnimationStyle(element, '');
const tokens = anim.split(',');
const index = findMatchingTokenIndex(tokens, name);
if (index >= 0) {
tokens.splice(index, 1);
const newValue = tokens.join(',');
setAnimationStyle(element, '', newValue);
}
}
function findIndexForAnimation(element, value) {
const anim = getAnimationStyle(element, '');
if (anim.indexOf(',') > 0) {
const tokens = anim.split(',');
return findMatchingTokenIndex(tokens, value);
}
return findMatchingTokenIndex([anim], value);
}
function findMatchingTokenIndex(tokens, searchToken) {
for (let i = 0; i < tokens.length; i++) {
if (tokens[i].indexOf(searchToken) >= 0) {
return i;
}
}
return -1;
}
function addRemoveAnimationEvent(element, fn, doRemove) {
doRemove ? element.removeEventListener(ANIMATIONEND_EVENT, fn) :
element.addEventListener(ANIMATIONEND_EVENT, fn);
}
function setAnimationStyle(element, name, value, index) {
const prop = ANIMATION_PROP + name;
if (index != null) {
const oldValue = element.style[prop];
if (oldValue.length) {
const tokens = oldValue.split(',');
tokens[index] = value;
value = tokens.join(',');
}
}
element.style[prop] = value;
}
function getAnimationStyle(element, name) {
return element.style[ANIMATION_PROP + name] || '';
}
function countChars(value, char) {
let count = 0;
for (let i = 0; i < value.length; i++) {
const c = value.charAt(i);
if (c === char)
count++;
}
return count;
}
const DEFAULT_FILL_MODE = 'forwards';
const DEFAULT_EASING = 'linear';
class CssKeyframesPlayer {
constructor(element, keyframes, animationName, _duration, _delay, easing, _finalStyles, _specialStyles) {
this.element = element;
this.keyframes = keyframes;
this.animationName = animationName;
this._duration = _duration;
this._delay = _delay;
this._finalStyles = _finalStyles;
this._specialStyles = _specialStyles;
this._onDoneFns = [];
this._onStartFns = [];
this._onDestroyFns = [];
this.currentSnapshot = {};
this._state = 0;
this.easing = easing || DEFAULT_EASING;
this.totalTime = _duration + _delay;
this._buildStyler();
}
onStart(fn) {
this._onStartFns.push(fn);
}
onDone(fn) {
this._onDoneFns.push(fn);
}
onDestroy(fn) {
this._onDestroyFns.push(fn);
}
destroy() {
this.init();
if (this._state >= 4 /* DESTROYED */)
return;
this._state = 4 /* DESTROYED */;
this._styler.destroy();
this._flushStartFns();
this._flushDoneFns();
if (this._specialStyles) {
this._specialStyles.destroy();
}
this._onDestroyFns.forEach(fn => fn());
this._onDestroyFns = [];
}
_flushDoneFns() {
this._onDoneFns.forEach(fn => fn());
this._onDoneFns = [];
}
_flushStartFns() {
this._onStartFns.forEach(fn => fn());
this._onStartFns = [];
}
finish() {
this.init();
if (this._state >= 3 /* FINISHED */)
return;
this._state = 3 /* FINISHED */;
this._styler.finish();
this._flushStartFns();
if (this._specialStyles) {
this._specialStyles.finish();
}
this._flushDoneFns();
}
setPosition(value) {
this._styler.setPosition(value);
}
getPosition() {
return this._styler.getPosition();
}
hasStarted() {
return this._state >= 2 /* STARTED */;
}
init() {
if (this._state >= 1 /* INITIALIZED */)
return;
this._state = 1 /* INITIALIZED */;
const elm = this.element;
this._styler.apply();
if (this._delay) {
this._styler.pause();
}
}
play() {
this.init();
if (!this.hasStarted()) {
this._flushStartFns();
this._state = 2 /* STARTED */;
if (this._specialStyles) {
this._specialStyles.start();
}
}
this._styler.resume();
}
pause() {
this.init();
this._styler.pause();
}
restart() {
this.reset();
this.play();
}
reset() {
this._state = 0 /* RESET */;
this._styler.destroy();
this._buildStyler();
this._styler.apply();
}
_buildStyler() {
this._styler = new ElementAnimationStyleHandler(this.element, this.animationName, this._duration, this._delay, this.easing, DEFAULT_FILL_MODE, () => this.finish());
}
/** @internal */
triggerCallback(phaseName) {
const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;
methods.forEach(fn => fn());
methods.length = 0;
}
beforeDestroy() {
this.init();
const styles = {};
if (this.hasStarted()) {
const finished = this._state >= 3 /* FINISHED */;
Object.keys(this._finalStyles).forEach(prop => {
if (prop != 'offset') {
styles[prop] = finished ? this._finalStyles[prop] : computeStyle(this.element, prop);
}
});
}
this.currentSnapshot = styles;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
class DirectStylePlayer extends _angular_animations__WEBPACK_IMPORTED_MODULE_0__.NoopAnimationPlayer {
constructor(element, styles) {
super();
this.element = element;
this._startingStyles = {};
this.__initialized = false;
this._styles = hypenatePropsObject(styles);
}
init() {
if (this.__initialized || !this._startingStyles)
return;
this.__initialized = true;
Object.keys(this._styles).forEach(prop => {
this._startingStyles[prop] = this.element.style[prop];
});
super.init();
}
play() {
if (!this._startingStyles)
return;
this.init();
Object.keys(this._styles)
.forEach(prop => this.element.style.setProperty(prop, this._styles[prop]));
super.play();
}
destroy() {
if (!this._startingStyles)
return;
Object.keys(this._startingStyles).forEach(prop => {
const value = this._startingStyles[prop];
if (value) {
this.element.style.setProperty(prop, value);
}
else {
this.element.style.removeProperty(prop);
}
});
this._startingStyles = null;
super.destroy();
}
}
const KEYFRAMES_NAME_PREFIX = 'gen_css_kf_';
const TAB_SPACE = ' ';
class CssKeyframesDriver {
constructor() {
this._count = 0;
}
validateStyleProperty(prop) {
return validateStyleProperty(prop);
}
matchesElement(element, selector) {
return matchesElement(element, selector);
}
containsElement(elm1, elm2) {
return containsElement(elm1, elm2);
}
query(element, selector, multi) {
return invokeQuery(element, selector, multi);
}
computeStyle(element, prop, defaultValue) {
return window.getComputedStyle(element)[prop];
}
buildKeyframeElement(element, name, keyframes) {
keyframes = keyframes.map(kf => hypenatePropsObject(kf));
let keyframeStr = `@keyframes ${name} {\n`;
let tab = '';
keyframes.forEach(kf => {
tab = TAB_SPACE;
const offset = parseFloat(kf['offset']);
keyframeStr += `${tab}${offset * 100}% {\n`;
tab += TAB_SPACE;
Object.keys(kf).forEach(prop => {
const value = kf[prop];
switch (prop) {
case 'offset':
return;
case 'easing':
if (value) {
keyframeStr += `${tab}animation-timing-function: ${value};\n`;
}
return;
default:
keyframeStr += `${tab}${prop}: ${value};\n`;
return;
}
});
keyframeStr += `${tab}}\n`;
});
keyframeStr += `}\n`;
const kfElm = document.createElement('style');
kfElm.textContent = keyframeStr;
return kfElm;
}
animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {
if ((typeof ngDevMode === 'undefined' || ngDevMode) && scrubberAccessRequested) {
notifyFaultyScrubber();
}
const previousCssKeyframePlayers = previousPlayers.filter(player => player instanceof CssKeyframesPlayer);
const previousStyles = {};
if (allowPreviousPlayerStylesMerge(duration, delay)) {
previousCssKeyframePlayers.forEach(player => {
let styles = player.currentSnapshot;
Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);
});
}
keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);
const finalStyles = flattenKeyframesIntoStyles(keyframes);
// if there is no animation then there is no point in applying
// styles and waiting for an event to get fired. This causes lag.
// It's better to just directly apply the styles to the element
// via the direct styling animation player.
if (duration == 0) {
return new DirectStylePlayer(element, finalStyles);
}
const animationName = `${KEYFRAMES_NAME_PREFIX}${this._count++}`;
const kfElm = this.buildKeyframeElement(element, animationName, keyframes);
const nodeToAppendKfElm = findNodeToAppendKeyframeElement(element);
nodeToAppendKfElm.appendChild(kfElm);
const specialStyles = packageNonAnimatableStyles(element, keyframes);
const player = new CssKeyframesPlayer(element, keyframes, animationName, duration, delay, easing, finalStyles, specialStyles);
player.onDestroy(() => removeElement(kfElm));
return player;
}
}
function findNodeToAppendKeyframeElement(element) {
var _a;
const rootNode = (_a = element.getRootNode) === null || _a === void 0 ? void 0 : _a.call(element);
if (typeof ShadowRoot !== 'undefined' && rootNode instanceof ShadowRoot) {
return rootNode;
}
return document.head;
}
function flattenKeyframesIntoStyles(keyframes) {
let flatKeyframes = {};
if (keyframes) {
const kfs = Array.isArray(keyframes) ? keyframes : [keyframes];
kfs.forEach(kf => {
Object.keys(kf).forEach(prop => {
if (prop == 'offset' || prop == 'easing')
return;
flatKeyframes[prop] = kf[prop];
});
});
}
return flatKeyframes;
}
function removeElement(node) {
node.parentNode.removeChild(node);
}
let warningIssued = false;
function notifyFaultyScrubber() {
if (warningIssued)
return;
console.warn('@angular/animations: please load the web-animations.js polyfill to allow programmatic access...\n', ' visit https://bit.ly/IWukam to learn more about using the web-animation-js polyfill.');
warningIssued = true;
}
class WebAnimationsPlayer {
constructor(element, keyframes, options, _specialStyles) {
this.element = element;
this.keyframes = keyframes;
this.options = options;
this._specialStyles = _specialStyles;
this._onDoneFns = [];
this._onStartFns = [];
this._onDestroyFns = [];
this._initialized = false;
this._finished = false;
this._started = false;
this._destroyed = false;
this.time = 0;
this.parentPlayer = null;
this.currentSnapshot = {};
this._duration = options['duration'];
this._delay = options['delay'] || 0;
this.time = this._duration + this._delay;
}
_onFinish() {
if (!this._finished) {
this._finished = true;
this._onDoneFns.forEach(fn => fn());
this._onDoneFns = [];
}
}
init() {
this._buildPlayer();
this._preparePlayerBeforeStart();
}
_buildPlayer() {
if (this._initialized)
return;
this._initialized = true;
const keyframes = this.keyframes;
this.domPlayer =
this._triggerWebAnimation(this.element, keyframes, this.options);
this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : {};
this.domPlayer.addEventListener('finish', () => this._onFinish());
}
_preparePlayerBeforeStart() {
// this is required so that the player doesn't start to animate right away
if (this._delay) {
this._resetDomPlayerState();
}
else {
this.domPlayer.pause();
}
}
/** @internal */
_triggerWebAnimation(element, keyframes, options) {
// jscompiler doesn't seem to know animate is a native property because it's not fully
// supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]
return element['animate'](keyframes, options);
}
onStart(fn) {
this._onStartFns.push(fn);
}
onDone(fn) {
this._onDoneFns.push(fn);
}
onDestroy(fn) {
this._onDestroyFns.push(fn);
}
play() {
this._buildPlayer();
if (!this.hasStarted()) {
this._onStartFns.forEach(fn => fn());
this._onStartFns = [];
this._started = true;
if (this._specialStyles) {
this._specialStyles.start();
}
}
this.domPlayer.play();
}
pause() {
this.init();
this.domPlayer.pause();
}
finish() {
this.init();
if (this._specialStyles) {
this._specialStyles.finish();
}
this._onFinish();
this.domPlayer.finish();
}
reset() {
this._resetDomPlayerState();
this._destroyed = false;
this._finished = false;
this._started = false;
}
_resetDomPlayerState() {
if (this.domPlayer) {
this.domPlayer.cancel();
}
}
restart() {
this.reset();
this.play();
}
hasStarted() {
return this._started;
}
destroy() {
if (!this._destroyed) {
this._destroyed = true;
this._resetDomPlayerState();
this._onFinish();
if (this._specialStyles) {
this._specialStyles.destroy();
}
this._onDestroyFns.forEach(fn => fn());
this._onDestroyFns = [];
}
}
setPosition(p) {
if (this.domPlayer === undefined) {
this.init();
}
this.domPlayer.currentTime = p * this.time;
}
getPosition() {
return this.domPlayer.currentTime / this.time;
}
get totalTime() {
return this._delay + this._duration;
}
beforeDestroy() {
const styles = {};
if (this.hasStarted()) {
Object.keys(this._finalKeyframe).forEach(prop => {
if (prop != 'offset') {
styles[prop] =
this._finished ? this._finalKeyframe[prop] : computeStyle(this.element, prop);
}
});
}
this.currentSnapshot = styles;
}
/** @internal */
triggerCallback(phaseName) {
const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;
methods.forEach(fn => fn());
methods.length = 0;
}
}
class WebAnimationsDriver {
constructor() {
this._isNativeImpl = /\{\s*\[native\s+code\]\s*\}/.test(getElementAnimateFn().toString());
this._cssKeyframesDriver = new CssKeyframesDriver();
}
validateStyleProperty(prop) {
return validateStyleProperty(prop);
}
matchesElement(element, selector) {
return matchesElement(element, selector);
}
containsElement(elm1, elm2) {
return containsElement(elm1, elm2);
}
query(element, selector, multi) {
return invokeQuery(element, selector, multi);
}
computeStyle(element, prop, defaultValue) {
return window.getComputedStyle(element)[prop];
}
overrideWebAnimationsSupport(supported) {
this._isNativeImpl = supported;
}
animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {
const useKeyframes = !scrubberAccessRequested && !this._isNativeImpl;
if (useKeyframes) {
return this._cssKeyframesDriver.animate(element, keyframes, duration, delay, easing, previousPlayers);
}
const fill = delay == 0 ? 'both' : 'forwards';
const playerOptions = { duration, delay, fill };
// we check for this to avoid having a null|undefined value be present
// for the easing (which results in an error for certain browsers #9752)
if (easing) {
playerOptions['easing'] = easing;
}
const previousStyles = {};
const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);
if (allowPreviousPlayerStylesMerge(duration, delay)) {
previousWebAnimationPlayers.forEach(player => {
let styles = player.currentSnapshot;
Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]);
});
}
keyframes = keyframes.map(styles => copyStyles(styles, false));
keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles);
const specialStyles = packageNonAnimatableStyles(element, keyframes);
return new WebAnimationsPlayer(element, keyframes, playerOptions, specialStyles);
}
}
function supportsWebAnimations() {
return typeof getElementAnimateFn() === 'function';
}
function getElementAnimateFn() {
return (isBrowser() && Element.prototype['animate']) || {};
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Generated bundle index. Do not edit.
*/
//# sourceMappingURL=browser.js.map
/***/ }),
/***/ 38583:
/*!**********************************************************************!*\
!*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js ***!
\**********************************************************************/
/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */ "APP_BASE_HREF": function() { return /* binding */ APP_BASE_HREF; },
/* harmony export */ "AsyncPipe": function() { return /* binding */ AsyncPipe; },
/* harmony export */ "CommonModule": function() { return /* binding */ CommonModule; },
/* harmony export */ "CurrencyPipe": function() { return /* binding */ CurrencyPipe; },
/* harmony export */ "DOCUMENT": function() { return /* binding */ DOCUMENT; },
/* harmony export */ "DatePipe": function() { return /* binding */ DatePipe; },
/* harmony export */ "DecimalPipe": function() { return /* binding */ DecimalPipe; },
/* harmony export */ "FormStyle": function() { return /* binding */ FormStyle; },
/* harmony export */ "FormatWidth": function() { return /* binding */ FormatWidth; },
/* harmony export */ "HashLocationStrategy": function() { return /* binding */ HashLocationStrategy; },
/* harmony export */ "I18nPluralPipe": function() { return /* binding */ I18nPluralPipe; },
/* harmony export */ "I18nSelectPipe": function() { return /* binding */ I18nSelectPipe; },
/* harmony export */ "JsonPipe": function() { return /* binding */ JsonPipe; },
/* harmony export */ "KeyValuePipe": function() { return /* binding */ KeyValuePipe; },
/* harmony export */ "LOCATION_INITIALIZED": function() { return /* binding */ LOCATION_INITIALIZED; },
/* harmony export */ "Location": function() { return /* binding */ Location; },
/* harmony export */ "LocationStrategy": function() { return /* binding */ LocationStrategy; },
/* harmony export */ "LowerCasePipe": function() { return /* binding */ LowerCasePipe; },
/* harmony export */ "NgClass": function() { return /* binding */ NgClass; },
/* harmony export */ "NgComponentOutlet": function() { return /* binding */ NgComponentOutlet; },
/* harmony export */ "NgForOf": function() { return /* binding */ NgForOf; },
/* harmony export */ "NgForOfContext": function() { return /* binding */ NgForOfContext; },
/* harmony export */ "NgIf": function() { return /* binding */ NgIf; },
/* harmony export */ "NgIfContext": function() { return /* binding */ NgIfContext; },
/* harmony export */ "NgLocaleLocalization": function() { return /* binding */ NgLocaleLocalization; },
/* harmony export */ "NgLocalization": function() { return /* binding */ NgLocalization; },
/* harmony export */ "NgPlural": function() { return /* binding */ NgPlural; },
/* harmony export */ "NgPluralCase": function() { return /* binding */ NgPluralCase; },
/* harmony export */ "NgStyle": function() { return /* binding */ NgStyle; },
/* harmony export */ "NgSwitch": function() { return /* binding */ NgSwitch; },
/* harmony export */ "NgSwitchCase": function() { return /* binding */ NgSwitchCase; },
/* harmony export */ "NgSwitchDefault": function() { return /* binding */ NgSwitchDefault; },
/* harmony export */ "NgTemplateOutlet": function() { return /* binding */ NgTemplateOutlet; },
/* harmony export */ "NumberFormatStyle": function() { return /* binding */ NumberFormatStyle; },
/* harmony export */ "NumberSymbol": function() { return /* binding */ NumberSymbol; },
/* harmony export */ "PathLocationStrategy": function() { return /* binding */ PathLocationStrategy; },
/* harmony export */ "PercentPipe": function() { return /* binding */ PercentPipe; },
/* harmony export */ "PlatformLocation": function() { return /* binding */ PlatformLocation; },
/* harmony export */ "Plural": function() { return /* binding */ Plural; },
/* harmony export */ "SlicePipe": function() { return /* binding */ SlicePipe; },
/* harmony export */ "TitleCasePipe": function() { return /* binding */ TitleCasePipe; },
/* harmony export */ "TranslationWidth": function() { return /* binding */ TranslationWidth; },
/* harmony export */ "UpperCasePipe": function() { return /* binding */ UpperCasePipe; },
/* harmony export */ "VERSION": function() { return /* binding */ VERSION; },
/* harmony export */ "ViewportScroller": function() { return /* binding */ ViewportScroller; },
/* harmony export */ "WeekDay": function() { return /* binding */ WeekDay; },
/* harmony export */ "XhrFactory": function() { return /* binding */ XhrFactory; },
/* harmony export */ "formatCurrency": function() { return /* binding */ formatCurrency; },
/* harmony export */ "formatDate": function() { return /* binding */ formatDate; },
/* harmony export */ "formatNumber": function() { return /* binding */ formatNumber; },
/* harmony export */ "formatPercent": function() { return /* binding */ formatPercent; },
/* harmony export */ "getCurrencySymbol": function() { return /* binding */ getCurrencySymbol; },
/* harmony export */ "getLocaleCurrencyCode": function() { return /* binding */ getLocaleCurrencyCode; },
/* harmony export */ "getLocaleCurrencyName": function() { return /* binding */ getLocaleCurrencyName; },
/* harmony export */ "getLocaleCurrencySymbol": function() { return /* binding */ getLocaleCurrencySymbol; },
/* harmony export */ "getLocaleDateFormat": function() { return /* binding */ getLocaleDateFormat; },
/* harmony export */ "getLocaleDateTimeFormat": function() { return /* binding */ getLocaleDateTimeFormat; },
/* harmony export */ "getLocaleDayNames": function() { return /* binding */ getLocaleDayNames; },
/* harmony export */ "getLocaleDayPeriods": function() { return /* binding */ getLocaleDayPeriods; },
/* harmony export */ "getLocaleDirection": function() { return /* binding */ getLocaleDirection; },
/* harmony export */ "getLocaleEraNames": function() { return /* binding */ getLocaleEraNames; },
/* harmony export */ "getLocaleExtraDayPeriodRules": function() { return /* binding */ getLocaleExtraDayPeriodRules; },
/* harmony export */ "getLocaleExtraDayPeriods": function() { return /* binding */ getLocaleExtraDayPeriods; },
/* harmony export */ "getLocaleFirstDayOfWeek": function() { return /* binding */ getLocaleFirstDayOfWeek; },
/* harmony export */ "getLocaleId": function() { return /* binding */ getLocaleId; },
/* harmony export */ "getLocaleMonthNames": function() { return /* binding */ getLocaleMonthNames; },
/* harmony export */ "getLocaleNumberFormat": function() { return /* binding */ getLocaleNumberFormat; },
/* harmony export */ "getLocaleNumberSymbol": function() { return /* binding */ getLocaleNumberSymbol; },
/* harmony export */ "getLocalePluralCase": function() { return /* binding */ getLocalePluralCase; },
/* harmony export */ "getLocaleTimeFormat": function() { return /* binding */ getLocaleTimeFormat; },
/* harmony export */ "getLocaleWeekEndRange": function() { return /* binding */ getLocaleWeekEndRange; },
/* harmony export */ "getNumberOfCurrencyDigits": function() { return /* binding */ getNumberOfCurrencyDigits; },
/* harmony export */ "isPlatformBrowser": function() { return /* binding */ isPlatformBrowser; },
/* harmony export */ "isPlatformServer": function() { return /* binding */ isPlatformServer; },
/* harmony export */ "isPlatformWorkerApp": function() { return /* binding */ isPlatformWorkerApp; },
/* harmony export */ "isPlatformWorkerUi": function() { return /* binding */ isPlatformWorkerUi; },
/* harmony export */ "registerLocaleData": function() { return /* binding */ registerLocaleData; },
/* harmony export */ "ɵBrowserPlatformLocation": function() { return /* binding */ BrowserPlatformLocation; },
/* harmony export */ "ɵDomAdapter": function() { return /* binding */ DomAdapter; },
/* harmony export */ "ɵNullViewportScroller": function() { return /* binding */ NullViewportScroller; },
/* harmony export */ "ɵPLATFORM_BROWSER_ID": function() { return /* binding */ PLATFORM_BROWSER_ID; },
/* harmony export */ "ɵPLATFORM_SERVER_ID": function() { return /* binding */ PLATFORM_SERVER_ID; },
/* harmony export */ "ɵPLATFORM_WORKER_APP_ID": function() { return /* binding */ PLATFORM_WORKER_APP_ID; },
/* harmony export */ "ɵPLATFORM_WORKER_UI_ID": function() { return /* binding */ PLATFORM_WORKER_UI_ID; },
/* harmony export */ "ɵangular_packages_common_common_a": function() { return /* binding */ useBrowserPlatformLocation; },
/* harmony export */ "ɵangular_packages_common_common_b": function() { return /* binding */ createBrowserPlatformLocation; },
/* harmony export */ "ɵangular_packages_common_common_c": function() { return /* binding */ createLocation; },
/* harmony export */ "ɵangular_packages_common_common_d": function() { return /* binding */ provideLocationStrategy; },
/* harmony export */ "ɵangular_packages_common_common_e": function() { return /* binding */ COMMON_DIRECTIVES; },
/* harmony export */ "ɵangular_packages_common_common_f": function() { return /* binding */ COMMON_PIPES; },
/* harmony export */ "ɵgetDOM": function() { return /* binding */ getDOM; },
/* harmony export */ "ɵparseCookieValue": function() { return /* binding */ parseCookieValue; },
/* harmony export */ "ɵsetRootDomAdapter": function() { return /* binding */ setRootDomAdapter; }
/* harmony export */ });
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ 37716);
/**
* @license Angular v12.0.2
* (c) 2010-2021 Google LLC. https://angular.io/
* License: MIT
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
let _DOM = null;
function getDOM() {
return _DOM;
}
function setDOM(adapter) {
_DOM = adapter;
}
function setRootDomAdapter(adapter) {
if (!_DOM) {
_DOM = adapter;
}
}
/* tslint:disable:requireParameterType */
/**
* Provides DOM operations in an environment-agnostic way.
*
* @security Tread carefully! Interacting with the DOM directly is dangerous and
* can introduce XSS risks.
*/
class DomAdapter {
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A DI Token representing the main rendering context. In a browser this is the DOM Document.
*
* Note: Document might not be available in the Application Context when Application and Rendering
* Contexts are not the same (e.g. when running the application in a Web Worker).
*
* @publicApi
*/
const DOCUMENT = new _angular_core__WEBPACK_IMPORTED_MODULE_0__.InjectionToken('DocumentToken');
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* This class should not be used directly by an application developer. Instead, use
* {@link Location}.
*
* `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be
* platform-agnostic.
* This means that we can have different implementation of `PlatformLocation` for the different
* platforms that Angular supports. For example, `@angular/platform-browser` provides an
* implementation specific to the browser environment, while `@angular/platform-server` provides
* one suitable for use with server-side rendering.
*
* The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}
* when they need to interact with the DOM APIs like pushState, popState, etc.
*
* {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly
* by the {@link Router} in order to navigate between routes. Since all interactions between {@link
* Router} /
* {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`
* class, they are all platform-agnostic.
*
* @publicApi
*/
class PlatformLocation {
historyGo(relativePosition) {
throw new Error('Not implemented');
}
}
PlatformLocation.ɵfac = function PlatformLocation_Factory(t) { return new (t || PlatformLocation)(); };
PlatformLocation.ɵprov = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: useBrowserPlatformLocation, token: PlatformLocation, providedIn: "platform" });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PlatformLocation, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable,
args: [{
providedIn: 'platform',
// See #23917
useFactory: useBrowserPlatformLocation
}]
}], null, null); })();
function useBrowserPlatformLocation() {
return (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(BrowserPlatformLocation);
}
/**
* @description
* Indicates when a location is initialized.
*
* @publicApi
*/
const LOCATION_INITIALIZED = new _angular_core__WEBPACK_IMPORTED_MODULE_0__.InjectionToken('Location Initialized');
/**
* `PlatformLocation` encapsulates all of the direct calls to platform APIs.
* This class should not be used directly by an application developer. Instead, use
* {@link Location}.
*/
class BrowserPlatformLocation extends PlatformLocation {
constructor(_doc) {
super();
this._doc = _doc;
this._init();
}
// This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it
/** @internal */
_init() {
this.location = window.location;
this._history = window.history;
}
getBaseHrefFromDOM() {
return getDOM().getBaseHref(this._doc);
}
onPopState(fn) {
const window = getDOM().getGlobalEventTarget(this._doc, 'window');
window.addEventListener('popstate', fn, false);
return () => window.removeEventListener('popstate', fn);
}
onHashChange(fn) {
const window = getDOM().getGlobalEventTarget(this._doc, 'window');
window.addEventListener('hashchange', fn, false);
return () => window.removeEventListener('hashchange', fn);
}
get href() {
return this.location.href;
}
get protocol() {
return this.location.protocol;
}
get hostname() {
return this.location.hostname;
}
get port() {
return this.location.port;
}
get pathname() {
return this.location.pathname;
}
get search() {
return this.location.search;
}
get hash() {
return this.location.hash;
}
set pathname(newPath) {
this.location.pathname = newPath;
}
pushState(state, title, url) {
if (supportsState()) {
this._history.pushState(state, title, url);
}
else {
this.location.hash = url;
}
}
replaceState(state, title, url) {
if (supportsState()) {
this._history.replaceState(state, title, url);
}
else {
this.location.hash = url;
}
}
forward() {
this._history.forward();
}
back() {
this._history.back();
}
historyGo(relativePosition = 0) {
this._history.go(relativePosition);
}
getState() {
return this._history.state;
}
}
BrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) { return new (t || BrowserPlatformLocation)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](DOCUMENT)); };
BrowserPlatformLocation.ɵprov = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createBrowserPlatformLocation, token: BrowserPlatformLocation, providedIn: "platform" });
BrowserPlatformLocation.ctorParameters = () => [
{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [DOCUMENT,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](BrowserPlatformLocation, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable,
args: [{
providedIn: 'platform',
// See #23917
useFactory: createBrowserPlatformLocation
}]
}], function () { return [{ type: undefined, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [DOCUMENT]
}] }]; }, null); })();
function supportsState() {
return !!window.history.pushState;
}
function createBrowserPlatformLocation() {
return new BrowserPlatformLocation((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT));
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Joins two parts of a URL with a slash if needed.
*
* @param start URL string
* @param end URL string
*
*
* @returns The joined URL string.
*/
function joinWithSlash(start, end) {
if (start.length == 0) {
return end;
}
if (end.length == 0) {
return start;
}
let slashes = 0;
if (start.endsWith('/')) {
slashes++;
}
if (end.startsWith('/')) {
slashes++;
}
if (slashes == 2) {
return start + end.substring(1);
}
if (slashes == 1) {
return start + end;
}
return start + '/' + end;
}
/**
* Removes a trailing slash from a URL string if needed.
* Looks for the first occurrence of either `#`, `?`, or the end of the
* line as `/` characters and removes the trailing slash if one exists.
*
* @param url URL string.
*
* @returns The URL string, modified if needed.
*/
function stripTrailingSlash(url) {
const match = url.match(/#|\?|$/);
const pathEndIdx = match && match.index || url.length;
const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);
return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);
}
/**
* Normalizes URL parameters by prepending with `?` if needed.
*
* @param params String of URL parameters.
*
* @returns The normalized URL parameters string.
*/
function normalizeQueryParams(params) {
return params && params[0] !== '?' ? '?' + params : params;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Enables the `Location` service to read route state from the browser's URL.
* Angular provides two strategies:
* `HashLocationStrategy` and `PathLocationStrategy`.
*
* Applications should use the `Router` or `Location` services to
* interact with application route state.
*
* For instance, `HashLocationStrategy` produces URLs like
* http://example.com#/foo,
* and `PathLocationStrategy` produces
* http://example.com/foo as an equivalent URL.
*
* See these two classes for more.
*
* @publicApi
*/
class LocationStrategy {
historyGo(relativePosition) {
throw new Error('Not implemented');
}
}
LocationStrategy.ɵfac = function LocationStrategy_Factory(t) { return new (t || LocationStrategy)(); };
LocationStrategy.ɵprov = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: provideLocationStrategy, token: LocationStrategy, providedIn: "root" });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](LocationStrategy, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable,
args: [{ providedIn: 'root', useFactory: provideLocationStrategy }]
}], null, null); })();
function provideLocationStrategy(platformLocation) {
// See #23917
const location = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT).location;
return new PathLocationStrategy((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(PlatformLocation), location && location.origin || '');
}
/**
* A predefined [DI token](guide/glossary#di-token) for the base href
* to be used with the `PathLocationStrategy`.
* The base href is the URL prefix that should be preserved when generating
* and recognizing URLs.
*
* @usageNotes
*
* The following example shows how to use this token to configure the root app injector
* with a base href value, so that the DI framework can supply the dependency anywhere in the app.
*
* ```typescript
* import {Component, NgModule} from '@angular/core';
* import {APP_BASE_HREF} from '@angular/common';
*
* @NgModule({
* providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]
* })
* class AppModule {}
* ```
*
* @publicApi
*/
const APP_BASE_HREF = new _angular_core__WEBPACK_IMPORTED_MODULE_0__.InjectionToken('appBaseHref');
/**
* @description
* A {@link LocationStrategy} used to configure the {@link Location} service to
* represent its state in the
* [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the
* browser's URL.
*
* If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF}
* or add a `` element to the document.
*
* For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call
* `location.go('/foo')`, the browser's URL will become
* `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,
* the `` and/or `APP_BASE_HREF` should end with a `/`.
*
* Similarly, if you add `` to the document and call
* `location.go('/foo')`, the browser's URL will become
* `example.com/my/app/foo`.
*
* Note that when using `PathLocationStrategy`, neither the query nor
* the fragment in the `` will be preserved, as outlined
* by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).
*
* @usageNotes
*
* ### Example
*
* {@example common/location/ts/path_location_component.ts region='LocationComponent'}
*
* @publicApi
*/
class PathLocationStrategy extends LocationStrategy {
constructor(_platformLocation, href) {
super();
this._platformLocation = _platformLocation;
this._removeListenerFns = [];
if (href == null) {
href = this._platformLocation.getBaseHrefFromDOM();
}
if (href == null) {
throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`);
}
this._baseHref = href;
}
ngOnDestroy() {
while (this._removeListenerFns.length) {
this._removeListenerFns.pop()();
}
}
onPopState(fn) {
this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
}
getBaseHref() {
return this._baseHref;
}
prepareExternalUrl(internal) {
return joinWithSlash(this._baseHref, internal);
}
path(includeHash = false) {
const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);
const hash = this._platformLocation.hash;
return hash && includeHash ? `${pathname}${hash}` : pathname;
}
pushState(state, title, url, queryParams) {
const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
this._platformLocation.pushState(state, title, externalUrl);
}
replaceState(state, title, url, queryParams) {
const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));
this._platformLocation.replaceState(state, title, externalUrl);
}
forward() {
this._platformLocation.forward();
}
back() {
this._platformLocation.back();
}
historyGo(relativePosition = 0) {
var _a, _b;
(_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);
}
}
PathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) { return new (t || PathLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); };
PathLocationStrategy.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: PathLocationStrategy, factory: PathLocationStrategy.ɵfac });
PathLocationStrategy.ctorParameters = () => [
{ type: PlatformLocation },
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [APP_BASE_HREF,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PathLocationStrategy, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable
}], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional
}, {
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [APP_BASE_HREF]
}] }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @description
* A {@link LocationStrategy} used to configure the {@link Location} service to
* represent its state in the
* [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)
* of the browser's URL.
*
* For instance, if you call `location.go('/foo')`, the browser's URL will become
* `example.com#/foo`.
*
* @usageNotes
*
* ### Example
*
* {@example common/location/ts/hash_location_component.ts region='LocationComponent'}
*
* @publicApi
*/
class HashLocationStrategy extends LocationStrategy {
constructor(_platformLocation, _baseHref) {
super();
this._platformLocation = _platformLocation;
this._baseHref = '';
this._removeListenerFns = [];
if (_baseHref != null) {
this._baseHref = _baseHref;
}
}
ngOnDestroy() {
while (this._removeListenerFns.length) {
this._removeListenerFns.pop()();
}
}
onPopState(fn) {
this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));
}
getBaseHref() {
return this._baseHref;
}
path(includeHash = false) {
// the hash value is always prefixed with a `#`
// and if it is empty then it will stay empty
let path = this._platformLocation.hash;
if (path == null)
path = '#';
return path.length > 0 ? path.substring(1) : path;
}
prepareExternalUrl(internal) {
const url = joinWithSlash(this._baseHref, internal);
return url.length > 0 ? ('#' + url) : url;
}
pushState(state, title, path, queryParams) {
let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
if (url.length == 0) {
url = this._platformLocation.pathname;
}
this._platformLocation.pushState(state, title, url);
}
replaceState(state, title, path, queryParams) {
let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));
if (url.length == 0) {
url = this._platformLocation.pathname;
}
this._platformLocation.replaceState(state, title, url);
}
forward() {
this._platformLocation.forward();
}
back() {
this._platformLocation.back();
}
historyGo(relativePosition = 0) {
var _a, _b;
(_b = (_a = this._platformLocation).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);
}
}
HashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) { return new (t || HashLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); };
HashLocationStrategy.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: HashLocationStrategy, factory: HashLocationStrategy.ɵfac });
HashLocationStrategy.ctorParameters = () => [
{ type: PlatformLocation },
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [APP_BASE_HREF,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](HashLocationStrategy, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable
}], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional
}, {
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [APP_BASE_HREF]
}] }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @description
*
* A service that applications can use to interact with a browser's URL.
*
* Depending on the `LocationStrategy` used, `Location` persists
* to the URL's path or the URL's hash segment.
*
* @usageNotes
*
* It's better to use the `Router.navigate()` service to trigger route changes. Use
* `Location` only if you need to interact with or create normalized URLs outside of
* routing.
*
* `Location` is responsible for normalizing the URL against the application's base href.
* A normalized URL is absolute from the URL host, includes the application's base href, and has no
* trailing slash:
* - `/my/app/user/123` is normalized
* - `my/app/user/123` **is not** normalized
* - `/my/app/user/123/` **is not** normalized
*
* ### Example
*
*
*
* @publicApi
*/
class Location {
constructor(platformStrategy, platformLocation) {
/** @internal */
this._subject = new _angular_core__WEBPACK_IMPORTED_MODULE_0__.EventEmitter();
/** @internal */
this._urlChangeListeners = [];
this._platformStrategy = platformStrategy;
const browserBaseHref = this._platformStrategy.getBaseHref();
this._platformLocation = platformLocation;
this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref));
this._platformStrategy.onPopState((ev) => {
this._subject.emit({
'url': this.path(true),
'pop': true,
'state': ev.state,
'type': ev.type,
});
});
}
/**
* Normalizes the URL path for this location.
*
* @param includeHash True to include an anchor fragment in the path.
*
* @returns The normalized URL path.
*/
// TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is
// removed.
path(includeHash = false) {
return this.normalize(this._platformStrategy.path(includeHash));
}
/**
* Reports the current state of the location history.
* @returns The current value of the `history.state` object.
*/
getState() {
return this._platformLocation.getState();
}
/**
* Normalizes the given path and compares to the current normalized path.
*
* @param path The given URL path.
* @param query Query parameters.
*
* @returns True if the given URL path is equal to the current normalized path, false
* otherwise.
*/
isCurrentPathEqualTo(path, query = '') {
return this.path() == this.normalize(path + normalizeQueryParams(query));
}
/**
* Normalizes a URL path by stripping any trailing slashes.
*
* @param url String representing a URL.
*
* @returns The normalized URL string.
*/
normalize(url) {
return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url)));
}
/**
* Normalizes an external URL path.
* If the given URL doesn't begin with a leading slash (`'/'`), adds one
* before normalizing. Adds a hash if `HashLocationStrategy` is
* in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.
*
* @param url String representing a URL.
*
* @returns A normalized platform-specific URL.
*/
prepareExternalUrl(url) {
if (url && url[0] !== '/') {
url = '/' + url;
}
return this._platformStrategy.prepareExternalUrl(url);
}
// TODO: rename this method to pushState
/**
* Changes the browser's URL to a normalized version of a given URL, and pushes a
* new item onto the platform's history.
*
* @param path URL path to normalize.
* @param query Query parameters.
* @param state Location history state.
*
*/
go(path, query = '', state = null) {
this._platformStrategy.pushState(state, '', path, query);
this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
}
/**
* Changes the browser's URL to a normalized version of the given URL, and replaces
* the top item on the platform's history stack.
*
* @param path URL path to normalize.
* @param query Query parameters.
* @param state Location history state.
*/
replaceState(path, query = '', state = null) {
this._platformStrategy.replaceState(state, '', path, query);
this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);
}
/**
* Navigates forward in the platform's history.
*/
forward() {
this._platformStrategy.forward();
}
/**
* Navigates back in the platform's history.
*/
back() {
this._platformStrategy.back();
}
/**
* Navigate to a specific page from session history, identified by its relative position to the
* current page.
*
* @param relativePosition Position of the target page in the history relative to the current
* page.
* A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`
* moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go
* beyond what's stored in the history session, we stay in the current page. Same behaviour occurs
* when `relativePosition` equals 0.
* @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history
*/
historyGo(relativePosition = 0) {
var _a, _b;
(_b = (_a = this._platformStrategy).historyGo) === null || _b === void 0 ? void 0 : _b.call(_a, relativePosition);
}
/**
* Registers a URL change listener. Use to catch updates performed by the Angular
* framework that are not detectible through "popstate" or "hashchange" events.
*
* @param fn The change handler function, which take a URL and a location history state.
*/
onUrlChange(fn) {
this._urlChangeListeners.push(fn);
if (!this._urlChangeSubscription) {
this._urlChangeSubscription = this.subscribe(v => {
this._notifyUrlChangeListeners(v.url, v.state);
});
}
}
/** @internal */
_notifyUrlChangeListeners(url = '', state) {
this._urlChangeListeners.forEach(fn => fn(url, state));
}
/**
* Subscribes to the platform's `popState` events.
*
* Note: `Location.go()` does not trigger the `popState` event in the browser. Use
* `Location.onUrlChange()` to subscribe to URL changes instead.
*
* @param value Event that is triggered when the state history changes.
* @param exception The exception to throw.
*
* @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)
*
* @returns Subscribed events.
*/
subscribe(onNext, onThrow, onReturn) {
return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });
}
}
Location.ɵfac = function Location_Factory(t) { return new (t || Location)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](LocationStrategy), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation)); };
/**
* Normalizes URL parameters by prepending with `?` if needed.
*
* @param params String of URL parameters.
*
* @returns The normalized URL parameters string.
*/
Location.normalizeQueryParams = normalizeQueryParams;
/**
* Joins two parts of a URL with a slash if needed.
*
* @param start URL string
* @param end URL string
*
*
* @returns The joined URL string.
*/
Location.joinWithSlash = joinWithSlash;
/**
* Removes a trailing slash from a URL string if needed.
* Looks for the first occurrence of either `#`, `?`, or the end of the
* line as `/` characters and removes the trailing slash if one exists.
*
* @param url URL string.
*
* @returns The URL string, modified if needed.
*/
Location.stripTrailingSlash = stripTrailingSlash;
Location.ɵprov = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createLocation, token: Location, providedIn: "root" });
Location.ctorParameters = () => [
{ type: LocationStrategy },
{ type: PlatformLocation }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](Location, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable,
args: [{
providedIn: 'root',
// See #23917
useFactory: createLocation
}]
}], function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; }, null); })();
function createLocation() {
return new Location((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(LocationStrategy), (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(PlatformLocation));
}
function _stripBaseHref(baseHref, url) {
return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url;
}
function _stripIndexHtml(url) {
return url.replace(/\/index.html$/, '');
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/** @internal */
const CURRENCIES_EN = {
'ADP': [undefined, undefined, 0],
'AFN': [undefined, undefined, 0],
'ALL': [undefined, undefined, 0],
'AMD': [undefined, undefined, 2],
'AOA': [undefined, 'Kz'],
'ARS': [undefined, '$'],
'AUD': ['A$', '$'],
'BAM': [undefined, 'KM'],
'BBD': [undefined, '$'],
'BDT': [undefined, '৳'],
'BHD': [undefined, undefined, 3],
'BIF': [undefined, undefined, 0],
'BMD': [undefined, '$'],
'BND': [undefined, '$'],
'BOB': [undefined, 'Bs'],
'BRL': ['R$'],
'BSD': [undefined, '$'],
'BWP': [undefined, 'P'],
'BYN': [undefined, 'р.', 2],
'BYR': [undefined, undefined, 0],
'BZD': [undefined, '$'],
'CAD': ['CA$', '$', 2],
'CHF': [undefined, undefined, 2],
'CLF': [undefined, undefined, 4],
'CLP': [undefined, '$', 0],
'CNY': ['CN¥', '¥'],
'COP': [undefined, '$', 2],
'CRC': [undefined, '₡', 2],
'CUC': [undefined, '$'],
'CUP': [undefined, '$'],
'CZK': [undefined, 'Kč', 2],
'DJF': [undefined, undefined, 0],
'DKK': [undefined, 'kr', 2],
'DOP': [undefined, '$'],
'EGP': [undefined, 'E£'],
'ESP': [undefined, '₧', 0],
'EUR': ['€'],
'FJD': [undefined, '$'],
'FKP': [undefined, '£'],
'GBP': ['£'],
'GEL': [undefined, '₾'],
'GIP': [undefined, '£'],
'GNF': [undefined, 'FG', 0],
'GTQ': [undefined, 'Q'],
'GYD': [undefined, '$', 2],
'HKD': ['HK$', '$'],
'HNL': [undefined, 'L'],
'HRK': [undefined, 'kn'],
'HUF': [undefined, 'Ft', 2],
'IDR': [undefined, 'Rp', 2],
'ILS': ['₪'],
'INR': ['₹'],
'IQD': [undefined, undefined, 0],
'IRR': [undefined, undefined, 0],
'ISK': [undefined, 'kr', 0],
'ITL': [undefined, undefined, 0],
'JMD': [undefined, '$'],
'JOD': [undefined, undefined, 3],
'JPY': ['¥', undefined, 0],
'KHR': [undefined, '៛'],
'KMF': [undefined, 'CF', 0],
'KPW': [undefined, '₩', 0],
'KRW': ['₩', undefined, 0],
'KWD': [undefined, undefined, 3],
'KYD': [undefined, '$'],
'KZT': [undefined, '₸'],
'LAK': [undefined, '₭', 0],
'LBP': [undefined, 'L£', 0],
'LKR': [undefined, 'Rs'],
'LRD': [undefined, '$'],
'LTL': [undefined, 'Lt'],
'LUF': [undefined, undefined, 0],
'LVL': [undefined, 'Ls'],
'LYD': [undefined, undefined, 3],
'MGA': [undefined, 'Ar', 0],
'MGF': [undefined, undefined, 0],
'MMK': [undefined, 'K', 0],
'MNT': [undefined, '₮', 2],
'MRO': [undefined, undefined, 0],
'MUR': [undefined, 'Rs', 2],
'MXN': ['MX$', '$'],
'MYR': [undefined, 'RM'],
'NAD': [undefined, '$'],
'NGN': [undefined, '₦'],
'NIO': [undefined, 'C$'],
'NOK': [undefined, 'kr', 2],
'NPR': [undefined, 'Rs'],
'NZD': ['NZ$', '$'],
'OMR': [undefined, undefined, 3],
'PHP': [undefined, '₱'],
'PKR': [undefined, 'Rs', 2],
'PLN': [undefined, 'zł'],
'PYG': [undefined, '₲', 0],
'RON': [undefined, 'lei'],
'RSD': [undefined, undefined, 0],
'RUB': [undefined, '₽'],
'RUR': [undefined, 'р.'],
'RWF': [undefined, 'RF', 0],
'SBD': [undefined, '$'],
'SEK': [undefined, 'kr', 2],
'SGD': [undefined, '$'],
'SHP': [undefined, '£'],
'SLL': [undefined, undefined, 0],
'SOS': [undefined, undefined, 0],
'SRD': [undefined, '$'],
'SSP': [undefined, '£'],
'STD': [undefined, undefined, 0],
'STN': [undefined, 'Db'],
'SYP': [undefined, '£', 0],
'THB': [undefined, '฿'],
'TMM': [undefined, undefined, 0],
'TND': [undefined, undefined, 3],
'TOP': [undefined, 'T$'],
'TRL': [undefined, undefined, 0],
'TRY': [undefined, '₺'],
'TTD': [undefined, '$'],
'TWD': ['NT$', '$', 2],
'TZS': [undefined, undefined, 2],
'UAH': [undefined, '₴'],
'UGX': [undefined, undefined, 0],
'USD': ['$'],
'UYI': [undefined, undefined, 0],
'UYU': [undefined, '$'],
'UYW': [undefined, undefined, 4],
'UZS': [undefined, undefined, 2],
'VEF': [undefined, 'Bs', 2],
'VND': ['₫', undefined, 0],
'VUV': [undefined, undefined, 0],
'XAF': ['FCFA', undefined, 0],
'XCD': ['EC$', '$'],
'XOF': ['CFA', undefined, 0],
'XPF': ['CFPF', undefined, 0],
'XXX': ['¤'],
'YER': [undefined, undefined, 0],
'ZAR': [undefined, 'R'],
'ZMK': [undefined, undefined, 0],
'ZMW': [undefined, 'ZK'],
'ZWD': [undefined, undefined, 0]
};
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Format styles that can be used to represent numbers.
* @see `getLocaleNumberFormat()`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
var NumberFormatStyle;
(function (NumberFormatStyle) {
NumberFormatStyle[NumberFormatStyle["Decimal"] = 0] = "Decimal";
NumberFormatStyle[NumberFormatStyle["Percent"] = 1] = "Percent";
NumberFormatStyle[NumberFormatStyle["Currency"] = 2] = "Currency";
NumberFormatStyle[NumberFormatStyle["Scientific"] = 3] = "Scientific";
})(NumberFormatStyle || (NumberFormatStyle = {}));
/**
* Plurality cases used for translating plurals to different languages.
*
* @see `NgPlural`
* @see `NgPluralCase`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
var Plural;
(function (Plural) {
Plural[Plural["Zero"] = 0] = "Zero";
Plural[Plural["One"] = 1] = "One";
Plural[Plural["Two"] = 2] = "Two";
Plural[Plural["Few"] = 3] = "Few";
Plural[Plural["Many"] = 4] = "Many";
Plural[Plural["Other"] = 5] = "Other";
})(Plural || (Plural = {}));
/**
* Context-dependant translation forms for strings.
* Typically the standalone version is for the nominative form of the word,
* and the format version is used for the genitive case.
* @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
var FormStyle;
(function (FormStyle) {
FormStyle[FormStyle["Format"] = 0] = "Format";
FormStyle[FormStyle["Standalone"] = 1] = "Standalone";
})(FormStyle || (FormStyle = {}));
/**
* String widths available for translations.
* The specific character widths are locale-specific.
* Examples are given for the word "Sunday" in English.
*
* @publicApi
*/
var TranslationWidth;
(function (TranslationWidth) {
/** 1 character for `en-US`. For example: 'S' */
TranslationWidth[TranslationWidth["Narrow"] = 0] = "Narrow";
/** 3 characters for `en-US`. For example: 'Sun' */
TranslationWidth[TranslationWidth["Abbreviated"] = 1] = "Abbreviated";
/** Full length for `en-US`. For example: "Sunday" */
TranslationWidth[TranslationWidth["Wide"] = 2] = "Wide";
/** 2 characters for `en-US`, For example: "Su" */
TranslationWidth[TranslationWidth["Short"] = 3] = "Short";
})(TranslationWidth || (TranslationWidth = {}));
/**
* String widths available for date-time formats.
* The specific character widths are locale-specific.
* Examples are given for `en-US`.
*
* @see `getLocaleDateFormat()`
* @see `getLocaleTimeFormat()`
* @see `getLocaleDateTimeFormat()`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* @publicApi
*/
var FormatWidth;
(function (FormatWidth) {
/**
* For `en-US`, 'M/d/yy, h:mm a'`
* (Example: `6/15/15, 9:03 AM`)
*/
FormatWidth[FormatWidth["Short"] = 0] = "Short";
/**
* For `en-US`, `'MMM d, y, h:mm:ss a'`
* (Example: `Jun 15, 2015, 9:03:01 AM`)
*/
FormatWidth[FormatWidth["Medium"] = 1] = "Medium";
/**
* For `en-US`, `'MMMM d, y, h:mm:ss a z'`
* (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)
*/
FormatWidth[FormatWidth["Long"] = 2] = "Long";
/**
* For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`
* (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)
*/
FormatWidth[FormatWidth["Full"] = 3] = "Full";
})(FormatWidth || (FormatWidth = {}));
/**
* Symbols that can be used to replace placeholders in number patterns.
* Examples are based on `en-US` values.
*
* @see `getLocaleNumberSymbol()`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
var NumberSymbol;
(function (NumberSymbol) {
/**
* Decimal separator.
* For `en-US`, the dot character.
* Example: 2,345`.`67
*/
NumberSymbol[NumberSymbol["Decimal"] = 0] = "Decimal";
/**
* Grouping separator, typically for thousands.
* For `en-US`, the comma character.
* Example: 2`,`345.67
*/
NumberSymbol[NumberSymbol["Group"] = 1] = "Group";
/**
* List-item separator.
* Example: "one, two, and three"
*/
NumberSymbol[NumberSymbol["List"] = 2] = "List";
/**
* Sign for percentage (out of 100).
* Example: 23.4%
*/
NumberSymbol[NumberSymbol["PercentSign"] = 3] = "PercentSign";
/**
* Sign for positive numbers.
* Example: +23
*/
NumberSymbol[NumberSymbol["PlusSign"] = 4] = "PlusSign";
/**
* Sign for negative numbers.
* Example: -23
*/
NumberSymbol[NumberSymbol["MinusSign"] = 5] = "MinusSign";
/**
* Computer notation for exponential value (n times a power of 10).
* Example: 1.2E3
*/
NumberSymbol[NumberSymbol["Exponential"] = 6] = "Exponential";
/**
* Human-readable format of exponential.
* Example: 1.2x103
*/
NumberSymbol[NumberSymbol["SuperscriptingExponent"] = 7] = "SuperscriptingExponent";
/**
* Sign for permille (out of 1000).
* Example: 23.4‰
*/
NumberSymbol[NumberSymbol["PerMille"] = 8] = "PerMille";
/**
* Infinity, can be used with plus and minus.
* Example: ∞, +∞, -∞
*/
NumberSymbol[NumberSymbol["Infinity"] = 9] = "Infinity";
/**
* Not a number.
* Example: NaN
*/
NumberSymbol[NumberSymbol["NaN"] = 10] = "NaN";
/**
* Symbol used between time units.
* Example: 10:52
*/
NumberSymbol[NumberSymbol["TimeSeparator"] = 11] = "TimeSeparator";
/**
* Decimal separator for currency values (fallback to `Decimal`).
* Example: $2,345.67
*/
NumberSymbol[NumberSymbol["CurrencyDecimal"] = 12] = "CurrencyDecimal";
/**
* Group separator for currency values (fallback to `Group`).
* Example: $2,345.67
*/
NumberSymbol[NumberSymbol["CurrencyGroup"] = 13] = "CurrencyGroup";
})(NumberSymbol || (NumberSymbol = {}));
/**
* The value for each day of the week, based on the `en-US` locale
*
* @publicApi
*/
var WeekDay;
(function (WeekDay) {
WeekDay[WeekDay["Sunday"] = 0] = "Sunday";
WeekDay[WeekDay["Monday"] = 1] = "Monday";
WeekDay[WeekDay["Tuesday"] = 2] = "Tuesday";
WeekDay[WeekDay["Wednesday"] = 3] = "Wednesday";
WeekDay[WeekDay["Thursday"] = 4] = "Thursday";
WeekDay[WeekDay["Friday"] = 5] = "Friday";
WeekDay[WeekDay["Saturday"] = 6] = "Saturday";
})(WeekDay || (WeekDay = {}));
/**
* Retrieves the locale ID from the currently loaded locale.
* The loaded locale could be, for example, a global one rather than a regional one.
* @param locale A locale code, such as `fr-FR`.
* @returns The locale code. For example, `fr`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleId(locale) {
return (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale)[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].LocaleId];
}
/**
* Retrieves day period strings for the given locale.
*
* @param locale A locale code for the locale format rules to use.
* @param formStyle The required grammatical form.
* @param width The required character width.
* @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleDayPeriods(locale, formStyle, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const amPmData = [
data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsStandalone]
];
const amPm = getLastDefinedValue(amPmData, formStyle);
return getLastDefinedValue(amPm, width);
}
/**
* Retrieves days of the week for the given locale, using the Gregorian calendar.
*
* @param locale A locale code for the locale format rules to use.
* @param formStyle The required grammatical form.
* @param width The required character width.
* @returns An array of localized name strings.
* For example,`[Sunday, Monday, ... Saturday]` for `en-US`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleDayNames(locale, formStyle, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const daysData = [data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysStandalone]];
const days = getLastDefinedValue(daysData, formStyle);
return getLastDefinedValue(days, width);
}
/**
* Retrieves months of the year for the given locale, using the Gregorian calendar.
*
* @param locale A locale code for the locale format rules to use.
* @param formStyle The required grammatical form.
* @param width The required character width.
* @returns An array of localized name strings.
* For example, `[January, February, ...]` for `en-US`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleMonthNames(locale, formStyle, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const monthsData = [data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsStandalone]];
const months = getLastDefinedValue(monthsData, formStyle);
return getLastDefinedValue(months, width);
}
/**
* Retrieves Gregorian-calendar eras for the given locale.
* @param locale A locale code for the locale format rules to use.
* @param width The required character width.
* @returns An array of localized era strings.
* For example, `[AD, BC]` for `en-US`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleEraNames(locale, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const erasData = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Eras];
return getLastDefinedValue(erasData, width);
}
/**
* Retrieves the first day of the week for the given locale.
*
* @param locale A locale code for the locale format rules to use.
* @returns A day index number, using the 0-based week-day index for `en-US`
* (Sunday = 0, Monday = 1, ...).
* For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleFirstDayOfWeek(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].FirstDayOfWeek];
}
/**
* Range of week days that are considered the week-end for the given locale.
*
* @param locale A locale code for the locale format rules to use.
* @returns The range of day values, `[startDay, endDay]`.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleWeekEndRange(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].WeekendRange];
}
/**
* Retrieves a localized date-value formating string.
*
* @param locale A locale code for the locale format rules to use.
* @param width The format type.
* @returns The localized formating string.
* @see `FormatWidth`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleDateFormat(locale, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateFormat], width);
}
/**
* Retrieves a localized time-value formatting string.
*
* @param locale A locale code for the locale format rules to use.
* @param width The format type.
* @returns The localized formatting string.
* @see `FormatWidth`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* @publicApi
*/
function getLocaleTimeFormat(locale, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].TimeFormat], width);
}
/**
* Retrieves a localized date-time formatting string.
*
* @param locale A locale code for the locale format rules to use.
* @param width The format type.
* @returns The localized formatting string.
* @see `FormatWidth`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleDateTimeFormat(locale, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const dateTimeFormatData = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateTimeFormat];
return getLastDefinedValue(dateTimeFormatData, width);
}
/**
* Retrieves a localized number symbol that can be used to replace placeholders in number formats.
* @param locale The locale code.
* @param symbol The symbol to localize.
* @returns The character for the localized symbol.
* @see `NumberSymbol`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleNumberSymbol(locale, symbol) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
const res = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][symbol];
if (typeof res === 'undefined') {
if (symbol === NumberSymbol.CurrencyDecimal) {
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Decimal];
}
else if (symbol === NumberSymbol.CurrencyGroup) {
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Group];
}
}
return res;
}
/**
* Retrieves a number format for a given locale.
*
* Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`
* when used to format the number 12345.678 could result in "12'345,678". That would happen if the
* grouping separator for your language is an apostrophe, and the decimal separator is a comma.
*
* Important: The characters `.` `,` `0` `#` (and others below) are special placeholders
* that stand for the decimal separator, and so on, and are NOT real characters.
* You must NOT "translate" the placeholders. For example, don't change `.` to `,` even though in
* your language the decimal point is written with a comma. The symbols should be replaced by the
* local equivalents, using the appropriate `NumberSymbol` for your language.
*
* Here are the special characters used in number patterns:
*
* | Symbol | Meaning |
* |--------|---------|
* | . | Replaced automatically by the character used for the decimal point. |
* | , | Replaced by the "grouping" (thousands) separator. |
* | 0 | Replaced by a digit (or zero if there aren't enough digits). |
* | # | Replaced by a digit (or nothing if there aren't enough). |
* | ¤ | Replaced by a currency symbol, such as $ or USD. |
* | % | Marks a percent format. The % symbol may change position, but must be retained. |
* | E | Marks a scientific format. The E symbol may change position, but must be retained. |
* | ' | Special characters used as literal characters are quoted with ASCII single quotes. |
*
* @param locale A locale code for the locale format rules to use.
* @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)
* @returns The localized format string.
* @see `NumberFormatStyle`
* @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleNumberFormat(locale, type) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberFormats][type];
}
/**
* Retrieves the symbol used to represent the currency for the main country
* corresponding to a given locale. For example, '$' for `en-US`.
*
* @param locale A locale code for the locale format rules to use.
* @returns The localized symbol character,
* or `null` if the main country cannot be determined.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleCurrencySymbol(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencySymbol] || null;
}
/**
* Retrieves the name of the currency for the main country corresponding
* to a given locale. For example, 'US Dollar' for `en-US`.
* @param locale A locale code for the locale format rules to use.
* @returns The currency name,
* or `null` if the main country cannot be determined.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleCurrencyName(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencyName] || null;
}
/**
* Retrieves the default currency code for the given locale.
*
* The default is defined as the first currency which is still in use.
*
* @param locale The code of the locale whose currency code we want.
* @returns The code of the default currency for the given locale.
*
* @publicApi
*/
function getLocaleCurrencyCode(locale) {
return (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocaleCurrencyCode"])(locale);
}
/**
* Retrieves the currency values for a given locale.
* @param locale A locale code for the locale format rules to use.
* @returns The currency values.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*/
function getLocaleCurrencies(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Currencies];
}
/**
* @alias core/ɵgetLocalePluralCase
* @publicApi
*/
const getLocalePluralCase = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocalePluralCase"];
function checkFullData(data) {
if (!data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData]) {
throw new Error(`Missing extra locale data for the locale "${data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].LocaleId]}". Use "registerLocaleData" to load new data. See the "I18n guide" on angular.io to know more.`);
}
}
/**
* Retrieves locale-specific rules used to determine which day period to use
* when more than one period is defined for a locale.
*
* There is a rule for each defined day period. The
* first rule is applied to the first day period and so on.
* Fall back to AM/PM when no rules are available.
*
* A rule can specify a period as time range, or as a single time value.
*
* This functionality is only available when you have loaded the full locale data.
* See the ["I18n guide"](guide/i18n#i18n-pipes).
*
* @param locale A locale code for the locale format rules to use.
* @returns The rules for the locale, a single time value or array of *from-time, to-time*,
* or null if no periods are available.
*
* @see `getLocaleExtraDayPeriods()`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleExtraDayPeriodRules(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
checkFullData(data);
const rules = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][2 /* ExtraDayPeriodsRules */] || [];
return rules.map((rule) => {
if (typeof rule === 'string') {
return extractTime(rule);
}
return [extractTime(rule[0]), extractTime(rule[1])];
});
}
/**
* Retrieves locale-specific day periods, which indicate roughly how a day is broken up
* in different languages.
* For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.
*
* This functionality is only available when you have loaded the full locale data.
* See the ["I18n guide"](guide/i18n#i18n-pipes).
*
* @param locale A locale code for the locale format rules to use.
* @param formStyle The required grammatical form.
* @param width The required character width.
* @returns The translated day-period strings.
* @see `getLocaleExtraDayPeriodRules()`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLocaleExtraDayPeriods(locale, formStyle, width) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
checkFullData(data);
const dayPeriodsData = [
data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][0 /* ExtraDayPeriodFormats */],
data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][1 /* ExtraDayPeriodStandalone */]
];
const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];
return getLastDefinedValue(dayPeriods, width) || [];
}
/**
* Retrieves the writing direction of a specified locale
* @param locale A locale code for the locale format rules to use.
* @publicApi
* @returns 'rtl' or 'ltr'
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*/
function getLocaleDirection(locale) {
const data = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale);
return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Directionality];
}
/**
* Retrieves the first value that is defined in an array, going backwards from an index position.
*
* To avoid repeating the same data (as when the "format" and "standalone" forms are the same)
* add the first value to the locale data arrays, and add other values only if they are different.
*
* @param data The data array to retrieve from.
* @param index A 0-based index into the array to start from.
* @returns The value immediately before the given index position.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getLastDefinedValue(data, index) {
for (let i = index; i > -1; i--) {
if (typeof data[i] !== 'undefined') {
return data[i];
}
}
throw new Error('Locale data API: locale data undefined');
}
/**
* Extracts the hours and minutes from a string like "15:45"
*/
function extractTime(time) {
const [h, m] = time.split(':');
return { hours: +h, minutes: +m };
}
/**
* Retrieves the currency symbol for a given currency code.
*
* For example, for the default `en-US` locale, the code `USD` can
* be represented by the narrow symbol `$` or the wide symbol `US$`.
*
* @param code The currency code.
* @param format The format, `wide` or `narrow`.
* @param locale A locale code for the locale format rules to use.
*
* @returns The symbol, or the currency code if no symbol is available.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getCurrencySymbol(code, format, locale = 'en') {
const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];
const symbolNarrow = currency[1 /* SymbolNarrow */];
if (format === 'narrow' && typeof symbolNarrow === 'string') {
return symbolNarrow;
}
return currency[0 /* Symbol */] || code;
}
// Most currencies have cents, that's why the default is 2
const DEFAULT_NB_OF_CURRENCY_DIGITS = 2;
/**
* Reports the number of decimal digits for a given currency.
* The value depends upon the presence of cents in that particular currency.
*
* @param code The currency code.
* @returns The number of decimal digits, typically 0 or 2.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function getNumberOfCurrencyDigits(code) {
let digits;
const currency = CURRENCIES_EN[code];
if (currency) {
digits = currency[2 /* NbOfDigits */];
}
return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const ISO8601_DATE_REGEX = /^(\d{4})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/;
// 1 2 3 4 5 6 7 8 9 10 11
const NAMED_FORMATS = {};
const DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\s\S]*)/;
var ZoneWidth;
(function (ZoneWidth) {
ZoneWidth[ZoneWidth["Short"] = 0] = "Short";
ZoneWidth[ZoneWidth["ShortGMT"] = 1] = "ShortGMT";
ZoneWidth[ZoneWidth["Long"] = 2] = "Long";
ZoneWidth[ZoneWidth["Extended"] = 3] = "Extended";
})(ZoneWidth || (ZoneWidth = {}));
var DateType;
(function (DateType) {
DateType[DateType["FullYear"] = 0] = "FullYear";
DateType[DateType["Month"] = 1] = "Month";
DateType[DateType["Date"] = 2] = "Date";
DateType[DateType["Hours"] = 3] = "Hours";
DateType[DateType["Minutes"] = 4] = "Minutes";
DateType[DateType["Seconds"] = 5] = "Seconds";
DateType[DateType["FractionalSeconds"] = 6] = "FractionalSeconds";
DateType[DateType["Day"] = 7] = "Day";
})(DateType || (DateType = {}));
var TranslationType;
(function (TranslationType) {
TranslationType[TranslationType["DayPeriods"] = 0] = "DayPeriods";
TranslationType[TranslationType["Days"] = 1] = "Days";
TranslationType[TranslationType["Months"] = 2] = "Months";
TranslationType[TranslationType["Eras"] = 3] = "Eras";
})(TranslationType || (TranslationType = {}));
/**
* @ngModule CommonModule
* @description
*
* Formats a date according to locale rules.
*
* @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)
* or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).
* @param format The date-time components to include. See `DatePipe` for details.
* @param locale A locale code for the locale format rules to use.
* @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),
* or a standard UTC/GMT or continental US time zone abbreviation.
* If not specified, uses host system settings.
*
* @returns The formatted date string.
*
* @see `DatePipe`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function formatDate(value, format, locale, timezone) {
let date = toDate(value);
const namedFormat = getNamedFormat(locale, format);
format = namedFormat || format;
let parts = [];
let match;
while (format) {
match = DATE_FORMATS_SPLIT.exec(format);
if (match) {
parts = parts.concat(match.slice(1));
const part = parts.pop();
if (!part) {
break;
}
format = part;
}
else {
parts.push(format);
break;
}
}
let dateTimezoneOffset = date.getTimezoneOffset();
if (timezone) {
dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
date = convertTimezoneToLocal(date, timezone, true);
}
let text = '';
parts.forEach(value => {
const dateFormatter = getDateFormatter(value);
text += dateFormatter ?
dateFormatter(date, locale, dateTimezoneOffset) :
value === '\'\'' ? '\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\'');
});
return text;
}
/**
* Create a new Date object with the given date value, and the time set to midnight.
*
* We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.
* See: https://github.com/angular/angular/issues/40377
*
* Note that this function returns a Date object whose time is midnight in the current locale's
* timezone. In the future we might want to change this to be midnight in UTC, but this would be a
* considerable breaking change.
*/
function createDate(year, month, date) {
// The `newDate` is set to midnight (UTC) on January 1st 1970.
// - In PST this will be December 31st 1969 at 4pm.
// - In GMT this will be January 1st 1970 at 1am.
// Note that they even have different years, dates and months!
const newDate = new Date(0);
// `setFullYear()` allows years like 0001 to be set correctly. This function does not
// change the internal time of the date.
// Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).
// - In PST this will now be September 20, 2019 at 4pm
// - In GMT this will now be September 20, 2019 at 1am
newDate.setFullYear(year, month, date);
// We want the final date to be at local midnight, so we reset the time.
// - In PST this will now be September 20, 2019 at 12am
// - In GMT this will now be September 20, 2019 at 12am
newDate.setHours(0, 0, 0);
return newDate;
}
function getNamedFormat(locale, format) {
const localeId = getLocaleId(locale);
NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};
if (NAMED_FORMATS[localeId][format]) {
return NAMED_FORMATS[localeId][format];
}
let formatValue = '';
switch (format) {
case 'shortDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Short);
break;
case 'mediumDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);
break;
case 'longDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Long);
break;
case 'fullDate':
formatValue = getLocaleDateFormat(locale, FormatWidth.Full);
break;
case 'shortTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);
break;
case 'mediumTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);
break;
case 'longTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);
break;
case 'fullTime':
formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);
break;
case 'short':
const shortTime = getNamedFormat(locale, 'shortTime');
const shortDate = getNamedFormat(locale, 'shortDate');
formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);
break;
case 'medium':
const mediumTime = getNamedFormat(locale, 'mediumTime');
const mediumDate = getNamedFormat(locale, 'mediumDate');
formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);
break;
case 'long':
const longTime = getNamedFormat(locale, 'longTime');
const longDate = getNamedFormat(locale, 'longDate');
formatValue =
formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);
break;
case 'full':
const fullTime = getNamedFormat(locale, 'fullTime');
const fullDate = getNamedFormat(locale, 'fullDate');
formatValue =
formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);
break;
}
if (formatValue) {
NAMED_FORMATS[localeId][format] = formatValue;
}
return formatValue;
}
function formatDateTime(str, opt_values) {
if (opt_values) {
str = str.replace(/\{([^}]+)}/g, function (match, key) {
return (opt_values != null && key in opt_values) ? opt_values[key] : match;
});
}
return str;
}
function padNumber(num, digits, minusSign = '-', trim, negWrap) {
let neg = '';
if (num < 0 || (negWrap && num <= 0)) {
if (negWrap) {
num = -num + 1;
}
else {
num = -num;
neg = minusSign;
}
}
let strNum = String(num);
while (strNum.length < digits) {
strNum = '0' + strNum;
}
if (trim) {
strNum = strNum.substr(strNum.length - digits);
}
return neg + strNum;
}
function formatFractionalSeconds(milliseconds, digits) {
const strMs = padNumber(milliseconds, 3);
return strMs.substr(0, digits);
}
/**
* Returns a date formatter that transforms a date into its locale digit representation
*/
function dateGetter(name, size, offset = 0, trim = false, negWrap = false) {
return function (date, locale) {
let part = getDatePart(name, date);
if (offset > 0 || part > -offset) {
part += offset;
}
if (name === DateType.Hours) {
if (part === 0 && offset === -12) {
part = 12;
}
}
else if (name === DateType.FractionalSeconds) {
return formatFractionalSeconds(part, size);
}
const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
return padNumber(part, size, localeMinus, trim, negWrap);
};
}
function getDatePart(part, date) {
switch (part) {
case DateType.FullYear:
return date.getFullYear();
case DateType.Month:
return date.getMonth();
case DateType.Date:
return date.getDate();
case DateType.Hours:
return date.getHours();
case DateType.Minutes:
return date.getMinutes();
case DateType.Seconds:
return date.getSeconds();
case DateType.FractionalSeconds:
return date.getMilliseconds();
case DateType.Day:
return date.getDay();
default:
throw new Error(`Unknown DateType value "${part}".`);
}
}
/**
* Returns a date formatter that transforms a date into its locale string representation
*/
function dateStrGetter(name, width, form = FormStyle.Format, extended = false) {
return function (date, locale) {
return getDateTranslation(date, locale, name, width, form, extended);
};
}
/**
* Returns the locale translation of a date for a given form, type and width
*/
function getDateTranslation(date, locale, name, width, form, extended) {
switch (name) {
case TranslationType.Months:
return getLocaleMonthNames(locale, form, width)[date.getMonth()];
case TranslationType.Days:
return getLocaleDayNames(locale, form, width)[date.getDay()];
case TranslationType.DayPeriods:
const currentHours = date.getHours();
const currentMinutes = date.getMinutes();
if (extended) {
const rules = getLocaleExtraDayPeriodRules(locale);
const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);
const index = rules.findIndex(rule => {
if (Array.isArray(rule)) {
// morning, afternoon, evening, night
const [from, to] = rule;
const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;
const beforeTo = (currentHours < to.hours ||
(currentHours === to.hours && currentMinutes < to.minutes));
// We must account for normal rules that span a period during the day (e.g. 6am-9am)
// where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.
// 10pm - 5am) where `from` is greater (later!) than `to`.
//
// In the first case the current time must be BOTH after `from` AND before `to`
// (e.g. 8am is after 6am AND before 10am).
//
// In the second case the current time must be EITHER after `from` OR before `to`
// (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is
// after 10pm).
if (from.hours < to.hours) {
if (afterFrom && beforeTo) {
return true;
}
}
else if (afterFrom || beforeTo) {
return true;
}
}
else { // noon or midnight
if (rule.hours === currentHours && rule.minutes === currentMinutes) {
return true;
}
}
return false;
});
if (index !== -1) {
return dayPeriods[index];
}
}
// if no rules for the day periods, we use am/pm by default
return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];
case TranslationType.Eras:
return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];
default:
// This default case is not needed by TypeScript compiler, as the switch is exhaustive.
// However Closure Compiler does not understand that and reports an error in typed mode.
// The `throw new Error` below works around the problem, and the unexpected: never variable
// makes sure tsc still checks this code is unreachable.
const unexpected = name;
throw new Error(`unexpected translation type ${unexpected}`);
}
}
/**
* Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or
* GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,
* extended = +04:30)
*/
function timeZoneGetter(width) {
return function (date, locale, offset) {
const zone = -1 * offset;
const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);
const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);
switch (width) {
case ZoneWidth.Short:
return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +
padNumber(Math.abs(zone % 60), 2, minusSign);
case ZoneWidth.ShortGMT:
return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);
case ZoneWidth.Long:
return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +
padNumber(Math.abs(zone % 60), 2, minusSign);
case ZoneWidth.Extended:
if (offset === 0) {
return 'Z';
}
else {
return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +
padNumber(Math.abs(zone % 60), 2, minusSign);
}
default:
throw new Error(`Unknown zone width "${width}"`);
}
};
}
const JANUARY = 0;
const THURSDAY = 4;
function getFirstThursdayOfYear(year) {
const firstDayOfYear = createDate(year, JANUARY, 1).getDay();
return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);
}
function getThursdayThisWeek(datetime) {
return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));
}
function weekGetter(size, monthBased = false) {
return function (date, locale) {
let result;
if (monthBased) {
const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;
const today = date.getDate();
result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);
}
else {
const thisThurs = getThursdayThisWeek(date);
// Some days of a year are part of next year according to ISO 8601.
// Compute the firstThurs from the year of this week's Thursday
const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());
const diff = thisThurs.getTime() - firstThurs.getTime();
result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week
}
return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
};
}
/**
* Returns a date formatter that provides the week-numbering year for the input date.
*/
function weekNumberingYearGetter(size, trim = false) {
return function (date, locale) {
const thisThurs = getThursdayThisWeek(date);
const weekNumberingYear = thisThurs.getFullYear();
return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);
};
}
const DATE_FORMATS = {};
// Based on CLDR formats:
// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table
// See also explanations: http://cldr.unicode.org/translation/date-time
// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x
function getDateFormatter(format) {
if (DATE_FORMATS[format]) {
return DATE_FORMATS[format];
}
let formatter;
switch (format) {
// Era name (AD/BC)
case 'G':
case 'GG':
case 'GGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);
break;
case 'GGGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);
break;
case 'GGGGG':
formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);
break;
// 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)
case 'y':
formatter = dateGetter(DateType.FullYear, 1, 0, false, true);
break;
// 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)
case 'yy':
formatter = dateGetter(DateType.FullYear, 2, 0, true, true);
break;
// 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)
case 'yyy':
formatter = dateGetter(DateType.FullYear, 3, 0, false, true);
break;
// 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)
case 'yyyy':
formatter = dateGetter(DateType.FullYear, 4, 0, false, true);
break;
// 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)
case 'Y':
formatter = weekNumberingYearGetter(1);
break;
// 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD
// 2010 => 10)
case 'YY':
formatter = weekNumberingYearGetter(2, true);
break;
// 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD
// 2010 => 2010)
case 'YYY':
formatter = weekNumberingYearGetter(3);
break;
// 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)
case 'YYYY':
formatter = weekNumberingYearGetter(4);
break;
// Month of the year (1-12), numeric
case 'M':
case 'L':
formatter = dateGetter(DateType.Month, 1, 1);
break;
case 'MM':
case 'LL':
formatter = dateGetter(DateType.Month, 2, 1);
break;
// Month of the year (January, ...), string, format
case 'MMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);
break;
case 'MMMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);
break;
case 'MMMMM':
formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);
break;
// Month of the year (January, ...), string, standalone
case 'LLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);
break;
case 'LLLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);
break;
case 'LLLLL':
formatter =
dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);
break;
// Week of the year (1, ... 52)
case 'w':
formatter = weekGetter(1);
break;
case 'ww':
formatter = weekGetter(2);
break;
// Week of the month (1, ...)
case 'W':
formatter = weekGetter(1, true);
break;
// Day of the month (1-31)
case 'd':
formatter = dateGetter(DateType.Date, 1);
break;
case 'dd':
formatter = dateGetter(DateType.Date, 2);
break;
// Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)
case 'c':
case 'cc':
formatter = dateGetter(DateType.Day, 1);
break;
case 'ccc':
formatter =
dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);
break;
case 'cccc':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);
break;
case 'ccccc':
formatter =
dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);
break;
case 'cccccc':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);
break;
// Day of the Week
case 'E':
case 'EE':
case 'EEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);
break;
case 'EEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);
break;
case 'EEEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);
break;
case 'EEEEEE':
formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);
break;
// Generic period of the day (am-pm)
case 'a':
case 'aa':
case 'aaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);
break;
case 'aaaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);
break;
case 'aaaaa':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);
break;
// Extended period of the day (midnight, at night, ...), standalone
case 'b':
case 'bb':
case 'bbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);
break;
case 'bbbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);
break;
case 'bbbbb':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);
break;
// Extended period of the day (midnight, night, ...), standalone
case 'B':
case 'BB':
case 'BBB':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);
break;
case 'BBBB':
formatter =
dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);
break;
case 'BBBBB':
formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);
break;
// Hour in AM/PM, (1-12)
case 'h':
formatter = dateGetter(DateType.Hours, 1, -12);
break;
case 'hh':
formatter = dateGetter(DateType.Hours, 2, -12);
break;
// Hour of the day (0-23)
case 'H':
formatter = dateGetter(DateType.Hours, 1);
break;
// Hour in day, padded (00-23)
case 'HH':
formatter = dateGetter(DateType.Hours, 2);
break;
// Minute of the hour (0-59)
case 'm':
formatter = dateGetter(DateType.Minutes, 1);
break;
case 'mm':
formatter = dateGetter(DateType.Minutes, 2);
break;
// Second of the minute (0-59)
case 's':
formatter = dateGetter(DateType.Seconds, 1);
break;
case 'ss':
formatter = dateGetter(DateType.Seconds, 2);
break;
// Fractional second
case 'S':
formatter = dateGetter(DateType.FractionalSeconds, 1);
break;
case 'SS':
formatter = dateGetter(DateType.FractionalSeconds, 2);
break;
case 'SSS':
formatter = dateGetter(DateType.FractionalSeconds, 3);
break;
// Timezone ISO8601 short format (-0430)
case 'Z':
case 'ZZ':
case 'ZZZ':
formatter = timeZoneGetter(ZoneWidth.Short);
break;
// Timezone ISO8601 extended format (-04:30)
case 'ZZZZZ':
formatter = timeZoneGetter(ZoneWidth.Extended);
break;
// Timezone GMT short format (GMT+4)
case 'O':
case 'OO':
case 'OOO':
// Should be location, but fallback to format O instead because we don't have the data yet
case 'z':
case 'zz':
case 'zzz':
formatter = timeZoneGetter(ZoneWidth.ShortGMT);
break;
// Timezone GMT long format (GMT+0430)
case 'OOOO':
case 'ZZZZ':
// Should be location, but fallback to format O instead because we don't have the data yet
case 'zzzz':
formatter = timeZoneGetter(ZoneWidth.Long);
break;
default:
return null;
}
DATE_FORMATS[format] = formatter;
return formatter;
}
function timezoneToOffset(timezone, fallback) {
// Support: IE 11 only, Edge 13-15+
// IE/Edge do not "understand" colon (`:`) in timezone
timezone = timezone.replace(/:/g, '');
const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;
return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;
}
function addDateMinutes(date, minutes) {
date = new Date(date.getTime());
date.setMinutes(date.getMinutes() + minutes);
return date;
}
function convertTimezoneToLocal(date, timezone, reverse) {
const reverseValue = reverse ? -1 : 1;
const dateTimezoneOffset = date.getTimezoneOffset();
const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);
return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));
}
/**
* Converts a value to date.
*
* Supported input formats:
* - `Date`
* - number: timestamp
* - string: numeric (e.g. "1234"), ISO and date strings in a format supported by
* [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).
* Note: ISO strings without time return a date without timeoffset.
*
* Throws if unable to convert to a date.
*/
function toDate(value) {
if (isDate(value)) {
return value;
}
if (typeof value === 'number' && !isNaN(value)) {
return new Date(value);
}
if (typeof value === 'string') {
value = value.trim();
if (/^(\d{4}(-\d{1,2}(-\d{1,2})?)?)$/.test(value)) {
/* For ISO Strings without time the day, month and year must be extracted from the ISO String
before Date creation to avoid time offset and errors in the new Date.
If we only replace '-' with ',' in the ISO String ("2015,01,01"), and try to create a new
date, some browsers (e.g. IE 9) will throw an invalid Date error.
If we leave the '-' ("2015-01-01") and try to create a new Date("2015-01-01") the timeoffset
is applied.
Note: ISO months are 0 for January, 1 for February, ... */
const [y, m = 1, d = 1] = value.split('-').map((val) => +val);
return createDate(y, m - 1, d);
}
const parsedNb = parseFloat(value);
// any string that only contains numbers, like "1234" but not like "1234hello"
if (!isNaN(value - parsedNb)) {
return new Date(parsedNb);
}
let match;
if (match = value.match(ISO8601_DATE_REGEX)) {
return isoStringToDate(match);
}
}
const date = new Date(value);
if (!isDate(date)) {
throw new Error(`Unable to convert "${value}" into a date`);
}
return date;
}
/**
* Converts a date in ISO8601 to a Date.
* Used instead of `Date.parse` because of browser discrepancies.
*/
function isoStringToDate(match) {
const date = new Date(0);
let tzHour = 0;
let tzMin = 0;
// match[8] means that the string contains "Z" (UTC) or a timezone like "+01:00" or "+0100"
const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;
const timeSetter = match[8] ? date.setUTCHours : date.setHours;
// if there is a timezone defined like "+01:00" or "+0100"
if (match[9]) {
tzHour = Number(match[9] + match[10]);
tzMin = Number(match[9] + match[11]);
}
dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));
const h = Number(match[4] || 0) - tzHour;
const m = Number(match[5] || 0) - tzMin;
const s = Number(match[6] || 0);
// The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)
// defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`
// becomes `999ms`.
const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);
timeSetter.call(date, h, m, s, ms);
return date;
}
function isDate(value) {
return value instanceof Date && !isNaN(value.valueOf());
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const NUMBER_FORMAT_REGEXP = /^(\d+)?\.((\d+)(-(\d+))?)?$/;
const MAX_DIGITS = 22;
const DECIMAL_SEP = '.';
const ZERO_CHAR = '0';
const PATTERN_SEP = ';';
const GROUP_SEP = ',';
const DIGIT_CHAR = '#';
const CURRENCY_CHAR = '¤';
const PERCENT_CHAR = '%';
/**
* Transforms a number to a locale string based on a style and a format.
*/
function formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {
let formattedText = '';
let isZero = false;
if (!isFinite(value)) {
formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);
}
else {
let parsedNumber = parseNumber(value);
if (isPercent) {
parsedNumber = toPercent(parsedNumber);
}
let minInt = pattern.minInt;
let minFraction = pattern.minFrac;
let maxFraction = pattern.maxFrac;
if (digitsInfo) {
const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);
if (parts === null) {
throw new Error(`${digitsInfo} is not a valid digit info`);
}
const minIntPart = parts[1];
const minFractionPart = parts[3];
const maxFractionPart = parts[5];
if (minIntPart != null) {
minInt = parseIntAutoRadix(minIntPart);
}
if (minFractionPart != null) {
minFraction = parseIntAutoRadix(minFractionPart);
}
if (maxFractionPart != null) {
maxFraction = parseIntAutoRadix(maxFractionPart);
}
else if (minFractionPart != null && minFraction > maxFraction) {
maxFraction = minFraction;
}
}
roundNumber(parsedNumber, minFraction, maxFraction);
let digits = parsedNumber.digits;
let integerLen = parsedNumber.integerLen;
const exponent = parsedNumber.exponent;
let decimals = [];
isZero = digits.every(d => !d);
// pad zeros for small numbers
for (; integerLen < minInt; integerLen++) {
digits.unshift(0);
}
// pad zeros for small numbers
for (; integerLen < 0; integerLen++) {
digits.unshift(0);
}
// extract decimals digits
if (integerLen > 0) {
decimals = digits.splice(integerLen, digits.length);
}
else {
decimals = digits;
digits = [0];
}
// format the integer digits with grouping separators
const groups = [];
if (digits.length >= pattern.lgSize) {
groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));
}
while (digits.length > pattern.gSize) {
groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));
}
if (digits.length) {
groups.unshift(digits.join(''));
}
formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));
// append the decimal digits
if (decimals.length) {
formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');
}
if (exponent) {
formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;
}
}
if (value < 0 && !isZero) {
formattedText = pattern.negPre + formattedText + pattern.negSuf;
}
else {
formattedText = pattern.posPre + formattedText + pattern.posSuf;
}
return formattedText;
}
/**
* @ngModule CommonModule
* @description
*
* Formats a number as currency using locale rules.
*
* @param value The number to format.
* @param locale A locale code for the locale format rules to use.
* @param currency A string containing the currency symbol or its name,
* such as "$" or "Canadian Dollar". Used in output string, but does not affect the operation
* of the function.
* @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)
* currency code, such as `USD` for the US dollar and `EUR` for the euro.
* Used to determine the number of digits in the decimal part.
* @param digitsInfo Decimal representation options, specified by a string in the following format:
* `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.
*
* @returns The formatted currency value.
*
* @see `formatNumber()`
* @see `DecimalPipe`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function formatCurrency(value, locale, currency, currencyCode, digitsInfo) {
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);
pattern.maxFrac = pattern.minFrac;
const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);
return res
.replace(CURRENCY_CHAR, currency)
// if we have 2 time the currency character, the second one is ignored
.replace(CURRENCY_CHAR, '')
// If there is a spacing between currency character and the value and
// the currency character is supressed by passing an empty string, the
// spacing character would remain as part of the string. Then we
// should remove it.
.trim();
}
/**
* @ngModule CommonModule
* @description
*
* Formats a number as a percentage according to locale rules.
*
* @param value The number to format.
* @param locale A locale code for the locale format rules to use.
* @param digitsInfo Decimal representation options, specified by a string in the following format:
* `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.
*
* @returns The formatted percentage value.
*
* @see `formatNumber()`
* @see `DecimalPipe`
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
* @publicApi
*
*/
function formatPercent(value, locale, digitsInfo) {
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);
return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));
}
/**
* @ngModule CommonModule
* @description
*
* Formats a number as text, with group sizing, separator, and other
* parameters based on the locale.
*
* @param value The number to format.
* @param locale A locale code for the locale format rules to use.
* @param digitsInfo Decimal representation options, specified by a string in the following format:
* `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.
*
* @returns The formatted text string.
* @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n)
*
* @publicApi
*/
function formatNumber(value, locale, digitsInfo) {
const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);
const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));
return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);
}
function parseNumberFormat(format, minusSign = '-') {
const p = {
minInt: 1,
minFrac: 0,
maxFrac: 0,
posPre: '',
posSuf: '',
negPre: '',
negSuf: '',
gSize: 0,
lgSize: 0
};
const patternParts = format.split(PATTERN_SEP);
const positive = patternParts[0];
const negative = patternParts[1];
const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?
positive.split(DECIMAL_SEP) :
[
positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),
positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)
], integer = positiveParts[0], fraction = positiveParts[1] || '';
p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR));
for (let i = 0; i < fraction.length; i++) {
const ch = fraction.charAt(i);
if (ch === ZERO_CHAR) {
p.minFrac = p.maxFrac = i + 1;
}
else if (ch === DIGIT_CHAR) {
p.maxFrac = i + 1;
}
else {
p.posSuf += ch;
}
}
const groups = integer.split(GROUP_SEP);
p.gSize = groups[1] ? groups[1].length : 0;
p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;
if (negative) {
const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);
p.negPre = negative.substr(0, pos).replace(/'/g, '');
p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, '');
}
else {
p.negPre = minusSign + p.posPre;
p.negSuf = p.posSuf;
}
return p;
}
// Transforms a parsed number into a percentage by multiplying it by 100
function toPercent(parsedNumber) {
// if the number is 0, don't do anything
if (parsedNumber.digits[0] === 0) {
return parsedNumber;
}
// Getting the current number of decimals
const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;
if (parsedNumber.exponent) {
parsedNumber.exponent += 2;
}
else {
if (fractionLen === 0) {
parsedNumber.digits.push(0, 0);
}
else if (fractionLen === 1) {
parsedNumber.digits.push(0);
}
parsedNumber.integerLen += 2;
}
return parsedNumber;
}
/**
* Parses a number.
* Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/
*/
function parseNumber(num) {
let numStr = Math.abs(num) + '';
let exponent = 0, digits, integerLen;
let i, j, zeros;
// Decimal point?
if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {
numStr = numStr.replace(DECIMAL_SEP, '');
}
// Exponential form?
if ((i = numStr.search(/e/i)) > 0) {
// Work out the exponent.
if (integerLen < 0)
integerLen = i;
integerLen += +numStr.slice(i + 1);
numStr = numStr.substring(0, i);
}
else if (integerLen < 0) {
// There was no decimal point or exponent so it is an integer.
integerLen = numStr.length;
}
// Count the number of leading zeros.
for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */
}
if (i === (zeros = numStr.length)) {
// The digits are all zero.
digits = [0];
integerLen = 1;
}
else {
// Count the number of trailing zeros
zeros--;
while (numStr.charAt(zeros) === ZERO_CHAR)
zeros--;
// Trailing zeros are insignificant so ignore them
integerLen -= i;
digits = [];
// Convert string to array of digits without leading/trailing zeros.
for (j = 0; i <= zeros; i++, j++) {
digits[j] = Number(numStr.charAt(i));
}
}
// If the number overflows the maximum allowed digits then use an exponent.
if (integerLen > MAX_DIGITS) {
digits = digits.splice(0, MAX_DIGITS - 1);
exponent = integerLen - 1;
integerLen = 1;
}
return { digits, exponent, integerLen };
}
/**
* Round the parsed number to the specified number of decimal places
* This function changes the parsedNumber in-place
*/
function roundNumber(parsedNumber, minFrac, maxFrac) {
if (minFrac > maxFrac) {
throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);
}
let digits = parsedNumber.digits;
let fractionLen = digits.length - parsedNumber.integerLen;
const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);
// The index of the digit to where rounding is to occur
let roundAt = fractionSize + parsedNumber.integerLen;
let digit = digits[roundAt];
if (roundAt > 0) {
// Drop fractional digits beyond `roundAt`
digits.splice(Math.max(parsedNumber.integerLen, roundAt));
// Set non-fractional digits beyond `roundAt` to 0
for (let j = roundAt; j < digits.length; j++) {
digits[j] = 0;
}
}
else {
// We rounded to zero so reset the parsedNumber
fractionLen = Math.max(0, fractionLen);
parsedNumber.integerLen = 1;
digits.length = Math.max(1, roundAt = fractionSize + 1);
digits[0] = 0;
for (let i = 1; i < roundAt; i++)
digits[i] = 0;
}
if (digit >= 5) {
if (roundAt - 1 < 0) {
for (let k = 0; k > roundAt; k--) {
digits.unshift(0);
parsedNumber.integerLen++;
}
digits.unshift(1);
parsedNumber.integerLen++;
}
else {
digits[roundAt - 1]++;
}
}
// Pad out with zeros to get the required fraction length
for (; fractionLen < Math.max(0, fractionSize); fractionLen++)
digits.push(0);
let dropTrailingZeros = fractionSize !== 0;
// Minimal length = nb of decimals required + current nb of integers
// Any number besides that is optional and can be removed if it's a trailing 0
const minLen = minFrac + parsedNumber.integerLen;
// Do any carrying, e.g. a digit was rounded up to 10
const carry = digits.reduceRight(function (carry, d, i, digits) {
d = d + carry;
digits[i] = d < 10 ? d : d - 10; // d % 10
if (dropTrailingZeros) {
// Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)
if (digits[i] === 0 && i >= minLen) {
digits.pop();
}
else {
dropTrailingZeros = false;
}
}
return d >= 10 ? 1 : 0; // Math.floor(d / 10);
}, 0);
if (carry) {
digits.unshift(carry);
parsedNumber.integerLen++;
}
}
function parseIntAutoRadix(text) {
const result = parseInt(text);
if (isNaN(result)) {
throw new Error('Invalid integer literal when parsing ' + text);
}
return result;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @publicApi
*/
class NgLocalization {
}
/**
* Returns the plural category for a given value.
* - "=value" when the case exists,
* - the plural category otherwise
*/
function getPluralCategory(value, cases, ngLocalization, locale) {
let key = `=${value}`;
if (cases.indexOf(key) > -1) {
return key;
}
key = ngLocalization.getPluralCategory(value, locale);
if (cases.indexOf(key) > -1) {
return key;
}
if (cases.indexOf('other') > -1) {
return 'other';
}
throw new Error(`No plural message found for value "${value}"`);
}
/**
* Returns the plural case based on the locale
*
* @publicApi
*/
class NgLocaleLocalization extends NgLocalization {
constructor(locale) {
super();
this.locale = locale;
}
getPluralCategory(value, locale) {
const plural = getLocalePluralCase(locale || this.locale)(value);
switch (plural) {
case Plural.Zero:
return 'zero';
case Plural.One:
return 'one';
case Plural.Two:
return 'two';
case Plural.Few:
return 'few';
case Plural.Many:
return 'many';
default:
return 'other';
}
}
}
NgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) { return new (t || NgLocaleLocalization)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID)); };
NgLocaleLocalization.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: NgLocaleLocalization, factory: NgLocaleLocalization.ɵfac });
NgLocaleLocalization.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgLocaleLocalization, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Injectable
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID]
}] }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Register global data to be used internally by Angular. See the
* ["I18n guide"](guide/i18n#i18n-pipes) to know how to import additional locale data.
*
* The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1
*
* @publicApi
*/
function registerLocaleData(data, localeId, extraData) {
return (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵregisterLocaleData"])(data, localeId, extraData);
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
function parseCookieValue(cookieStr, name) {
name = encodeURIComponent(name);
for (const cookie of cookieStr.split(';')) {
const eqIndex = cookie.indexOf('=');
const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];
if (cookieName.trim() === name) {
return decodeURIComponent(cookieValue);
}
}
return null;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
*
* @usageNotes
* ```
* ...
*
* ...
*
* ...
*
* ...
*
* ...
* ```
*
* @description
*
* Adds and removes CSS classes on an HTML element.
*
* The CSS classes are updated as follows, depending on the type of the expression evaluation:
* - `string` - the CSS classes listed in the string (space delimited) are added,
* - `Array` - the CSS classes declared as Array elements are added,
* - `Object` - keys are CSS classes that get added when the expression given in the value
* evaluates to a truthy value, otherwise they are removed.
*
* @publicApi
*/
class NgClass {
constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {
this._iterableDiffers = _iterableDiffers;
this._keyValueDiffers = _keyValueDiffers;
this._ngEl = _ngEl;
this._renderer = _renderer;
this._iterableDiffer = null;
this._keyValueDiffer = null;
this._initialClasses = [];
this._rawClass = null;
}
set klass(value) {
this._removeClasses(this._initialClasses);
this._initialClasses = typeof value === 'string' ? value.split(/\s+/) : [];
this._applyClasses(this._initialClasses);
this._applyClasses(this._rawClass);
}
set ngClass(value) {
this._removeClasses(this._rawClass);
this._applyClasses(this._initialClasses);
this._iterableDiffer = null;
this._keyValueDiffer = null;
this._rawClass = typeof value === 'string' ? value.split(/\s+/) : value;
if (this._rawClass) {
if ((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisListLikeIterable"])(this._rawClass)) {
this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create();
}
else {
this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create();
}
}
}
ngDoCheck() {
if (this._iterableDiffer) {
const iterableChanges = this._iterableDiffer.diff(this._rawClass);
if (iterableChanges) {
this._applyIterableChanges(iterableChanges);
}
}
else if (this._keyValueDiffer) {
const keyValueChanges = this._keyValueDiffer.diff(this._rawClass);
if (keyValueChanges) {
this._applyKeyValueChanges(keyValueChanges);
}
}
}
_applyKeyValueChanges(changes) {
changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue));
changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue));
changes.forEachRemovedItem((record) => {
if (record.previousValue) {
this._toggleClass(record.key, false);
}
});
}
_applyIterableChanges(changes) {
changes.forEachAddedItem((record) => {
if (typeof record.item === 'string') {
this._toggleClass(record.item, true);
}
else {
throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${(0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(record.item)}`);
}
});
changes.forEachRemovedItem((record) => this._toggleClass(record.item, false));
}
/**
* Applies a collection of CSS classes to the DOM element.
*
* For argument of type Set and Array CSS class names contained in those collections are always
* added.
* For argument of type Map CSS class name in the map's key is toggled based on the value (added
* for truthy and removed for falsy).
*/
_applyClasses(rawClassVal) {
if (rawClassVal) {
if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {
rawClassVal.forEach((klass) => this._toggleClass(klass, true));
}
else {
Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass]));
}
}
}
/**
* Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup
* purposes.
*/
_removeClasses(rawClassVal) {
if (rawClassVal) {
if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) {
rawClassVal.forEach((klass) => this._toggleClass(klass, false));
}
else {
Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false));
}
}
}
_toggleClass(klass, enabled) {
klass = klass.trim();
if (klass) {
klass.split(/\s+/g).forEach(klass => {
if (enabled) {
this._renderer.addClass(this._ngEl.nativeElement, klass);
}
else {
this._renderer.removeClass(this._ngEl.nativeElement, klass);
}
});
}
}
}
NgClass.ɵfac = function NgClass_Factory(t) { return new (t || NgClass)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2)); };
NgClass.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgClass, selectors: [["", "ngClass", ""]], inputs: { klass: ["class", "klass"], ngClass: "ngClass" } });
NgClass.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2 }
];
NgClass.propDecorators = {
klass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input, args: ['class',] }],
ngClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input, args: ['ngClass',] }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgClass, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngClass]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2 }]; }, { klass: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input,
args: ['class']
}], ngClass: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input,
args: ['ngClass']
}] }); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Instantiates a single {@link Component} type and inserts its Host View into current View.
* `NgComponentOutlet` provides a declarative approach for dynamic component creation.
*
* `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and
* any existing component will get destroyed.
*
* @usageNotes
*
* ### Fine tune control
*
* You can control the component creation process by using the following optional attributes:
*
* * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for
* the Component. Defaults to the injector of the current view container.
*
* * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content
* section of the component, if exists.
*
* * `ngComponentOutletNgModuleFactory`: Optional module factory to allow dynamically loading other
* module, then load a component from that module.
*
* ### Syntax
*
* Simple
* ```
*
* ```
*
* Customized injector/content
* ```
*
*
* ```
*
* Customized ngModuleFactory
* ```
*
*
* ```
*
* ### A simple example
*
* {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}
*
* A more complete example with additional options:
*
* {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}
*
* @publicApi
* @ngModule CommonModule
*/
class NgComponentOutlet {
constructor(_viewContainerRef) {
this._viewContainerRef = _viewContainerRef;
this._componentRef = null;
this._moduleRef = null;
}
ngOnChanges(changes) {
this._viewContainerRef.clear();
this._componentRef = null;
if (this.ngComponentOutlet) {
const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;
if (changes['ngComponentOutletNgModuleFactory']) {
if (this._moduleRef)
this._moduleRef.destroy();
if (this.ngComponentOutletNgModuleFactory) {
const parentModule = elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__.NgModuleRef);
this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector);
}
else {
this._moduleRef = null;
}
}
const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver :
elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__.ComponentFactoryResolver);
const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet);
this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent);
}
}
ngOnDestroy() {
if (this._moduleRef)
this._moduleRef.destroy();
}
}
NgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) { return new (t || NgComponentOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef)); };
NgComponentOutlet.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgComponentOutlet, selectors: [["", "ngComponentOutlet", ""]], inputs: { ngComponentOutlet: "ngComponentOutlet", ngComponentOutletInjector: "ngComponentOutletInjector", ngComponentOutletContent: "ngComponentOutletContent", ngComponentOutletNgModuleFactory: "ngComponentOutletNgModuleFactory" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] });
NgComponentOutlet.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }
];
NgComponentOutlet.propDecorators = {
ngComponentOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngComponentOutletInjector: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngComponentOutletContent: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngComponentOutletNgModuleFactory: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgComponentOutlet, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngComponentOutlet]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }]; }, { ngComponentOutlet: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngComponentOutletInjector: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngComponentOutletContent: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngComponentOutletNgModuleFactory: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @publicApi
*/
class NgForOfContext {
constructor($implicit, ngForOf, index, count) {
this.$implicit = $implicit;
this.ngForOf = ngForOf;
this.index = index;
this.count = count;
}
get first() {
return this.index === 0;
}
get last() {
return this.index === this.count - 1;
}
get even() {
return this.index % 2 === 0;
}
get odd() {
return !this.even;
}
}
/**
* A [structural directive](guide/structural-directives) that renders
* a template for each item in a collection.
* The directive is placed on an element, which becomes the parent
* of the cloned templates.
*
* The `ngForOf` directive is generally used in the
* [shorthand form](guide/structural-directives#asterisk) `*ngFor`.
* In this form, the template to be rendered for each iteration is the content
* of an anchor element containing the directive.
*
* The following example shows the shorthand syntax with some options,
* contained in an `
` element.
*
* ```
*
...
* ```
*
* The shorthand form expands into a long form that uses the `ngForOf` selector
* on an `` element.
* The content of the `` element is the `
` element that held the
* short-form directive.
*
* Here is the expanded version of the short-form example.
*
* ```
*
*
...
*
* ```
*
* Angular automatically expands the shorthand syntax as it compiles the template.
* The context for each embedded view is logically merged to the current component
* context according to its lexical position.
*
* When using the shorthand syntax, Angular allows only [one structural directive
* on an element](guide/built-in-directives#one-per-element).
* If you want to iterate conditionally, for example,
* put the `*ngIf` on a container element that wraps the `*ngFor` element.
* For futher discussion, see
* [Structural Directives](guide/built-in-directives#one-per-element).
*
* @usageNotes
*
* ### Local variables
*
* `NgForOf` provides exported values that can be aliased to local variables.
* For example:
*
* ```
*
* {{i}}/{{users.length}}. {{user}} default
*
* ```
*
* The following exported values can be aliased to local variables:
*
* - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).
* - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is
* more complex then a property access, for example when using the async pipe (`userStreams |
* async`).
* - `index: number`: The index of the current item in the iterable.
* - `count: number`: The length of the iterable.
* - `first: boolean`: True when the item is the first item in the iterable.
* - `last: boolean`: True when the item is the last item in the iterable.
* - `even: boolean`: True when the item has an even index in the iterable.
* - `odd: boolean`: True when the item has an odd index in the iterable.
*
* ### Change propagation
*
* When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:
*
* * When an item is added, a new instance of the template is added to the DOM.
* * When an item is removed, its template instance is removed from the DOM.
* * When items are reordered, their respective templates are reordered in the DOM.
*
* Angular uses object identity to track insertions and deletions within the iterator and reproduce
* those changes in the DOM. This has important implications for animations and any stateful
* controls that are present, such as `` elements that accept user input. Inserted rows can
* be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state
* such as user input.
* For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).
*
* The identities of elements in the iterator can change while the data does not.
* This can happen, for example, if the iterator is produced from an RPC to the server, and that
* RPC is re-run. Even if the data hasn't changed, the second response produces objects with
* different identities, and Angular must tear down the entire DOM and rebuild it (as if all old
* elements were deleted and all new elements inserted).
*
* To avoid this expensive operation, you can customize the default tracking algorithm.
* by supplying the `trackBy` option to `NgForOf`.
* `trackBy` takes a function that has two arguments: `index` and `item`.
* If `trackBy` is given, Angular tracks changes by the return value of the function.
*
* @see [Structural Directives](guide/structural-directives)
* @ngModule CommonModule
* @publicApi
*/
class NgForOf {
constructor(_viewContainer, _template, _differs) {
this._viewContainer = _viewContainer;
this._template = _template;
this._differs = _differs;
this._ngForOf = null;
this._ngForOfDirty = true;
this._differ = null;
}
/**
* The value of the iterable expression, which can be used as a
* [template input variable](guide/structural-directives#shorthand).
*/
set ngForOf(ngForOf) {
this._ngForOf = ngForOf;
this._ngForOfDirty = true;
}
/**
* A function that defines how to track changes for items in the iterable.
*
* When items are added, moved, or removed in the iterable,
* the directive must re-render the appropriate DOM nodes.
* To minimize churn in the DOM, only nodes that have changed
* are re-rendered.
*
* By default, the change detector assumes that
* the object instance identifies the node in the iterable.
* When this function is supplied, the directive uses
* the result of calling this function to identify the item node,
* rather than the identity of the object itself.
*
* The function receives two inputs,
* the iteration index and the associated node data.
*/
set ngForTrackBy(fn) {
if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {
// TODO(vicb): use a log service once there is a public one available
if (console && console.warn) {
console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +
`See https://angular.io/api/common/NgForOf#change-propagation for more information.`);
}
}
this._trackByFn = fn;
}
get ngForTrackBy() {
return this._trackByFn;
}
/**
* A reference to the template that is stamped out for each item in the iterable.
* @see [template reference variable](guide/template-reference-variables)
*/
set ngForTemplate(value) {
// TODO(TS2.1): make TemplateRef>> once we move to TS v2.1
// The current type is too restrictive; a template that just uses index, for example,
// should be acceptable.
if (value) {
this._template = value;
}
}
/**
* Applies the changes when needed.
*/
ngDoCheck() {
if (this._ngForOfDirty) {
this._ngForOfDirty = false;
// React on ngForOf changes only once all inputs have been initialized
const value = this._ngForOf;
if (!this._differ && value) {
try {
this._differ = this._differs.find(value).create(this.ngForTrackBy);
}
catch (_a) {
throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`);
}
}
}
if (this._differ) {
const changes = this._differ.diff(this._ngForOf);
if (changes)
this._applyChanges(changes);
}
}
_applyChanges(changes) {
const insertTuples = [];
changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {
if (item.previousIndex == null) {
// NgForOf is never "null" or "undefined" here because the differ detected
// that a new item needs to be inserted from the iterable. This implies that
// there is an iterable value for "_ngForOf".
const view = this._viewContainer.createEmbeddedView(this._template, new NgForOfContext(null, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);
const tuple = new RecordViewTuple(item, view);
insertTuples.push(tuple);
}
else if (currentIndex == null) {
this._viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);
}
else if (adjustedPreviousIndex !== null) {
const view = this._viewContainer.get(adjustedPreviousIndex);
this._viewContainer.move(view, currentIndex);
const tuple = new RecordViewTuple(item, view);
insertTuples.push(tuple);
}
});
for (let i = 0; i < insertTuples.length; i++) {
this._perViewChange(insertTuples[i].view, insertTuples[i].record);
}
for (let i = 0, ilen = this._viewContainer.length; i < ilen; i++) {
const viewRef = this._viewContainer.get(i);
viewRef.context.index = i;
viewRef.context.count = ilen;
viewRef.context.ngForOf = this._ngForOf;
}
changes.forEachIdentityChange((record) => {
const viewRef = this._viewContainer.get(record.currentIndex);
viewRef.context.$implicit = record.item;
});
}
_perViewChange(view, record) {
view.context.$implicit = record.item;
}
/**
* Asserts the correct type of the context for the template that `NgForOf` will render.
*
* The presence of this method is a signal to the Ivy template type-check compiler that the
* `NgForOf` structural directive renders its template with a specific context type.
*/
static ngTemplateContextGuard(dir, ctx) {
return true;
}
}
NgForOf.ɵfac = function NgForOf_Factory(t) { return new (t || NgForOf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers)); };
NgForOf.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgForOf, selectors: [["", "ngFor", "", "ngForOf", ""]], inputs: { ngForOf: "ngForOf", ngForTrackBy: "ngForTrackBy", ngForTemplate: "ngForTemplate" } });
NgForOf.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers }
];
NgForOf.propDecorators = {
ngForOf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngForTrackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngForTemplate: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgForOf, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngFor][ngForOf]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.IterableDiffers }]; }, { ngForOf: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngForTrackBy: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngForTemplate: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
class RecordViewTuple {
constructor(record, view) {
this.record = record;
this.view = view;
}
}
function getTypeName(type) {
return type['name'] || typeof type;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A structural directive that conditionally includes a template based on the value of
* an expression coerced to Boolean.
* When the expression evaluates to true, Angular renders the template
* provided in a `then` clause, and when false or null,
* Angular renders the template provided in an optional `else` clause. The default
* template for the `else` clause is blank.
*
* A [shorthand form](guide/structural-directives#asterisk) of the directive,
* `*ngIf="condition"`, is generally used, provided
* as an attribute of the anchor element for the inserted template.
* Angular expands this into a more explicit version, in which the anchor element
* is contained in an `` element.
*
* Simple form with shorthand syntax:
*
* ```
*
Content to render when condition is true.
* ```
*
* Simple form with expanded syntax:
*
* ```
*
Content to render when condition is
* true.
* ```
*
* Form with an "else" block:
*
* ```
*
Content to render when condition is true.
* Content to render when condition is false.
* ```
*
* Shorthand form with "then" and "else" blocks:
*
* ```
*
* Content to render when condition is true.
* Content to render when condition is false.
* ```
*
* Form with storing the value locally:
*
* ```
*
{{value}}
* Content to render when value is null.
* ```
*
* @usageNotes
*
* The `*ngIf` directive is most commonly used to conditionally show an inline template,
* as seen in the following example.
* The default `else` template is blank.
*
* {@example common/ngIf/ts/module.ts region='NgIfSimple'}
*
* ### Showing an alternative template using `else`
*
* To display a template when `expression` evaluates to false, use an `else` template
* binding as shown in the following example.
* The `else` binding points to an `` element labeled `#elseBlock`.
* The template can be defined anywhere in the component view, but is typically placed right after
* `ngIf` for readability.
*
* {@example common/ngIf/ts/module.ts region='NgIfElse'}
*
* ### Using an external `then` template
*
* In the previous example, the then-clause template is specified inline, as the content of the
* tag that contains the `ngIf` directive. You can also specify a template that is defined
* externally, by referencing a labeled `` element. When you do this, you can
* change which template to use at runtime, as shown in the following example.
*
* {@example common/ngIf/ts/module.ts region='NgIfThenElse'}
*
* ### Storing a conditional result in a variable
*
* You might want to show a set of properties from the same object. If you are waiting
* for asynchronous data, the object can be undefined.
* In this case, you can use `ngIf` and store the result of the condition in a local
* variable as shown in the following example.
*
* {@example common/ngIf/ts/module.ts region='NgIfAs'}
*
* This code uses only one `AsyncPipe`, so only one subscription is created.
* The conditional statement stores the result of `userStream|async` in the local variable `user`.
* You can then bind the local `user` repeatedly.
*
* The conditional displays the data only if `userStream` returns a value,
* so you don't need to use the
* safe-navigation-operator (`?.`)
* to guard against null values when accessing properties.
* You can display an alternative template while waiting for the data.
*
* ### Shorthand syntax
*
* The shorthand syntax `*ngIf` expands into two separate template specifications
* for the "then" and "else" clauses. For example, consider the following shorthand statement,
* that is meant to show a loading page while waiting for data to be loaded.
*
* ```
*
* ...
*
*
*
*
Loading...
*
* ```
*
* You can see that the "else" clause references the ``
* with the `#loading` label, and the template for the "then" clause
* is provided as the content of the anchor element.
*
* However, when Angular expands the shorthand syntax, it creates
* another `` tag, with `ngIf` and `ngIfElse` directives.
* The anchor element containing the template for the "then" clause becomes
* the content of this unlabeled `` tag.
*
* ```
*
*
* ...
*
*
*
*
*
Loading...
*
* ```
*
* The presence of the implicit template object has implications for the nesting of
* structural directives. For more on this subject, see
* [Structural Directives](https://angular.io/guide/built-in-directives#one-per-element).
*
* @ngModule CommonModule
* @publicApi
*/
class NgIf {
constructor(_viewContainer, templateRef) {
this._viewContainer = _viewContainer;
this._context = new NgIfContext();
this._thenTemplateRef = null;
this._elseTemplateRef = null;
this._thenViewRef = null;
this._elseViewRef = null;
this._thenTemplateRef = templateRef;
}
/**
* The Boolean expression to evaluate as the condition for showing a template.
*/
set ngIf(condition) {
this._context.$implicit = this._context.ngIf = condition;
this._updateView();
}
/**
* A template to show if the condition expression evaluates to true.
*/
set ngIfThen(templateRef) {
assertTemplate('ngIfThen', templateRef);
this._thenTemplateRef = templateRef;
this._thenViewRef = null; // clear previous view if any.
this._updateView();
}
/**
* A template to show if the condition expression evaluates to false.
*/
set ngIfElse(templateRef) {
assertTemplate('ngIfElse', templateRef);
this._elseTemplateRef = templateRef;
this._elseViewRef = null; // clear previous view if any.
this._updateView();
}
_updateView() {
if (this._context.$implicit) {
if (!this._thenViewRef) {
this._viewContainer.clear();
this._elseViewRef = null;
if (this._thenTemplateRef) {
this._thenViewRef =
this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);
}
}
}
else {
if (!this._elseViewRef) {
this._viewContainer.clear();
this._thenViewRef = null;
if (this._elseTemplateRef) {
this._elseViewRef =
this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);
}
}
}
}
/**
* Asserts the correct type of the context for the template that `NgIf` will render.
*
* The presence of this method is a signal to the Ivy template type-check compiler that the
* `NgIf` structural directive renders its template with a specific context type.
*/
static ngTemplateContextGuard(dir, ctx) {
return true;
}
}
NgIf.ɵfac = function NgIf_Factory(t) { return new (t || NgIf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef)); };
NgIf.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgIf, selectors: [["", "ngIf", ""]], inputs: { ngIf: "ngIf", ngIfThen: "ngIfThen", ngIfElse: "ngIfElse" } });
NgIf.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }
];
NgIf.propDecorators = {
ngIf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngIfThen: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngIfElse: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgIf, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngIf]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }]; }, { ngIf: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngIfThen: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngIfElse: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @publicApi
*/
class NgIfContext {
constructor() {
this.$implicit = null;
this.ngIf = null;
}
}
function assertTemplate(property, templateRef) {
const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);
if (!isTemplateRefOrNull) {
throw new Error(`${property} must be a TemplateRef, but received '${(0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(templateRef)}'.`);
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
class SwitchView {
constructor(_viewContainerRef, _templateRef) {
this._viewContainerRef = _viewContainerRef;
this._templateRef = _templateRef;
this._created = false;
}
create() {
this._created = true;
this._viewContainerRef.createEmbeddedView(this._templateRef);
}
destroy() {
this._created = false;
this._viewContainerRef.clear();
}
enforceState(created) {
if (created && !this._created) {
this.create();
}
else if (!created && this._created) {
this.destroy();
}
}
}
/**
* @ngModule CommonModule
*
* @description
* The `[ngSwitch]` directive on a container specifies an expression to match against.
* The expressions to match are provided by `ngSwitchCase` directives on views within the container.
* - Every view that matches is rendered.
* - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.
* - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`
* or `ngSwitchDefault` directive are preserved at the location.
*
* @usageNotes
* Define a container element for the directive, and specify the switch expression
* to match against as an attribute:
*
* ```
*
* ```
*
* Within the container, `*ngSwitchCase` statements specify the match expressions
* as attributes. Include `*ngSwitchDefault` as the final case.
*
* ```
*
* ...
* ...
* ...
*
* ```
*
* ### Usage Examples
*
* The following example shows how to use more than one case to display the same view:
*
* ```
*
*
* ...
* ...
* ...
*
* ...
*
* ```
*
* The following example shows how cases can be nested:
* ```
*
* ...
* ...
* ...
*
*
*
*
*
* ...
*
* ```
*
* @publicApi
* @see `NgSwitchCase`
* @see `NgSwitchDefault`
* @see [Structural Directives](guide/structural-directives)
*
*/
class NgSwitch {
constructor() {
this._defaultUsed = false;
this._caseCount = 0;
this._lastCaseCheckIndex = 0;
this._lastCasesMatched = false;
}
set ngSwitch(newValue) {
this._ngSwitch = newValue;
if (this._caseCount === 0) {
this._updateDefaultCases(true);
}
}
/** @internal */
_addCase() {
return this._caseCount++;
}
/** @internal */
_addDefault(view) {
if (!this._defaultViews) {
this._defaultViews = [];
}
this._defaultViews.push(view);
}
/** @internal */
_matchCase(value) {
const matched = value == this._ngSwitch;
this._lastCasesMatched = this._lastCasesMatched || matched;
this._lastCaseCheckIndex++;
if (this._lastCaseCheckIndex === this._caseCount) {
this._updateDefaultCases(!this._lastCasesMatched);
this._lastCaseCheckIndex = 0;
this._lastCasesMatched = false;
}
return matched;
}
_updateDefaultCases(useDefault) {
if (this._defaultViews && useDefault !== this._defaultUsed) {
this._defaultUsed = useDefault;
for (let i = 0; i < this._defaultViews.length; i++) {
const defaultView = this._defaultViews[i];
defaultView.enforceState(useDefault);
}
}
}
}
NgSwitch.ɵfac = function NgSwitch_Factory(t) { return new (t || NgSwitch)(); };
NgSwitch.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitch, selectors: [["", "ngSwitch", ""]], inputs: { ngSwitch: "ngSwitch" } });
NgSwitch.propDecorators = {
ngSwitch: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitch, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngSwitch]' }]
}], function () { return []; }, { ngSwitch: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @ngModule CommonModule
*
* @description
* Provides a switch case expression to match against an enclosing `ngSwitch` expression.
* When the expressions match, the given `NgSwitchCase` template is rendered.
* If multiple match expressions match the switch expression value, all of them are displayed.
*
* @usageNotes
*
* Within a switch container, `*ngSwitchCase` statements specify the match expressions
* as attributes. Include `*ngSwitchDefault` as the final case.
*
* ```
*
* ...
* ...
* ...
*
* ```
*
* Each switch-case statement contains an in-line HTML template or template reference
* that defines the subtree to be selected if the value of the match expression
* matches the value of the switch expression.
*
* Unlike JavaScript, which uses strict equality, Angular uses loose equality.
* This means that the empty string, `""` matches 0.
*
* @publicApi
* @see `NgSwitch`
* @see `NgSwitchDefault`
*
*/
class NgSwitchCase {
constructor(viewContainer, templateRef, ngSwitch) {
this.ngSwitch = ngSwitch;
if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {
throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');
}
ngSwitch._addCase();
this._view = new SwitchView(viewContainer, templateRef);
}
/**
* Performs case matching. For internal use only.
*/
ngDoCheck() {
this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));
}
}
NgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) { return new (t || NgSwitchCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 9)); };
NgSwitchCase.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchCase, selectors: [["", "ngSwitchCase", ""]], inputs: { ngSwitchCase: "ngSwitchCase" } });
NgSwitchCase.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef },
{ type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host }] }
];
NgSwitchCase.propDecorators = {
ngSwitchCase: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitchCase, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngSwitchCase]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }, { type: NgSwitch, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional
}, {
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host
}] }]; }, { ngSwitchCase: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @ngModule CommonModule
*
* @description
*
* Creates a view that is rendered when no `NgSwitchCase` expressions
* match the `NgSwitch` expression.
* This statement should be the final case in an `NgSwitch`.
*
* @publicApi
* @see `NgSwitch`
* @see `NgSwitchCase`
*
*/
class NgSwitchDefault {
constructor(viewContainer, templateRef, ngSwitch) {
if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {
throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');
}
ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));
}
}
NgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) { return new (t || NgSwitchDefault)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 9)); };
NgSwitchDefault.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchDefault, selectors: [["", "ngSwitchDefault", ""]] });
NgSwitchDefault.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef },
{ type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitchDefault, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngSwitchDefault]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }, { type: NgSwitch, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Optional
}, {
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host
}] }]; }, null); })();
function throwNgSwitchProviderNotFoundError(attrName, directiveName) {
throw new _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵRuntimeError"]("305" /* TEMPLATE_STRUCTURE_ERROR */, `An element with the "${attrName}" attribute ` +
`(matching the "${directiveName}" directive) must be located inside an element with the "ngSwitch" attribute ` +
`(matching "NgSwitch" directive)`);
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
*
* @usageNotes
* ```
*
* there is nothing
* there is one
* there are a few
*
* ```
*
* @description
*
* Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.
*
* Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees
* that match the switch expression's pluralization category.
*
* To use this directive you must provide a container element that sets the `[ngPlural]` attribute
* to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their
* expression:
* - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value
* matches the switch expression exactly,
* - otherwise, the view will be treated as a "category match", and will only display if exact
* value matches aren't found and the value maps to its category for the defined locale.
*
* See http://cldr.unicode.org/index/cldr-spec/plural-rules
*
* @publicApi
*/
class NgPlural {
constructor(_localization) {
this._localization = _localization;
this._caseViews = {};
}
set ngPlural(value) {
this._switchValue = value;
this._updateView();
}
addCase(value, switchView) {
this._caseViews[value] = switchView;
}
_updateView() {
this._clearViews();
const cases = Object.keys(this._caseViews);
const key = getPluralCategory(this._switchValue, cases, this._localization);
this._activateView(this._caseViews[key]);
}
_clearViews() {
if (this._activeView)
this._activeView.destroy();
}
_activateView(view) {
if (view) {
this._activeView = view;
this._activeView.create();
}
}
}
NgPlural.ɵfac = function NgPlural_Factory(t) { return new (t || NgPlural)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization)); };
NgPlural.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPlural, selectors: [["", "ngPlural", ""]], inputs: { ngPlural: "ngPlural" } });
NgPlural.ctorParameters = () => [
{ type: NgLocalization }
];
NgPlural.propDecorators = {
ngPlural: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgPlural, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngPlural]' }]
}], function () { return [{ type: NgLocalization }]; }, { ngPlural: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @ngModule CommonModule
*
* @description
*
* Creates a view that will be added/removed from the parent {@link NgPlural} when the
* given expression matches the plural expression according to CLDR rules.
*
* @usageNotes
* ```
*
* ...
* ...
*
*```
*
* See {@link NgPlural} for more details and example.
*
* @publicApi
*/
class NgPluralCase {
constructor(value, template, viewContainer, ngPlural) {
this.value = value;
const isANumber = !isNaN(Number(value));
ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));
}
}
NgPluralCase.ɵfac = function NgPluralCase_Factory(t) { return new (t || NgPluralCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinjectAttribute"]('ngPluralCase'), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgPlural, 1)); };
NgPluralCase.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPluralCase, selectors: [["", "ngPluralCase", ""]] });
NgPluralCase.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Attribute, args: ['ngPluralCase',] }] },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef },
{ type: NgPlural, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgPluralCase, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngPluralCase]' }]
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Attribute,
args: ['ngPluralCase']
}] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.TemplateRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }, { type: NgPlural, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Host
}] }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
*
* @usageNotes
*
* Set the font of the containing element to the result of an expression.
*
* ```
* ...
* ```
*
* Set the width of the containing element to a pixel value returned by an expression.
*
* ```
* ...
* ```
*
* Set a collection of style values using an expression that returns key-value pairs.
*
* ```
* ...
* ```
*
* @description
*
* An attribute directive that updates styles for the containing HTML element.
* Sets one or more style properties, specified as colon-separated key-value pairs.
* The key is a style name, with an optional `.` suffix
* (such as 'top.px', 'font-style.em').
* The value is an expression to be evaluated.
* The resulting non-null value, expressed in the given unit,
* is assigned to the given style property.
* If the result of evaluation is null, the corresponding style is removed.
*
* @publicApi
*/
class NgStyle {
constructor(_ngEl, _differs, _renderer) {
this._ngEl = _ngEl;
this._differs = _differs;
this._renderer = _renderer;
this._ngStyle = null;
this._differ = null;
}
set ngStyle(values) {
this._ngStyle = values;
if (!this._differ && values) {
this._differ = this._differs.find(values).create();
}
}
ngDoCheck() {
if (this._differ) {
const changes = this._differ.diff(this._ngStyle);
if (changes) {
this._applyChanges(changes);
}
}
}
_setStyle(nameAndUnit, value) {
const [name, unit] = nameAndUnit.split('.');
value = value != null && unit ? `${value}${unit}` : value;
if (value != null) {
this._renderer.setStyle(this._ngEl.nativeElement, name, value);
}
else {
this._renderer.removeStyle(this._ngEl.nativeElement, name);
}
}
_applyChanges(changes) {
changes.forEachRemovedItem((record) => this._setStyle(record.key, null));
changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));
changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));
}
}
NgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2)); };
NgStyle.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgStyle, selectors: [["", "ngStyle", ""]], inputs: { ngStyle: "ngStyle" } });
NgStyle.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers },
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2 }
];
NgStyle.propDecorators = {
ngStyle: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input, args: ['ngStyle',] }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgStyle, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngStyle]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ElementRef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Renderer2 }]; }, { ngStyle: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input,
args: ['ngStyle']
}] }); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
*
* @description
*
* Inserts an embedded view from a prepared `TemplateRef`.
*
* You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.
* `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding
* by the local template `let` declarations.
*
* @usageNotes
* ```
*
* ```
*
* Using the key `$implicit` in the context object will set its value as default.
*
* ### Example
*
* {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}
*
* @publicApi
*/
class NgTemplateOutlet {
constructor(_viewContainerRef) {
this._viewContainerRef = _viewContainerRef;
this._viewRef = null;
/**
* A context object to attach to the {@link EmbeddedViewRef}. This should be an
* object, the object's keys will be available for binding by the local template `let`
* declarations.
* Using the key `$implicit` in the context object will set its value as default.
*/
this.ngTemplateOutletContext = null;
/**
* A string defining the template reference and optionally the context object for the template.
*/
this.ngTemplateOutlet = null;
}
ngOnChanges(changes) {
if (changes['ngTemplateOutlet']) {
const viewContainerRef = this._viewContainerRef;
if (this._viewRef) {
viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));
}
this._viewRef = this.ngTemplateOutlet ?
viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) :
null;
}
else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {
this._viewRef.context = this.ngTemplateOutletContext;
}
}
}
NgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef)); };
NgTemplateOutlet.ɵdir = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgTemplateOutlet, selectors: [["", "ngTemplateOutlet", ""]], inputs: { ngTemplateOutletContext: "ngTemplateOutletContext", ngTemplateOutlet: "ngTemplateOutlet" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] });
NgTemplateOutlet.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }
];
NgTemplateOutlet.propDecorators = {
ngTemplateOutletContext: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }],
ngTemplateOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input }]
};
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgTemplateOutlet, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Directive,
args: [{ selector: '[ngTemplateOutlet]' }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ViewContainerRef }]; }, { ngTemplateOutletContext: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}], ngTemplateOutlet: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Input
}] }); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A collection of Angular directives that are likely to be used in each and every Angular
* application.
*/
const COMMON_DIRECTIVES = [
NgClass,
NgComponentOutlet,
NgForOf,
NgIf,
NgTemplateOutlet,
NgStyle,
NgSwitch,
NgSwitchCase,
NgSwitchDefault,
NgPlural,
NgPluralCase,
];
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
function invalidPipeArgumentError(type, value) {
return Error(`InvalidPipeArgument: '${value}' for pipe '${(0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(type)}'`);
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
class SubscribableStrategy {
createSubscription(async, updateLatestValue) {
return async.subscribe({
next: updateLatestValue,
error: (e) => {
throw e;
}
});
}
dispose(subscription) {
subscription.unsubscribe();
}
onDestroy(subscription) {
subscription.unsubscribe();
}
}
class PromiseStrategy {
createSubscription(async, updateLatestValue) {
return async.then(updateLatestValue, e => {
throw e;
});
}
dispose(subscription) { }
onDestroy(subscription) { }
}
const _promiseStrategy = new PromiseStrategy();
const _subscribableStrategy = new SubscribableStrategy();
/**
* @ngModule CommonModule
* @description
*
* Unwraps a value from an asynchronous primitive.
*
* The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has
* emitted. When a new value is emitted, the `async` pipe marks the component to be checked for
* changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid
* potential memory leaks.
*
* @usageNotes
*
* ### Examples
*
* This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the
* promise.
*
* {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}
*
* It's also possible to use `async` with Observables. The example below binds the `time` Observable
* to the view. The Observable continuously updates the view with the current time.
*
* {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}
*
* @publicApi
*/
class AsyncPipe {
constructor(_ref) {
this._ref = _ref;
this._latestValue = null;
this._subscription = null;
this._obj = null;
this._strategy = null;
}
ngOnDestroy() {
if (this._subscription) {
this._dispose();
}
}
transform(obj) {
if (!this._obj) {
if (obj) {
this._subscribe(obj);
}
return this._latestValue;
}
if (obj !== this._obj) {
this._dispose();
return this.transform(obj);
}
return this._latestValue;
}
_subscribe(obj) {
this._obj = obj;
this._strategy = this._selectStrategy(obj);
this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));
}
_selectStrategy(obj) {
if ((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisPromise"])(obj)) {
return _promiseStrategy;
}
if ((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisSubscribable"])(obj)) {
return _subscribableStrategy;
}
throw invalidPipeArgumentError(AsyncPipe, obj);
}
_dispose() {
this._strategy.dispose(this._subscription);
this._latestValue = null;
this._subscription = null;
this._obj = null;
}
_updateLatestValue(async, value) {
if (async === this._obj) {
this._latestValue = value;
this._ref.markForCheck();
}
}
}
AsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.ChangeDetectorRef, 16)); };
AsyncPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "async", type: AsyncPipe, pure: false });
AsyncPipe.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ChangeDetectorRef }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](AsyncPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'async', pure: false }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.ChangeDetectorRef }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Transforms text to all lower case.
*
* @see `UpperCasePipe`
* @see `TitleCasePipe`
* @usageNotes
*
* The following example defines a view that allows the user to enter
* text, and then uses the pipe to convert the input text to all lower case.
*
*
*
* @ngModule CommonModule
* @publicApi
*/
class LowerCasePipe {
transform(value) {
if (value == null)
return null;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(LowerCasePipe, value);
}
return value.toLowerCase();
}
}
LowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); };
LowerCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "lowercase", type: LowerCasePipe, pure: true });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](LowerCasePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'lowercase' }]
}], null, null); })();
//
// Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result
// can be achieved by using /\p{L}\S*/gu and also known as Unicode Property Escapes
// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no
// transpilation of this functionality down to ES5 without external tool, the only solution is
// to use already transpiled form. Example can be found here -
// https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1
//
const unicodeWordMatch = /(?:[A-Za-z\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0561-\u0587\u05D0-\u05EA\u05F0-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u0860-\u086A\u08A0-\u08B4\u08B6-\u08BD\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u09FC\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C60\u0C61\u0C80\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D05-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D54-\u0D56\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E87\u0E88\u0E8A\u0E8D\u0E94-\u0E97\u0E99-\u0E9F\u0EA1-\u0EA3\u0EA5\u0EA7\u0EAA\u0EAB\u0EAD-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16F1-\u16F8\u1700-\u170C\u170E-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1877\u1880-\u1884\u1887-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4B\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1C80-\u1C88\u1CE9-\u1CEC\u1CEE-\u1CF1\u1CF5\u1CF6\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2119-\u211D\u2124\u2126\u2128\u212A-\u212D\u212F-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2183\u2184\u2C00-\u2C2E\u2C30-\u2C5E\u2C60-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2E2F\u3005\u3006\u3031-\u3035\u303B\u303C\u3041-\u3096\u309D-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312E\u3131-\u318E\u31A0-\u31BA\u31F0-\u31FF\u3400-\u4DB5\u4E00-\u9FEA\uA000-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6E5\uA717-\uA71F\uA722-\uA788\uA78B-\uA7AE\uA7B0-\uA7B7\uA7F7-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB65\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE70-\uFE74\uFE76-\uFEFC\uFF21-\uFF3A\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDE80-\uDE9C\uDEA0-\uDED0\uDF00-\uDF1F\uDF2D-\uDF40\uDF42-\uDF49\uDF50-\uDF75\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF]|\uD801[\uDC00-\uDC9D\uDCB0-\uDCD3\uDCD8-\uDCFB\uDD00-\uDD27\uDD30-\uDD63\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00\uDE10-\uDE13\uDE15-\uDE17\uDE19-\uDE33\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE4\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2]|\uD804[\uDC03-\uDC37\uDC83-\uDCAF\uDCD0-\uDCE8\uDD03-\uDD26\uDD50-\uDD72\uDD76\uDD83-\uDDB2\uDDC1-\uDDC4\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE2B\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEDE\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3D\uDF50\uDF5D-\uDF61]|\uD805[\uDC00-\uDC34\uDC47-\uDC4A\uDC80-\uDCAF\uDCC4\uDCC5\uDCC7\uDD80-\uDDAE\uDDD8-\uDDDB\uDE00-\uDE2F\uDE44\uDE80-\uDEAA\uDF00-\uDF19]|\uD806[\uDCA0-\uDCDF\uDCFF\uDE00\uDE0B-\uDE32\uDE3A\uDE50\uDE5C-\uDE83\uDE86-\uDE89\uDEC0-\uDEF8]|\uD807[\uDC00-\uDC08\uDC0A-\uDC2E\uDC40\uDC72-\uDC8F\uDD00-\uDD06\uDD08\uDD09\uDD0B-\uDD30\uDD46]|\uD808[\uDC00-\uDF99]|\uD809[\uDC80-\uDD43]|[\uD80C\uD81C-\uD820\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872\uD874-\uD879][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDED0-\uDEED\uDF00-\uDF2F\uDF40-\uDF43\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDF00-\uDF44\uDF50\uDF93-\uDF9F\uDFE0\uDFE1]|\uD821[\uDC00-\uDFEC]|\uD822[\uDC00-\uDEF2]|\uD82C[\uDC00-\uDD1E\uDD70-\uDEFB]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB]|\uD83A[\uDC00-\uDCC4\uDD00-\uDD43]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDED6\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF34\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1\uDEB0-\uDFFF]|\uD87A[\uDC00-\uDFE0]|\uD87E[\uDC00-\uDE1D])\S*/g;
/**
* Transforms text to title case.
* Capitalizes the first letter of each word and transforms the
* rest of the word to lower case.
* Words are delimited by any whitespace character, such as a space, tab, or line-feed character.
*
* @see `LowerCasePipe`
* @see `UpperCasePipe`
*
* @usageNotes
* The following example shows the result of transforming various strings into title case.
*
*
*
* @ngModule CommonModule
* @publicApi
*/
class TitleCasePipe {
transform(value) {
if (value == null)
return null;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(TitleCasePipe, value);
}
return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase()));
}
}
TitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); };
TitleCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "titlecase", type: TitleCasePipe, pure: true });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](TitleCasePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'titlecase' }]
}], null, null); })();
/**
* Transforms text to all upper case.
* @see `LowerCasePipe`
* @see `TitleCasePipe`
*
* @ngModule CommonModule
* @publicApi
*/
class UpperCasePipe {
transform(value) {
if (value == null)
return null;
if (typeof value !== 'string') {
throw invalidPipeArgumentError(UpperCasePipe, value);
}
return value.toUpperCase();
}
}
UpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); };
UpperCasePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "uppercase", type: UpperCasePipe, pure: true });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](UpperCasePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'uppercase' }]
}], null, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
// clang-format off
/**
* @ngModule CommonModule
* @description
*
* Formats a date value according to locale rules.
*
* `DatePipe` is executed only when it detects a pure change to the input value.
* A pure change is either a change to a primitive input value
* (such as `String`, `Number`, `Boolean`, or `Symbol`),
* or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).
*
* Note that mutating a `Date` object does not cause the pipe to be rendered again.
* To ensure that the pipe is executed, you must create a new `Date` object.
*
* Only the `en-US` locale data comes with Angular. To localize dates
* in another language, you must import the corresponding locale data.
* See the [I18n guide](guide/i18n#i18n-pipes) for more information.
*
* @see `formatDate()`
*
*
* @usageNotes
*
* The result of this pipe is not reevaluated when the input is mutated. To avoid the need to
* reformat the date on every change-detection cycle, treat the date as an immutable object
* and change the reference when the pipe needs to run again.
*
* ### Pre-defined format options
*
* | Option | Equivalent to | Examples (given in `en-US` locale) |
* |---------------|-------------------------------------|-------------------------------------------------|
* | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |
* | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |
* | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |
* | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |
* | `'shortDate'` | `'M/d/yy'` | `6/15/15` |
* | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |
* | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |
* | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |
* | `'shortTime'` | `'h:mm a'` | `9:03 AM` |
* | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |
* | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |
* | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |
*
* ### Custom format options
*
* You can construct a format string using symbols to specify the components
* of a date-time value, as described in the following table.
* Format details depend on the locale.
* Fields marked with (*) are only available in the extra data set for the given locale.
*
* | Field type | Format | Description | Example Value |
* |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|
* | Era | G, GG & GGG | Abbreviated | AD |
* | | GGGG | Wide | Anno Domini |
* | | GGGGG | Narrow | A |
* | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |
* | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |
* | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |
* | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |
* | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |
* | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |
* | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |
* | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |
* | Month | M | Numeric: 1 digit | 9, 12 |
* | | MM | Numeric: 2 digits + zero padded | 09, 12 |
* | | MMM | Abbreviated | Sep |
* | | MMMM | Wide | September |
* | | MMMMM | Narrow | S |
* | Month standalone | L | Numeric: 1 digit | 9, 12 |
* | | LL | Numeric: 2 digits + zero padded | 09, 12 |
* | | LLL | Abbreviated | Sep |
* | | LLLL | Wide | September |
* | | LLLLL | Narrow | S |
* | Week of year | w | Numeric: minimum digits | 1... 53 |
* | | ww | Numeric: 2 digits + zero padded | 01... 53 |
* | Week of month | W | Numeric: 1 digit | 1... 5 |
* | Day of month | d | Numeric: minimum digits | 1 |
* | | dd | Numeric: 2 digits + zero padded | 01 |
* | Week day | E, EE & EEE | Abbreviated | Tue |
* | | EEEE | Wide | Tuesday |
* | | EEEEE | Narrow | T |
* | | EEEEEE | Short | Tu |
* | Week day standalone | c, cc | Numeric: 1 digit | 2 |
* | | ccc | Abbreviated | Tue |
* | | cccc | Wide | Tuesday |
* | | ccccc | Narrow | T |
* | | cccccc | Short | Tu |
* | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |
* | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |
* | | aaaaa | Narrow | a/p |
* | Period* | B, BB & BBB | Abbreviated | mid. |
* | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |
* | | BBBBB | Narrow | md |
* | Period standalone* | b, bb & bbb | Abbreviated | mid. |
* | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |
* | | bbbbb | Narrow | md |
* | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |
* | | hh | Numeric: 2 digits + zero padded | 01, 12 |
* | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |
* | | HH | Numeric: 2 digits + zero padded | 00, 23 |
* | Minute | m | Numeric: minimum digits | 8, 59 |
* | | mm | Numeric: 2 digits + zero padded | 08, 59 |
* | Second | s | Numeric: minimum digits | 0... 59 |
* | | ss | Numeric: 2 digits + zero padded | 00... 59 |
* | Fractional seconds | S | Numeric: 1 digit | 0... 9 |
* | | SS | Numeric: 2 digits + zero padded | 00... 99 |
* | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |
* | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |
* | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |
* | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |
* | | ZZZZ | Long localized GMT format | GMT-8:00 |
* | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |
* | | O, OO & OOO | Short localized GMT format | GMT-8 |
* | | OOOO | Long localized GMT format | GMT-08:00 |
*
*
* ### Format examples
*
* These examples transform a date into various formats,
* assuming that `dateObj` is a JavaScript `Date` object for
* year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,
* given in the local time for the `en-US` locale.
*
* ```
* {{ dateObj | date }} // output is 'Jun 15, 2015'
* {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'
* {{ dateObj | date:'shortTime' }} // output is '9:43 PM'
* {{ dateObj | date:'mm:ss' }} // output is '43:11'
* ```
*
* ### Usage example
*
* The following component uses a date pipe to display the current date in different formats.
*
* ```
* @Component({
* selector: 'date-pipe',
* template: `
*
Today is {{today | date}}
*
Or if you prefer, {{today | date:'fullDate'}}
*
The time is {{today | date:'h:mm a z'}}
*
`
* })
* // Get the current date and time as a date-time value.
* export class DatePipeComponent {
* today: number = Date.now();
* }
* ```
*
* @publicApi
*/
// clang-format on
class DatePipe {
constructor(locale) {
this.locale = locale;
}
transform(value, format = 'mediumDate', timezone, locale) {
if (value == null || value === '' || value !== value)
return null;
try {
return formatDate(value, format, locale || this.locale, timezone);
}
catch (error) {
throw invalidPipeArgumentError(DatePipe, error.message);
}
}
}
DatePipe.ɵfac = function DatePipe_Factory(t) { return new (t || DatePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID, 16)); };
DatePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "date", type: DatePipe, pure: true });
DatePipe.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](DatePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'date', pure: true }]
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID]
}] }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const _INTERPOLATION_REGEXP = /#/g;
/**
* @ngModule CommonModule
* @description
*
* Maps a value to a string that pluralizes the value according to locale rules.
*
* @usageNotes
*
* ### Example
*
* {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}
*
* @publicApi
*/
class I18nPluralPipe {
constructor(_localization) {
this._localization = _localization;
}
/**
* @param value the number to be formatted
* @param pluralMap an object that mimics the ICU format, see
* http://userguide.icu-project.org/formatparse/messages.
* @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by
* default).
*/
transform(value, pluralMap, locale) {
if (value == null)
return '';
if (typeof pluralMap !== 'object' || pluralMap === null) {
throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);
}
const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);
return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());
}
}
I18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) { return new (t || I18nPluralPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization, 16)); };
I18nPluralPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nPlural", type: I18nPluralPipe, pure: true });
I18nPluralPipe.ctorParameters = () => [
{ type: NgLocalization }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](I18nPluralPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'i18nPlural', pure: true }]
}], function () { return [{ type: NgLocalization }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
* @description
*
* Generic selector that displays the string that matches the current value.
*
* If none of the keys of the `mapping` match the `value`, then the content
* of the `other` key is returned when present, otherwise an empty string is returned.
*
* @usageNotes
*
* ### Example
*
* {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}
*
* @publicApi
*/
class I18nSelectPipe {
/**
* @param value a string to be internationalized.
* @param mapping an object that indicates the text that should be displayed
* for different values of the provided `value`.
*/
transform(value, mapping) {
if (value == null)
return '';
if (typeof mapping !== 'object' || typeof value !== 'string') {
throw invalidPipeArgumentError(I18nSelectPipe, mapping);
}
if (mapping.hasOwnProperty(value)) {
return mapping[value];
}
if (mapping.hasOwnProperty('other')) {
return mapping['other'];
}
return '';
}
}
I18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) { return new (t || I18nSelectPipe)(); };
I18nSelectPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nSelect", type: I18nSelectPipe, pure: true });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](I18nSelectPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'i18nSelect', pure: true }]
}], null, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
* @description
*
* Converts a value into its JSON-format representation. Useful for debugging.
*
* @usageNotes
*
* The following component uses a JSON pipe to convert an object
* to JSON format, and displays the string in both formats for comparison.
*
* {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}
*
* @publicApi
*/
class JsonPipe {
/**
* @param value A value of any type to convert into a JSON-format string.
*/
transform(value) {
return JSON.stringify(value, null, 2);
}
}
JsonPipe.ɵfac = function JsonPipe_Factory(t) { return new (t || JsonPipe)(); };
JsonPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "json", type: JsonPipe, pure: false });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](JsonPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'json', pure: false }]
}], null, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
function makeKeyValuePair(key, value) {
return { key: key, value: value };
}
/**
* @ngModule CommonModule
* @description
*
* Transforms Object or Map into an array of key value pairs.
*
* The output array will be ordered by keys.
* By default the comparator will be by Unicode point value.
* You can optionally pass a compareFn if your keys are complex types.
*
* @usageNotes
* ### Examples
*
* This examples show how an Object or a Map can be iterated by ngFor with the use of this
* keyvalue pipe.
*
* {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}
*
* @publicApi
*/
class KeyValuePipe {
constructor(differs) {
this.differs = differs;
this.keyValues = [];
}
transform(input, compareFn = defaultComparator) {
if (!input || (!(input instanceof Map) && typeof input !== 'object')) {
return null;
}
if (!this.differ) {
// make a differ for whatever type we've been passed in
this.differ = this.differs.find(input).create();
}
const differChanges = this.differ.diff(input);
if (differChanges) {
this.keyValues = [];
differChanges.forEachItem((r) => {
this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));
});
this.keyValues.sort(compareFn);
}
return this.keyValues;
}
}
KeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) { return new (t || KeyValuePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers, 16)); };
KeyValuePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "keyvalue", type: KeyValuePipe, pure: false });
KeyValuePipe.ctorParameters = () => [
{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](KeyValuePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'keyvalue', pure: false }]
}], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.KeyValueDiffers }]; }, null); })();
function defaultComparator(keyValueA, keyValueB) {
const a = keyValueA.key;
const b = keyValueB.key;
// if same exit with 0;
if (a === b)
return 0;
// make sure that undefined are at the end of the sort.
if (a === undefined)
return 1;
if (b === undefined)
return -1;
// make sure that nulls are at the end of the sort.
if (a === null)
return 1;
if (b === null)
return -1;
if (typeof a == 'string' && typeof b == 'string') {
return a < b ? -1 : 1;
}
if (typeof a == 'number' && typeof b == 'number') {
return a - b;
}
if (typeof a == 'boolean' && typeof b == 'boolean') {
return a < b ? -1 : 1;
}
// `a` and `b` are of different types. Compare their string values.
const aString = String(a);
const bString = String(b);
return aString == bString ? 0 : aString < bString ? -1 : 1;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
* @description
*
* Formats a value according to digit options and locale rules.
* Locale determines group sizing and separator,
* decimal point character, and other locale-specific configurations.
*
* @see `formatNumber()`
*
* @usageNotes
*
* ### digitsInfo
*
* The value's decimal representation is specified by the `digitsInfo`
* parameter, written in the following format:
*
* ```
* {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}
* ```
*
* - `minIntegerDigits`:
* The minimum number of integer digits before the decimal point.
* Default is 1.
*
* - `minFractionDigits`:
* The minimum number of digits after the decimal point.
* Default is 0.
*
* - `maxFractionDigits`:
* The maximum number of digits after the decimal point.
* Default is 3.
*
* If the formatted value is truncated it will be rounded using the "to-nearest" method:
*
* ```
* {{3.6 | number: '1.0-0'}}
*
*
* {{-3.6 | number:'1.0-0'}}
*
* ```
*
* ### locale
*
* `locale` will format a value according to locale rules.
* Locale determines group sizing and separator,
* decimal point character, and other locale-specific configurations.
*
* When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.
*
* See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app).
*
* ### Example
*
* The following code shows how the pipe transforms values
* according to various format specifications,
* where the caller's default locale is `en-US`.
*
*
*
* @publicApi
*/
class DecimalPipe {
constructor(_locale) {
this._locale = _locale;
}
/**
* @param value The value to be formatted.
* @param digitsInfo Sets digit and decimal representation.
* [See more](#digitsinfo).
* @param locale Specifies what locale format rules to use.
* [See more](#locale).
*/
transform(value, digitsInfo, locale) {
if (!isValue(value))
return null;
locale = locale || this._locale;
try {
const num = strToNumber(value);
return formatNumber(num, locale, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(DecimalPipe, error.message);
}
}
}
DecimalPipe.ɵfac = function DecimalPipe_Factory(t) { return new (t || DecimalPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID, 16)); };
DecimalPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "number", type: DecimalPipe, pure: true });
DecimalPipe.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](DecimalPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'number' }]
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID]
}] }]; }, null); })();
/**
* @ngModule CommonModule
* @description
*
* Transforms a number to a percentage
* string, formatted according to locale rules that determine group sizing and
* separator, decimal-point character, and other locale-specific
* configurations.
*
* @see `formatPercent()`
*
* @usageNotes
* The following code shows how the pipe transforms numbers
* into text strings, according to various format specifications,
* where the caller's default locale is `en-US`.
*
*
*
* @publicApi
*/
class PercentPipe {
constructor(_locale) {
this._locale = _locale;
}
transform(value, digitsInfo, locale) {
if (!isValue(value))
return null;
locale = locale || this._locale;
try {
const num = strToNumber(value);
return formatPercent(num, locale, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(PercentPipe, error.message);
}
}
}
PercentPipe.ɵfac = function PercentPipe_Factory(t) { return new (t || PercentPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID, 16)); };
PercentPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "percent", type: PercentPipe, pure: true });
PercentPipe.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PercentPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'percent' }]
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID]
}] }]; }, null); })();
/**
* @ngModule CommonModule
* @description
*
* Transforms a number to a currency string, formatted according to locale rules
* that determine group sizing and separator, decimal-point character,
* and other locale-specific configurations.
*
* {@a currency-code-deprecation}
*
*
* **Deprecation notice:**
*
* The default currency code is currently always `USD` but this is deprecated from v9.
*
* **In v11 the default currency code will be taken from the current locale identified by
* the `LOCALE_ID` token. See the [i18n guide](guide/i18n#setting-up-the-locale-of-your-app) for
* more information.**
*
* If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in
* your application `NgModule`:
*
* ```ts
* {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'}
* ```
*
*
*
* @see `getCurrencySymbol()`
* @see `formatCurrency()`
*
* @usageNotes
* The following code shows how the pipe transforms numbers
* into text strings, according to various format specifications,
* where the caller's default locale is `en-US`.
*
*
*
* @publicApi
*/
class CurrencyPipe {
constructor(_locale, _defaultCurrencyCode = 'USD') {
this._locale = _locale;
this._defaultCurrencyCode = _defaultCurrencyCode;
}
transform(value, currencyCode, display = 'symbol', digitsInfo, locale) {
if (!isValue(value))
return null;
locale = locale || this._locale;
if (typeof display === 'boolean') {
if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {
console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are "code", "symbol" or "symbol-narrow".`);
}
display = display ? 'symbol' : 'code';
}
let currency = currencyCode || this._defaultCurrencyCode;
if (display !== 'code') {
if (display === 'symbol' || display === 'symbol-narrow') {
currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);
}
else {
currency = display;
}
}
try {
const num = strToNumber(value);
return formatCurrency(num, locale, currency, currencyCode, digitsInfo);
}
catch (error) {
throw invalidPipeArgumentError(CurrencyPipe, error.message);
}
}
}
CurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID, 16), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__.DEFAULT_CURRENCY_CODE, 16)); };
CurrencyPipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "currency", type: CurrencyPipe, pure: true });
CurrencyPipe.ctorParameters = () => [
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID,] }] },
{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject, args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.DEFAULT_CURRENCY_CODE,] }] }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CurrencyPipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'currency' }]
}], function () { return [{ type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.LOCALE_ID]
}] }, { type: String, decorators: [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Inject,
args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__.DEFAULT_CURRENCY_CODE]
}] }]; }, null); })();
function isValue(value) {
return !(value == null || value === '' || value !== value);
}
/**
* Transforms a string into a number (if needed).
*/
function strToNumber(value) {
// Convert strings to numbers
if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {
return Number(value);
}
if (typeof value !== 'number') {
throw new Error(`${value} is not a number`);
}
return value;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @ngModule CommonModule
* @description
*
* Creates a new `Array` or `String` containing a subset (slice) of the elements.
*
* @usageNotes
*
* All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`
* and `String.prototype.slice()`.
*
* When operating on an `Array`, the returned `Array` is always a copy even when all
* the elements are being returned.
*
* When operating on a blank value, the pipe returns the blank value.
*
* ### List Example
*
* This `ngFor` example:
*
* {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}
*
* produces the following:
*
* ```html
*
b
*
c
* ```
*
* ### String Examples
*
* {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}
*
* @publicApi
*/
class SlicePipe {
transform(value, start, end) {
if (value == null)
return null;
if (!this.supports(value)) {
throw invalidPipeArgumentError(SlicePipe, value);
}
return value.slice(start, end);
}
supports(obj) {
return typeof obj === 'string' || Array.isArray(obj);
}
}
SlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); };
SlicePipe.ɵpipe = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "slice", type: SlicePipe, pure: false });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](SlicePipe, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.Pipe,
args: [{ name: 'slice', pure: false }]
}], null, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A collection of Angular pipes that are likely to be used in each and every application.
*/
const COMMON_PIPES = [
AsyncPipe,
UpperCasePipe,
LowerCasePipe,
JsonPipe,
SlicePipe,
DecimalPipe,
PercentPipe,
TitleCasePipe,
CurrencyPipe,
DatePipe,
I18nPluralPipe,
I18nSelectPipe,
KeyValuePipe,
];
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
// Note: This does not contain the location providers,
// as they need some platform specific implementations to work.
/**
* Exports all the basic Angular directives and pipes,
* such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.
* Re-exported by `BrowserModule`, which is included automatically in the root
* `AppModule` when you create a new app with the CLI `new` command.
*
* * The `providers` options configure the NgModule's injector to provide
* localization dependencies to members.
* * The `exports` options make the declared directives and pipes available for import
* by other NgModules.
*
* @publicApi
*/
class CommonModule {
}
CommonModule.ɵfac = function CommonModule_Factory(t) { return new (t || CommonModule)(); };
CommonModule.ɵmod = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: CommonModule });
CommonModule.ɵinj = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ providers: [
{ provide: NgLocalization, useClass: NgLocaleLocalization },
] });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CommonModule, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_0__.NgModule,
args: [{
declarations: [COMMON_DIRECTIVES, COMMON_PIPES],
exports: [COMMON_DIRECTIVES, COMMON_PIPES],
providers: [
{ provide: NgLocalization, useClass: NgLocaleLocalization },
]
}]
}], null, null); })();
(function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](CommonModule, { declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
const PLATFORM_BROWSER_ID = 'browser';
const PLATFORM_SERVER_ID = 'server';
const PLATFORM_WORKER_APP_ID = 'browserWorkerApp';
const PLATFORM_WORKER_UI_ID = 'browserWorkerUi';
/**
* Returns whether a platform id represents a browser platform.
* @publicApi
*/
function isPlatformBrowser(platformId) {
return platformId === PLATFORM_BROWSER_ID;
}
/**
* Returns whether a platform id represents a server platform.
* @publicApi
*/
function isPlatformServer(platformId) {
return platformId === PLATFORM_SERVER_ID;
}
/**
* Returns whether a platform id represents a web worker app platform.
* @publicApi
*/
function isPlatformWorkerApp(platformId) {
return platformId === PLATFORM_WORKER_APP_ID;
}
/**
* Returns whether a platform id represents a web worker UI platform.
* @publicApi
*/
function isPlatformWorkerUi(platformId) {
return platformId === PLATFORM_WORKER_UI_ID;
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @publicApi
*/
const VERSION = new _angular_core__WEBPACK_IMPORTED_MODULE_0__.Version('12.0.2');
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Defines a scroll position manager. Implemented by `BrowserViewportScroller`.
*
* @publicApi
*/
class ViewportScroller {
}
// De-sugared tree-shakable injection
// See #23917
/** @nocollapse */
ViewportScroller.ɵprov = (0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({
token: ViewportScroller,
providedIn: 'root',
factory: () => new BrowserViewportScroller((0,_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT), window)
});
/**
* Manages the scroll position for a browser window.
*/
class BrowserViewportScroller {
constructor(document, window) {
this.document = document;
this.window = window;
this.offset = () => [0, 0];
}
/**
* Configures the top offset used when scrolling to an anchor.
* @param offset A position in screen coordinates (a tuple with x and y values)
* or a function that returns the top offset position.
*
*/
setOffset(offset) {
if (Array.isArray(offset)) {
this.offset = () => offset;
}
else {
this.offset = offset;
}
}
/**
* Retrieves the current scroll position.
* @returns The position in screen coordinates.
*/
getScrollPosition() {
if (this.supportsScrolling()) {
return [this.window.pageXOffset, this.window.pageYOffset];
}
else {
return [0, 0];
}
}
/**
* Sets the scroll position.
* @param position The new position in screen coordinates.
*/
scrollToPosition(position) {
if (this.supportsScrolling()) {
this.window.scrollTo(position[0], position[1]);
}
}
/**
* Scrolls to an element and attempts to focus the element.
*
* Note that the function name here is misleading in that the target string may be an ID for a
* non-anchor element.
*
* @param target The ID of an element or name of the anchor.
*
* @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document
* @see https://html.spec.whatwg.org/#scroll-to-fragid
*/
scrollToAnchor(target) {
if (!this.supportsScrolling()) {
return;
}
// TODO(atscott): The correct behavior for `getElementsByName` would be to also verify that the
// element is an anchor. However, this could be considered a breaking change and should be
// done in a major version.
const elSelected = findAnchorFromDocument(this.document, target);
if (elSelected) {
this.scrollToElement(elSelected);
// After scrolling to the element, the spec dictates that we follow the focus steps for the
// target. Rather than following the robust steps, simply attempt focus.
this.attemptFocus(elSelected);
}
}
/**
* Disables automatic scroll restoration provided by the browser.
*/
setHistoryScrollRestoration(scrollRestoration) {
if (this.supportScrollRestoration()) {
const history = this.window.history;
if (history && history.scrollRestoration) {
history.scrollRestoration = scrollRestoration;
}
}
}
/**
* Scrolls to an element using the native offset and the specified offset set on this scroller.
*
* The offset can be used when we know that there is a floating header and scrolling naively to an
* element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.
*/
scrollToElement(el) {
const rect = el.getBoundingClientRect();
const left = rect.left + this.window.pageXOffset;
const top = rect.top + this.window.pageYOffset;
const offset = this.offset();
this.window.scrollTo(left - offset[0], top - offset[1]);
}
/**
* Calls `focus` on the `focusTarget` and returns `true` if the element was focused successfully.
*
* If `false`, further steps may be necessary to determine a valid substitute to be focused
* instead.
*
* @see https://html.spec.whatwg.org/#get-the-focusable-area
* @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus
* @see https://html.spec.whatwg.org/#focusable-area
*/
attemptFocus(focusTarget) {
focusTarget.focus();
return this.document.activeElement === focusTarget;
}
/**
* We only support scroll restoration when we can get a hold of window.
* This means that we do not support this behavior when running in a web worker.
*
* Lifting this restriction right now would require more changes in the dom adapter.
* Since webworkers aren't widely used, we will lift it once RouterScroller is
* battle-tested.
*/
supportScrollRestoration() {
try {
if (!this.supportsScrolling()) {
return false;
}
// The `scrollRestoration` property could be on the `history` instance or its prototype.
const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||
getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));
// We can write to the `scrollRestoration` property if it is a writable data field or it has a
// setter function.
return !!scrollRestorationDescriptor &&
!!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);
}
catch (_a) {
return false;
}
}
supportsScrolling() {
try {
return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;
}
catch (_a) {
return false;
}
}
}
function getScrollRestorationProperty(obj) {
return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');
}
function findAnchorFromDocument(document, target) {
const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];
if (documentResult) {
return documentResult;
}
// `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we
// have to traverse the DOM manually and do the lookup through the shadow roots.
if (typeof document.createTreeWalker === 'function' && document.body &&
(document.body.createShadowRoot || document.body.attachShadow)) {
const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);
let currentNode = treeWalker.currentNode;
while (currentNode) {
const shadowRoot = currentNode.shadowRoot;
if (shadowRoot) {
// Note that `ShadowRoot` doesn't support `getElementsByName`
// so we have to fall back to `querySelector`.
const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name="${target}"]`);
if (result) {
return result;
}
}
currentNode = treeWalker.nextNode();
}
}
return null;
}
/**
* Provides an empty implementation of the viewport scroller.
*/
class NullViewportScroller {
/**
* Empty implementation
*/
setOffset(offset) { }
/**
* Empty implementation
*/
getScrollPosition() {
return [0, 0];
}
/**
* Empty implementation
*/
scrollToPosition(position) { }
/**
* Empty implementation
*/
scrollToAnchor(anchor) { }
/**
* Empty implementation
*/
setHistoryScrollRestoration(scrollRestoration) { }
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A wrapper around the `XMLHttpRequest` constructor.
*
* @publicApi
*/
class XhrFactory {
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
// This file only reexports content of the `src` folder. Keep it that way.
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Generated bundle index. Do not edit.
*/
//# sourceMappingURL=common.js.map
/***/ }),
/***/ 91841:
/*!********************************************************************!*\
!*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/http.js ***!
\********************************************************************/
/***/ (function(__unused_webpack_module, __webpack_exports__, __webpack_require__) {
"use strict";
__webpack_require__.r(__webpack_exports__);
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */ "HTTP_INTERCEPTORS": function() { return /* binding */ HTTP_INTERCEPTORS; },
/* harmony export */ "HttpBackend": function() { return /* binding */ HttpBackend; },
/* harmony export */ "HttpClient": function() { return /* binding */ HttpClient; },
/* harmony export */ "HttpClientJsonpModule": function() { return /* binding */ HttpClientJsonpModule; },
/* harmony export */ "HttpClientModule": function() { return /* binding */ HttpClientModule; },
/* harmony export */ "HttpClientXsrfModule": function() { return /* binding */ HttpClientXsrfModule; },
/* harmony export */ "HttpContext": function() { return /* binding */ HttpContext; },
/* harmony export */ "HttpContextToken": function() { return /* binding */ HttpContextToken; },
/* harmony export */ "HttpErrorResponse": function() { return /* binding */ HttpErrorResponse; },
/* harmony export */ "HttpEventType": function() { return /* binding */ HttpEventType; },
/* harmony export */ "HttpHandler": function() { return /* binding */ HttpHandler; },
/* harmony export */ "HttpHeaderResponse": function() { return /* binding */ HttpHeaderResponse; },
/* harmony export */ "HttpHeaders": function() { return /* binding */ HttpHeaders; },
/* harmony export */ "HttpParams": function() { return /* binding */ HttpParams; },
/* harmony export */ "HttpRequest": function() { return /* binding */ HttpRequest; },
/* harmony export */ "HttpResponse": function() { return /* binding */ HttpResponse; },
/* harmony export */ "HttpResponseBase": function() { return /* binding */ HttpResponseBase; },
/* harmony export */ "HttpUrlEncodingCodec": function() { return /* binding */ HttpUrlEncodingCodec; },
/* harmony export */ "HttpXhrBackend": function() { return /* binding */ HttpXhrBackend; },
/* harmony export */ "HttpXsrfTokenExtractor": function() { return /* binding */ HttpXsrfTokenExtractor; },
/* harmony export */ "JsonpClientBackend": function() { return /* binding */ JsonpClientBackend; },
/* harmony export */ "JsonpInterceptor": function() { return /* binding */ JsonpInterceptor; },
/* harmony export */ "XhrFactory": function() { return /* binding */ XhrFactory; },
/* harmony export */ "ɵHttpInterceptingHandler": function() { return /* binding */ HttpInterceptingHandler; },
/* harmony export */ "ɵangular_packages_common_http_http_a": function() { return /* binding */ NoopInterceptor; },
/* harmony export */ "ɵangular_packages_common_http_http_b": function() { return /* binding */ JsonpCallbackContext; },
/* harmony export */ "ɵangular_packages_common_http_http_c": function() { return /* binding */ jsonpCallbackContext; },
/* harmony export */ "ɵangular_packages_common_http_http_d": function() { return /* binding */ XSRF_COOKIE_NAME; },
/* harmony export */ "ɵangular_packages_common_http_http_e": function() { return /* binding */ XSRF_HEADER_NAME; },
/* harmony export */ "ɵangular_packages_common_http_http_f": function() { return /* binding */ HttpXsrfCookieExtractor; },
/* harmony export */ "ɵangular_packages_common_http_http_g": function() { return /* binding */ HttpXsrfInterceptor; }
/* harmony export */ });
/* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/common */ 38583);
/* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/core */ 37716);
/* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! rxjs */ 25917);
/* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! rxjs */ 69165);
/* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! rxjs/operators */ 94612);
/* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs/operators */ 45435);
/* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs/operators */ 88002);
/**
* @license Angular v12.0.2
* (c) 2010-2021 Google LLC. https://angular.io/
* License: MIT
*/
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a
* `HttpResponse`.
*
* `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the
* first interceptor in the chain, which dispatches to the second, etc, eventually reaching the
* `HttpBackend`.
*
* In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.
*
* @publicApi
*/
class HttpHandler {
}
/**
* A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.
*
* Interceptors sit between the `HttpClient` interface and the `HttpBackend`.
*
* When injected, `HttpBackend` dispatches requests directly to the backend, without going
* through the interceptor chain.
*
* @publicApi
*/
class HttpBackend {
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Represents the header configuration options for an HTTP request.
* Instances are immutable. Modifying methods return a cloned
* instance with the change. The original object is never changed.
*
* @publicApi
*/
class HttpHeaders {
/** Constructs a new HTTP header object with the given values.*/
constructor(headers) {
/**
* Internal map of lowercased header names to the normalized
* form of the name (the form seen first).
*/
this.normalizedNames = new Map();
/**
* Queued updates to be materialized the next initialization.
*/
this.lazyUpdate = null;
if (!headers) {
this.headers = new Map();
}
else if (typeof headers === 'string') {
this.lazyInit = () => {
this.headers = new Map();
headers.split('\n').forEach(line => {
const index = line.indexOf(':');
if (index > 0) {
const name = line.slice(0, index);
const key = name.toLowerCase();
const value = line.slice(index + 1).trim();
this.maybeSetNormalizedName(name, key);
if (this.headers.has(key)) {
this.headers.get(key).push(value);
}
else {
this.headers.set(key, [value]);
}
}
});
};
}
else {
this.lazyInit = () => {
this.headers = new Map();
Object.keys(headers).forEach(name => {
let values = headers[name];
const key = name.toLowerCase();
if (typeof values === 'string') {
values = [values];
}
if (values.length > 0) {
this.headers.set(key, values);
this.maybeSetNormalizedName(name, key);
}
});
};
}
}
/**
* Checks for existence of a given header.
*
* @param name The header name to check for existence.
*
* @returns True if the header exists, false otherwise.
*/
has(name) {
this.init();
return this.headers.has(name.toLowerCase());
}
/**
* Retrieves the first value of a given header.
*
* @param name The header name.
*
* @returns The value string if the header exists, null otherwise
*/
get(name) {
this.init();
const values = this.headers.get(name.toLowerCase());
return values && values.length > 0 ? values[0] : null;
}
/**
* Retrieves the names of the headers.
*
* @returns A list of header names.
*/
keys() {
this.init();
return Array.from(this.normalizedNames.values());
}
/**
* Retrieves a list of values for a given header.
*
* @param name The header name from which to retrieve values.
*
* @returns A string of values if the header exists, null otherwise.
*/
getAll(name) {
this.init();
return this.headers.get(name.toLowerCase()) || null;
}
/**
* Appends a new value to the existing set of values for a header
* and returns them in a clone of the original instance.
*
* @param name The header name for which to append the values.
* @param value The value to append.
*
* @returns A clone of the HTTP headers object with the value appended to the given header.
*/
append(name, value) {
return this.clone({ name, value, op: 'a' });
}
/**
* Sets or modifies a value for a given header in a clone of the original instance.
* If the header already exists, its value is replaced with the given value
* in the returned object.
*
* @param name The header name.
* @param value The value or values to set or overide for the given header.
*
* @returns A clone of the HTTP headers object with the newly set header value.
*/
set(name, value) {
return this.clone({ name, value, op: 's' });
}
/**
* Deletes values for a given header in a clone of the original instance.
*
* @param name The header name.
* @param value The value or values to delete for the given header.
*
* @returns A clone of the HTTP headers object with the given value deleted.
*/
delete(name, value) {
return this.clone({ name, value, op: 'd' });
}
maybeSetNormalizedName(name, lcName) {
if (!this.normalizedNames.has(lcName)) {
this.normalizedNames.set(lcName, name);
}
}
init() {
if (!!this.lazyInit) {
if (this.lazyInit instanceof HttpHeaders) {
this.copyFrom(this.lazyInit);
}
else {
this.lazyInit();
}
this.lazyInit = null;
if (!!this.lazyUpdate) {
this.lazyUpdate.forEach(update => this.applyUpdate(update));
this.lazyUpdate = null;
}
}
}
copyFrom(other) {
other.init();
Array.from(other.headers.keys()).forEach(key => {
this.headers.set(key, other.headers.get(key));
this.normalizedNames.set(key, other.normalizedNames.get(key));
});
}
clone(update) {
const clone = new HttpHeaders();
clone.lazyInit =
(!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;
clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);
return clone;
}
applyUpdate(update) {
const key = update.name.toLowerCase();
switch (update.op) {
case 'a':
case 's':
let value = update.value;
if (typeof value === 'string') {
value = [value];
}
if (value.length === 0) {
return;
}
this.maybeSetNormalizedName(update.name, key);
const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];
base.push(...value);
this.headers.set(key, base);
break;
case 'd':
const toDelete = update.value;
if (!toDelete) {
this.headers.delete(key);
this.normalizedNames.delete(key);
}
else {
let existing = this.headers.get(key);
if (!existing) {
return;
}
existing = existing.filter(value => toDelete.indexOf(value) === -1);
if (existing.length === 0) {
this.headers.delete(key);
this.normalizedNames.delete(key);
}
else {
this.headers.set(key, existing);
}
}
break;
}
}
/**
* @internal
*/
forEach(fn) {
this.init();
Array.from(this.normalizedNames.keys())
.forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Provides encoding and decoding of URL parameter and query-string values.
*
* Serializes and parses URL parameter keys and values to encode and decode them.
* If you pass URL query parameters without encoding,
* the query parameters can be misinterpreted at the receiving end.
*
*
* @publicApi
*/
class HttpUrlEncodingCodec {
/**
* Encodes a key name for a URL parameter or query-string.
* @param key The key name.
* @returns The encoded key name.
*/
encodeKey(key) {
return standardEncoding(key);
}
/**
* Encodes the value of a URL parameter or query-string.
* @param value The value.
* @returns The encoded value.
*/
encodeValue(value) {
return standardEncoding(value);
}
/**
* Decodes an encoded URL parameter or query-string key.
* @param key The encoded key name.
* @returns The decoded key name.
*/
decodeKey(key) {
return decodeURIComponent(key);
}
/**
* Decodes an encoded URL parameter or query-string value.
* @param value The encoded value.
* @returns The decoded value.
*/
decodeValue(value) {
return decodeURIComponent(value);
}
}
function paramParser(rawParams, codec) {
const map = new Map();
if (rawParams.length > 0) {
// The `window.location.search` can be used while creating an instance of the `HttpParams` class
// (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`
// may start with the `?` char, so we strip it if it's present.
const params = rawParams.replace(/^\?/, '').split('&');
params.forEach((param) => {
const eqIdx = param.indexOf('=');
const [key, val] = eqIdx == -1 ?
[codec.decodeKey(param), ''] :
[codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];
const list = map.get(key) || [];
list.push(val);
map.set(key, list);
});
}
return map;
}
function standardEncoding(v) {
return encodeURIComponent(v)
.replace(/%40/gi, '@')
.replace(/%3A/gi, ':')
.replace(/%24/gi, '$')
.replace(/%2C/gi, ',')
.replace(/%3B/gi, ';')
.replace(/%2B/gi, '+')
.replace(/%3D/gi, '=')
.replace(/%3F/gi, '?')
.replace(/%2F/gi, '/');
}
function valueToString(value) {
return `${value}`;
}
/**
* An HTTP request/response body that represents serialized parameters,
* per the MIME type `application/x-www-form-urlencoded`.
*
* This class is immutable; all mutation operations return a new instance.
*
* @publicApi
*/
class HttpParams {
constructor(options = {}) {
this.updates = null;
this.cloneFrom = null;
this.encoder = options.encoder || new HttpUrlEncodingCodec();
if (!!options.fromString) {
if (!!options.fromObject) {
throw new Error(`Cannot specify both fromString and fromObject.`);
}
this.map = paramParser(options.fromString, this.encoder);
}
else if (!!options.fromObject) {
this.map = new Map();
Object.keys(options.fromObject).forEach(key => {
const value = options.fromObject[key];
this.map.set(key, Array.isArray(value) ? value : [value]);
});
}
else {
this.map = null;
}
}
/**
* Reports whether the body includes one or more values for a given parameter.
* @param param The parameter name.
* @returns True if the parameter has one or more values,
* false if it has no value or is not present.
*/
has(param) {
this.init();
return this.map.has(param);
}
/**
* Retrieves the first value for a parameter.
* @param param The parameter name.
* @returns The first value of the given parameter,
* or `null` if the parameter is not present.
*/
get(param) {
this.init();
const res = this.map.get(param);
return !!res ? res[0] : null;
}
/**
* Retrieves all values for a parameter.
* @param param The parameter name.
* @returns All values in a string array,
* or `null` if the parameter not present.
*/
getAll(param) {
this.init();
return this.map.get(param) || null;
}
/**
* Retrieves all the parameters for this body.
* @returns The parameter names in a string array.
*/
keys() {
this.init();
return Array.from(this.map.keys());
}
/**
* Appends a new value to existing values for a parameter.
* @param param The parameter name.
* @param value The new value to add.
* @return A new body with the appended value.
*/
append(param, value) {
return this.clone({ param, value, op: 'a' });
}
/**
* Constructs a new body with appended values for the given parameter name.
* @param params parameters and values
* @return A new body with the new value.
*/
appendAll(params) {
const updates = [];
Object.keys(params).forEach(param => {
const value = params[param];
if (Array.isArray(value)) {
value.forEach(_value => {
updates.push({ param, value: _value, op: 'a' });
});
}
else {
updates.push({ param, value: value, op: 'a' });
}
});
return this.clone(updates);
}
/**
* Replaces the value for a parameter.
* @param param The parameter name.
* @param value The new value.
* @return A new body with the new value.
*/
set(param, value) {
return this.clone({ param, value, op: 's' });
}
/**
* Removes a given value or all values from a parameter.
* @param param The parameter name.
* @param value The value to remove, if provided.
* @return A new body with the given value removed, or with all values
* removed if no value is specified.
*/
delete(param, value) {
return this.clone({ param, value, op: 'd' });
}
/**
* Serializes the body to an encoded string, where key-value pairs (separated by `=`) are
* separated by `&`s.
*/
toString() {
this.init();
return this.keys()
.map(key => {
const eKey = this.encoder.encodeKey(key);
// `a: ['1']` produces `'a=1'`
// `b: []` produces `''`
// `c: ['1', '2']` produces `'c=1&c=2'`
return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))
.join('&');
})
// filter out empty values because `b: []` produces `''`
// which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't
.filter(param => param !== '')
.join('&');
}
clone(update) {
const clone = new HttpParams({ encoder: this.encoder });
clone.cloneFrom = this.cloneFrom || this;
clone.updates = (this.updates || []).concat(update);
return clone;
}
init() {
if (this.map === null) {
this.map = new Map();
}
if (this.cloneFrom !== null) {
this.cloneFrom.init();
this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));
this.updates.forEach(update => {
switch (update.op) {
case 'a':
case 's':
const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];
base.push(valueToString(update.value));
this.map.set(update.param, base);
break;
case 'd':
if (update.value !== undefined) {
let base = this.map.get(update.param) || [];
const idx = base.indexOf(valueToString(update.value));
if (idx !== -1) {
base.splice(idx, 1);
}
if (base.length > 0) {
this.map.set(update.param, base);
}
else {
this.map.delete(update.param);
}
}
else {
this.map.delete(update.param);
break;
}
}
});
this.cloneFrom = this.updates = null;
}
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* A token used to manipulate and access values stored in `HttpContext`.
*
* @publicApi
*/
class HttpContextToken {
constructor(defaultValue) {
this.defaultValue = defaultValue;
}
}
/**
* Http context stores arbitrary user defined values and ensures type safety without
* actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.
*
* This context is mutable and is shared between cloned requests unless explicitly specified.
*
* @usageNotes
*
* ### Usage Example
*
* ```typescript
* // inside cache.interceptors.ts
* export const IS_CACHE_ENABLED = new HttpContextToken(() => false);
*
* export class CacheInterceptor implements HttpInterceptor {
*
* intercept(req: HttpRequest, delegate: HttpHandler): Observable> {
* if (req.context.get(IS_CACHE_ENABLED) === true) {
* return ...;
* }
* return delegate.handle(req);
* }
* }
*
* // inside a service
*
* this.httpClient.get('/api/weather', {
* context: new HttpContext().set(IS_CACHE_ENABLED, true)
* }).subscribe(...);
* ```
*
* @publicApi
*/
class HttpContext {
constructor() {
this.map = new Map();
}
/**
* Store a value in the context. If a value is already present it will be overwritten.
*
* @param token The reference to an instance of `HttpContextToken`.
* @param value The value to store.
*
* @returns A reference to itself for easy chaining.
*/
set(token, value) {
this.map.set(token, value);
return this;
}
/**
* Retrieve the value associated with the given token.
*
* @param token The reference to an instance of `HttpContextToken`.
*
* @returns The stored value or default if one is defined.
*/
get(token) {
if (!this.map.has(token)) {
this.map.set(token, token.defaultValue());
}
return this.map.get(token);
}
/**
* Delete the value associated with the given token.
*
* @param token The reference to an instance of `HttpContextToken`.
*
* @returns A reference to itself for easy chaining.
*/
delete(token) {
this.map.delete(token);
return this;
}
/**
* @returns a list of tokens currently stored in the context.
*/
keys() {
return this.map.keys();
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Determine whether the given HTTP method may include a body.
*/
function mightHaveBody(method) {
switch (method) {
case 'DELETE':
case 'GET':
case 'HEAD':
case 'OPTIONS':
case 'JSONP':
return false;
default:
return true;
}
}
/**
* Safely assert whether the given value is an ArrayBuffer.
*
* In some execution environments ArrayBuffer is not defined.
*/
function isArrayBuffer(value) {
return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;
}
/**
* Safely assert whether the given value is a Blob.
*
* In some execution environments Blob is not defined.
*/
function isBlob(value) {
return typeof Blob !== 'undefined' && value instanceof Blob;
}
/**
* Safely assert whether the given value is a FormData instance.
*
* In some execution environments FormData is not defined.
*/
function isFormData(value) {
return typeof FormData !== 'undefined' && value instanceof FormData;
}
/**
* An outgoing HTTP request with an optional typed body.
*
* `HttpRequest` represents an outgoing request, including URL, method,
* headers, body, and other request configuration options. Instances should be
* assumed to be immutable. To modify a `HttpRequest`, the `clone`
* method should be used.
*
* @publicApi
*/
class HttpRequest {
constructor(method, url, third, fourth) {
this.url = url;
/**
* The request body, or `null` if one isn't set.
*
* Bodies are not enforced to be immutable, as they can include a reference to any
* user-defined data type. However, interceptors should take care to preserve
* idempotence by treating them as such.
*/
this.body = null;
/**
* Whether this request should be made in a way that exposes progress events.
*
* Progress events are expensive (change detection runs on each event) and so
* they should only be requested if the consumer intends to monitor them.
*/
this.reportProgress = false;
/**
* Whether this request should be sent with outgoing credentials (cookies).
*/
this.withCredentials = false;
/**
* The expected response type of the server.
*
* This is used to parse the response appropriately before returning it to
* the requestee.
*/
this.responseType = 'json';
this.method = method.toUpperCase();
// Next, need to figure out which argument holds the HttpRequestInit
// options, if any.
let options;
// Check whether a body argument is expected. The only valid way to omit
// the body argument is to use a known no-body method like GET.
if (mightHaveBody(this.method) || !!fourth) {
// Body is the third argument, options are the fourth.
this.body = (third !== undefined) ? third : null;
options = fourth;
}
else {
// No body required, options are the third argument. The body stays null.
options = third;
}
// If options have been passed, interpret them.
if (options) {
// Normalize reportProgress and withCredentials.
this.reportProgress = !!options.reportProgress;
this.withCredentials = !!options.withCredentials;
// Override default response type of 'json' if one is provided.
if (!!options.responseType) {
this.responseType = options.responseType;
}
// Override headers if they're provided.
if (!!options.headers) {
this.headers = options.headers;
}
if (!!options.context) {
this.context = options.context;
}
if (!!options.params) {
this.params = options.params;
}
}
// If no headers have been passed in, construct a new HttpHeaders instance.
if (!this.headers) {
this.headers = new HttpHeaders();
}
// If no context have been passed in, construct a new HttpContext instance.
if (!this.context) {
this.context = new HttpContext();
}
// If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.
if (!this.params) {
this.params = new HttpParams();
this.urlWithParams = url;
}
else {
// Encode the parameters to a string in preparation for inclusion in the URL.
const params = this.params.toString();
if (params.length === 0) {
// No parameters, the visible URL is just the URL given at creation time.
this.urlWithParams = url;
}
else {
// Does the URL already have query parameters? Look for '?'.
const qIdx = url.indexOf('?');
// There are 3 cases to handle:
// 1) No existing parameters -> append '?' followed by params.
// 2) '?' exists and is followed by existing query string ->
// append '&' followed by params.
// 3) '?' exists at the end of the url -> append params directly.
// This basically amounts to determining the character, if any, with
// which to join the URL and parameters.
const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');
this.urlWithParams = url + sep + params;
}
}
}
/**
* Transform the free-form body into a serialized format suitable for
* transmission to the server.
*/
serializeBody() {
// If no body is present, no need to serialize it.
if (this.body === null) {
return null;
}
// Check whether the body is already in a serialized form. If so,
// it can just be returned directly.
if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||
typeof this.body === 'string') {
return this.body;
}
// Check whether the body is an instance of HttpUrlEncodedParams.
if (this.body instanceof HttpParams) {
return this.body.toString();
}
// Check whether the body is an object or array, and serialize with JSON if so.
if (typeof this.body === 'object' || typeof this.body === 'boolean' ||
Array.isArray(this.body)) {
return JSON.stringify(this.body);
}
// Fall back on toString() for everything else.
return this.body.toString();
}
/**
* Examine the body and attempt to infer an appropriate MIME type
* for it.
*
* If no such type can be inferred, this method will return `null`.
*/
detectContentTypeHeader() {
// An empty body has no content type.
if (this.body === null) {
return null;
}
// FormData bodies rely on the browser's content type assignment.
if (isFormData(this.body)) {
return null;
}
// Blobs usually have their own content type. If it doesn't, then
// no type can be inferred.
if (isBlob(this.body)) {
return this.body.type || null;
}
// Array buffers have unknown contents and thus no type can be inferred.
if (isArrayBuffer(this.body)) {
return null;
}
// Technically, strings could be a form of JSON data, but it's safe enough
// to assume they're plain strings.
if (typeof this.body === 'string') {
return 'text/plain';
}
// `HttpUrlEncodedParams` has its own content-type.
if (this.body instanceof HttpParams) {
return 'application/x-www-form-urlencoded;charset=UTF-8';
}
// Arrays, objects, boolean and numbers will be encoded as JSON.
if (typeof this.body === 'object' || typeof this.body === 'number' ||
typeof this.body === 'boolean') {
return 'application/json';
}
// No type could be inferred.
return null;
}
clone(update = {}) {
var _a;
// For method, url, and responseType, take the current value unless
// it is overridden in the update hash.
const method = update.method || this.method;
const url = update.url || this.url;
const responseType = update.responseType || this.responseType;
// The body is somewhat special - a `null` value in update.body means
// whatever current body is present is being overridden with an empty
// body, whereas an `undefined` value in update.body implies no
// override.
const body = (update.body !== undefined) ? update.body : this.body;
// Carefully handle the boolean options to differentiate between
// `false` and `undefined` in the update args.
const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;
const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;
// Headers and params may be appended to if `setHeaders` or
// `setParams` are used.
let headers = update.headers || this.headers;
let params = update.params || this.params;
// Pass on context if needed
const context = (_a = update.context) !== null && _a !== void 0 ? _a : this.context;
// Check whether the caller has asked to add headers.
if (update.setHeaders !== undefined) {
// Set every requested header.
headers =
Object.keys(update.setHeaders)
.reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);
}
// Check whether the caller has asked to set params.
if (update.setParams) {
// Set every requested param.
params = Object.keys(update.setParams)
.reduce((params, param) => params.set(param, update.setParams[param]), params);
}
// Finally, construct the new HttpRequest using the pieces from above.
return new HttpRequest(method, url, body, {
params,
headers,
context,
reportProgress,
responseType,
withCredentials,
});
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Type enumeration for the different kinds of `HttpEvent`.
*
* @publicApi
*/
var HttpEventType;
(function (HttpEventType) {
/**
* The request was sent out over the wire.
*/
HttpEventType[HttpEventType["Sent"] = 0] = "Sent";
/**
* An upload progress event was received.
*/
HttpEventType[HttpEventType["UploadProgress"] = 1] = "UploadProgress";
/**
* The response status code and headers were received.
*/
HttpEventType[HttpEventType["ResponseHeader"] = 2] = "ResponseHeader";
/**
* A download progress event was received.
*/
HttpEventType[HttpEventType["DownloadProgress"] = 3] = "DownloadProgress";
/**
* The full response including the body was received.
*/
HttpEventType[HttpEventType["Response"] = 4] = "Response";
/**
* A custom event from an interceptor or a backend.
*/
HttpEventType[HttpEventType["User"] = 5] = "User";
})(HttpEventType || (HttpEventType = {}));
/**
* Base class for both `HttpResponse` and `HttpHeaderResponse`.
*
* @publicApi
*/
class HttpResponseBase {
/**
* Super-constructor for all responses.
*
* The single parameter accepted is an initialization hash. Any properties
* of the response passed there will override the default values.
*/
constructor(init, defaultStatus = 200 /* Ok */, defaultStatusText = 'OK') {
// If the hash has values passed, use them to initialize the response.
// Otherwise use the default values.
this.headers = init.headers || new HttpHeaders();
this.status = init.status !== undefined ? init.status : defaultStatus;
this.statusText = init.statusText || defaultStatusText;
this.url = init.url || null;
// Cache the ok value to avoid defining a getter.
this.ok = this.status >= 200 && this.status < 300;
}
}
/**
* A partial HTTP response which only includes the status and header data,
* but no response body.
*
* `HttpHeaderResponse` is a `HttpEvent` available on the response
* event stream, only when progress events are requested.
*
* @publicApi
*/
class HttpHeaderResponse extends HttpResponseBase {
/**
* Create a new `HttpHeaderResponse` with the given parameters.
*/
constructor(init = {}) {
super(init);
this.type = HttpEventType.ResponseHeader;
}
/**
* Copy this `HttpHeaderResponse`, overriding its contents with the
* given parameter hash.
*/
clone(update = {}) {
// Perform a straightforward initialization of the new HttpHeaderResponse,
// overriding the current parameters with new ones if given.
return new HttpHeaderResponse({
headers: update.headers || this.headers,
status: update.status !== undefined ? update.status : this.status,
statusText: update.statusText || this.statusText,
url: update.url || this.url || undefined,
});
}
}
/**
* A full HTTP response, including a typed response body (which may be `null`
* if one was not returned).
*
* `HttpResponse` is a `HttpEvent` available on the response event
* stream.
*
* @publicApi
*/
class HttpResponse extends HttpResponseBase {
/**
* Construct a new `HttpResponse`.
*/
constructor(init = {}) {
super(init);
this.type = HttpEventType.Response;
this.body = init.body !== undefined ? init.body : null;
}
clone(update = {}) {
return new HttpResponse({
body: (update.body !== undefined) ? update.body : this.body,
headers: update.headers || this.headers,
status: (update.status !== undefined) ? update.status : this.status,
statusText: update.statusText || this.statusText,
url: update.url || this.url || undefined,
});
}
}
/**
* A response that represents an error or failure, either from a
* non-successful HTTP status, an error while executing the request,
* or some other failure which occurred during the parsing of the response.
*
* Any error returned on the `Observable` response stream will be
* wrapped in an `HttpErrorResponse` to provide additional context about
* the state of the HTTP layer when the error occurred. The error property
* will contain either a wrapped Error object or the error response returned
* from the server.
*
* @publicApi
*/
class HttpErrorResponse extends HttpResponseBase {
constructor(init) {
// Initialize with a default status of 0 / Unknown Error.
super(init, 0, 'Unknown Error');
this.name = 'HttpErrorResponse';
/**
* Errors are never okay, even when the status code is in the 2xx success range.
*/
this.ok = false;
// If the response was successful, then this was a parse error. Otherwise, it was
// a protocol-level failure of some sort. Either the request failed in transit
// or the server returned an unsuccessful status code.
if (this.status >= 200 && this.status < 300) {
this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;
}
else {
this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;
}
this.error = init.error || null;
}
}
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and
* the given `body`. This function clones the object and adds the body.
*
* Note that the `responseType` *options* value is a String that identifies the
* single data type of the response.
* A single overload version of the method handles each response type.
* The value of `responseType` cannot be a union, as the combined signature could imply.
*
*/
function addBody(options, body) {
return {
body,
headers: options.headers,
context: options.context,
observe: options.observe,
params: options.params,
reportProgress: options.reportProgress,
responseType: options.responseType,
withCredentials: options.withCredentials,
};
}
/**
* Performs HTTP requests.
* This service is available as an injectable class, with methods to perform HTTP requests.
* Each request method has multiple signatures, and the return type varies based on
* the signature that is called (mainly the values of `observe` and `responseType`).
*
* Note that the `responseType` *options* value is a String that identifies the
* single data type of the response.
* A single overload version of the method handles each response type.
* The value of `responseType` cannot be a union, as the combined signature could imply.
*
* @usageNotes
* Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application.
*
* ### HTTP Request Example
*
* ```
* // GET heroes whose name contains search term
* searchHeroes(term: string): observable{
*
* const params = new HttpParams({fromString: 'name=term'});
* return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});
* }
* ```
*
* Alternatively, the parameter string can be used without invoking HttpParams
* by directly joining to the URL.
* ```
* this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});
* ```
*
*
* ### JSONP Example
* ```
* requestJsonp(url, callback = 'callback') {
* return this.httpClient.jsonp(this.heroesURL, callback);
* }
* ```
*
* ### PATCH Example
* ```
* // PATCH one of the heroes' name
* patchHero (id: number, heroName: string): Observable<{}> {
* const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42
* return this.httpClient.patch(url, {name: heroName}, httpOptions)
* .pipe(catchError(this.handleError('patchHero')));
* }
* ```
*
* @see [HTTP Guide](guide/http)
* @see [HTTP Request](api/common/http/HttpRequest)
*
* @publicApi
*/
class HttpClient {
constructor(handler) {
this.handler = handler;
}
/**
* Constructs an observable for a generic HTTP request that, when subscribed,
* fires the request through the chain of registered interceptors and on to the
* server.
*
* You can pass an `HttpRequest` directly as the only parameter. In this case,
* the call returns an observable of the raw `HttpEvent` stream.
*
* Alternatively you can pass an HTTP method as the first parameter,
* a URL string as the second, and an options hash containing the request body as the third.
* See `addBody()`. In this case, the specified `responseType` and `observe` options determine the
* type of returned observable.
* * The `responseType` value determines how a successful response body is parsed.
* * If `responseType` is the default `json`, you can pass a type interface for the resulting
* object as a type parameter to the call.
*
* The `observe` value determines the return type, according to what you are interested in
* observing.
* * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including
* progress events by default.
* * An `observe` value of response returns an observable of `HttpResponse`,
* where the `T` parameter depends on the `responseType` and any optionally provided type
* parameter.
* * An `observe` value of body returns an observable of `` with the same `T` body type.
*
*/
request(first, url, options = {}) {
let req;
// First, check whether the primary argument is an instance of `HttpRequest`.
if (first instanceof HttpRequest) {
// It is. The other arguments must be undefined (per the signatures) and can be
// ignored.
req = first;
}
else {
// It's a string, so it represents a URL. Construct a request based on it,
// and incorporate the remaining arguments (assuming `GET` unless a method is
// provided.
// Figure out the headers.
let headers = undefined;
if (options.headers instanceof HttpHeaders) {
headers = options.headers;
}
else {
headers = new HttpHeaders(options.headers);
}
// Sort out parameters.
let params = undefined;
if (!!options.params) {
if (options.params instanceof HttpParams) {
params = options.params;
}
else {
params = new HttpParams({ fromObject: options.params });
}
}
// Construct the request.
req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {
headers,
context: options.context,
params,
reportProgress: options.reportProgress,
// By default, JSON is assumed to be returned for all calls.
responseType: options.responseType || 'json',
withCredentials: options.withCredentials,
});
}
// Start with an Observable.of() the initial request, and run the handler (which
// includes all interceptors) inside a concatMap(). This way, the handler runs
// inside an Observable chain, which causes interceptors to be re-run on every
// subscription (this also makes retries re-run the handler, including interceptors).
const events$ = (0,rxjs__WEBPACK_IMPORTED_MODULE_0__.of)(req).pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_1__.concatMap)((req) => this.handler.handle(req)));
// If coming via the API signature which accepts a previously constructed HttpRequest,
// the only option is to get the event stream. Otherwise, return the event stream if
// that is what was requested.
if (first instanceof HttpRequest || options.observe === 'events') {
return events$;
}
// The requested stream contains either the full response or the body. In either
// case, the first step is to filter the event stream to extract a stream of
// responses(s).
const res$ = events$.pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_2__.filter)((event) => event instanceof HttpResponse));
// Decide which stream to return.
switch (options.observe || 'body') {
case 'body':
// The requested stream is the body. Map the response stream to the response
// body. This could be done more simply, but a misbehaving interceptor might
// transform the response body into a different format and ignore the requested
// responseType. Guard against this by validating that the response is of the
// requested type.
switch (req.responseType) {
case 'arraybuffer':
return res$.pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_3__.map)((res) => {
// Validate that the body is an ArrayBuffer.
if (res.body !== null && !(res.body instanceof ArrayBuffer)) {
throw new Error('Response is not an ArrayBuffer.');
}
return res.body;
}));
case 'blob':
return res$.pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_3__.map)((res) => {
// Validate that the body is a Blob.
if (res.body !== null && !(res.body instanceof Blob)) {
throw new Error('Response is not a Blob.');
}
return res.body;
}));
case 'text':
return res$.pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_3__.map)((res) => {
// Validate that the body is a string.
if (res.body !== null && typeof res.body !== 'string') {
throw new Error('Response is not a string.');
}
return res.body;
}));
case 'json':
default:
// No validation needed for JSON responses, as they can be of any type.
return res$.pipe((0,rxjs_operators__WEBPACK_IMPORTED_MODULE_3__.map)((res) => res.body));
}
case 'response':
// The response stream was requested directly, so return it.
return res$;
default:
// Guard against new future observe types being added.
throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);
}
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `DELETE` request to execute on the server. See the individual overloads for
* details on the return type.
*
* @param url The endpoint URL.
* @param options The HTTP options to send with the request.
*
*/
delete(url, options = {}) {
return this.request('DELETE', url, options);
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `GET` request to execute on the server. See the individual overloads for
* details on the return type.
*/
get(url, options = {}) {
return this.request('GET', url, options);
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `HEAD` request to execute on the server. The `HEAD` method returns
* meta information about the resource without transferring the
* resource itself. See the individual overloads for
* details on the return type.
*/
head(url, options = {}) {
return this.request('HEAD', url, options);
}
/**
* Constructs an `Observable` that, when subscribed, causes a request with the special method
* `JSONP` to be dispatched via the interceptor pipeline.
* The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain
* API endpoints that don't support newer,
* and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.
* JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the
* requests even if the API endpoint is not located on the same domain (origin) as the client-side
* application making the request.
* The endpoint API must support JSONP callback for JSONP requests to work.
* The resource API returns the JSON response wrapped in a callback function.
* You can pass the callback function name as one of the query parameters.
* Note that JSONP requests can only be used with `GET` requests.
*
* @param url The resource URL.
* @param callbackParam The callback function name.
*
*/
jsonp(url, callbackParam) {
return this.request('JSONP', url, {
params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),
observe: 'body',
responseType: 'json',
});
}
/**
* Constructs an `Observable` that, when subscribed, causes the configured
* `OPTIONS` request to execute on the server. This method allows the client
* to determine the supported HTTP methods and other capabilites of an endpoint,
* without implying a resource action. See the individual overloads for
* details on the return type.
*/
options(url, options = {}) {
return this.request('OPTIONS', url, options);
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `PATCH` request to execute on the server. See the individual overloads for
* details on the return type.
*/
patch(url, body, options = {}) {
return this.request('PATCH', url, addBody(options, body));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `POST` request to execute on the server. The server responds with the location of
* the replaced resource. See the individual overloads for
* details on the return type.
*/
post(url, body, options = {}) {
return this.request('POST', url, addBody(options, body));
}
/**
* Constructs an observable that, when subscribed, causes the configured
* `PUT` request to execute on the server. The `PUT` method replaces an existing resource
* with a new set of values.
* See the individual overloads for details on the return type.
*/
put(url, body, options = {}) {
return this.request('PUT', url, addBody(options, body));
}
}
HttpClient.ɵfac = function HttpClient_Factory(t) { return new (t || HttpClient)(_angular_core__WEBPACK_IMPORTED_MODULE_4__["ɵɵinject"](HttpHandler)); };
HttpClient.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_4__["ɵɵdefineInjectable"]({ token: HttpClient, factory: HttpClient.ɵfac });
HttpClient.ctorParameters = () => [
{ type: HttpHandler }
];
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_4__["ɵsetClassMetadata"](HttpClient, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_4__.Injectable
}], function () { return [{ type: HttpHandler }]; }, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
/**
* `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`.
*
*
*/
class HttpInterceptorHandler {
constructor(next, interceptor) {
this.next = next;
this.interceptor = interceptor;
}
handle(req) {
return this.interceptor.intercept(req, this.next);
}
}
/**
* A multi-provider token that represents the array of registered
* `HttpInterceptor` objects.
*
* @publicApi
*/
const HTTP_INTERCEPTORS = new _angular_core__WEBPACK_IMPORTED_MODULE_4__.InjectionToken('HTTP_INTERCEPTORS');
class NoopInterceptor {
intercept(req, next) {
return next.handle(req);
}
}
NoopInterceptor.ɵfac = function NoopInterceptor_Factory(t) { return new (t || NoopInterceptor)(); };
NoopInterceptor.ɵprov = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_4__["ɵɵdefineInjectable"]({ token: NoopInterceptor, factory: NoopInterceptor.ɵfac });
(function () { (typeof ngDevMode === "undefined" || ngDevMode) && _angular_core__WEBPACK_IMPORTED_MODULE_4__["ɵsetClassMetadata"](NoopInterceptor, [{
type: _angular_core__WEBPACK_IMPORTED_MODULE_4__.Injectable
}], null, null); })();
/**
* @license
* Copyright Google LLC All Rights Reserved.
*
* Use of this source code is governed by an MIT-style license that can be
* found in the LICENSE file at https://angular.io/license
*/
// Every request made through JSONP needs a callback name that's unique across the
// whole page. Each request is assigned an id and the callback name is constructed
// from that. The next id to be assigned is tracked in a global variable here that
// is shared among all applications on the page.
let nextRequestId = 0;
// Error text given when a JSONP script is injected, but doesn't invoke the callback
// passed in its URL.
const JSONP_ERR_NO_CALLBACK = 'JSONP injected script did not invoke callback.';
// Error text given when a request is passed to the JsonpClientBackend that doesn't
// have a request method JSONP.
const JSONP_ERR_WRONG_METHOD = 'JSONP requests must use JSONP request method.';
const JSONP_ERR_WRONG_RESPONSE_TYPE = 'JSONP requests must use Json response type.';
/**
* DI token/abstract type representing a map of JSONP callbacks.
*
* In the browser, this should always be the `window` object.
*
*
*/
class JsonpCallbackContext {
}
/**
* Processes an `HttpRequest` with the JSONP method,
* by performing JSONP style requests.
* @see `HttpHandler`
* @see `HttpXhrBackend`
*
* @publicApi
*/
class JsonpClientBackend {
constructor(callbackMap, document) {
this.callbackMap = callbackMap;
this.document = document;
/**
* A resolved promise that can be used to schedule microtasks in the event handlers.
*/
this.resolvedPromise = Promise.resolve();
}
/**
* Get the name of the next callback method, by incrementing the global `nextRequestId`.
*/
nextCallback() {
return `ng_jsonp_callback_${nextRequestId++}`;
}
/**
* Processes a JSONP request and returns an event stream of the results.
* @param req The request object.
* @returns An observable of the response events.
*
*/
handle(req) {
// Firstly, check both the method and response type. If either doesn't match
// then the request was improperly routed here and cannot be handled.
if (req.method !== 'JSONP') {
throw new Error(JSONP_ERR_WRONG_METHOD);
}
else if (req.responseType !== 'json') {
throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE);
}
// Everything else happens inside the Observable boundary.
return new rxjs__WEBPACK_IMPORTED_MODULE_5__.Observable((observer) => {
// The first step to make a request is to generate the callback name, and replace the
// callback placeholder in the URL with the name. Care has to be taken here to ensure
// a trailing &, if matched, gets inserted back into the URL in the correct place.
const callback = this.nextCallback();
const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`);
// Construct the